diff --git "a/dynamic_chem.json" "b/dynamic_chem.json" new file mode 100644--- /dev/null +++ "b/dynamic_chem.json" @@ -0,0 +1,26002 @@ +[ + { + "question": "What is the SMILES expression of C10H22N2S?\nAnswer:", + "answer": [ + "CC(C)CNC(CN)C1CCSC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (2R,5S)-5-ethyl-2-methylnonanal?\nAnswer:", + "answer": [ + "C12H24O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (3E,6E)-5,5-dimethylocta-1,3,6-triene?\nAnswer (numerical number):", + "answer": [ + "136.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-amino-3-pentan-2-yloxypropanenitrile?\nAnswer:", + "answer": [ + "CCCC(C)OCC(C#N)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H18O3?\nAnswer (numerical number):", + "answer": [ + "162.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-[(E)-3-piperidin-4-ylprop-2-enylidene]methanimidamide?\nAnswer:", + "answer": [ + "C9H15N3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 4-[(2,2-difluoro-3-hydroxypropyl)amino]butan-1-ol?\nAnswer (numerical number):", + "answer": [ + "183.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C(#N)SNC(=NN)N?\nAnswer (numerical number):", + "answer": [ + "131.16" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H14O?\nAnswer:", + "answer": [ + "CCCC(CC=C)C=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (E)-1-hydroperoxy-2-methylbut-1-ene?\nAnswer:", + "answer": [ + "C5H10O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (3R)-1-(2H-tetrazol-5-yl)pyrrolidin-3-ol?\nAnswer:", + "answer": [ + "C1CN(CC1O)C2=NNN=N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 5-hydroxy-N-(3-hydroxy-4-methoxybutyl)pentanamide?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N,N,N'-trimethyl-N'-(1H-pyrrol-2-yl)ethane-1,2-diamine?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C6H6N2O?\nAnswer (numerical number):", + "answer": [ + 15 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CN1CCCC(C1)C(=O)ON?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H14ClN5?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 4-iodo-4-methylhex-5-enoic acid?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H17NO2S?\nAnswer:", + "answer": [ + "3-ethylsulfanyl-1-morpholin-4-ylpropan-1-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C13H27NO?\nAnswer:", + "answer": [ + "CCCNC(CC)CCC1CCCOC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H16OS2?\nAnswer:", + "answer": [ + "4-methyl-5,6-bis(sulfanyl)hexan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 4-aminocyclohexa-2,4-diene-1-thione?\nAnswer:", + "answer": [ + "C6H7NS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H24O?\nAnswer:", + "answer": [ + "CCC(C)(C)OC(C)(CC)CC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CC(CC1CNCC(CO)O)O?\nAnswer:", + "answer": [ + "C9H19NO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C(CCl)C(CCCl)O?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1CC(C(NC1)C)C\nAnswer:", + "answer": [ + "(2R,3S,5R)-2,3,5-trimethylpiperidine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (5R)-5-(1,3-thiazol-4-yl)-1,4-oxazepane?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H12O3?\nAnswer (numerical number):", + "answer": [ + "144.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-(3-oxobutyl)diazinan-3-one?\nAnswer (numerical number):", + "answer": [ + "170.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H18N2O?\nAnswer:", + "answer": [ + "6-amino-2-propan-2-ylidenehexanamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-(5-bromo-2-methyl-1,2,4-triazol-3-yl)propan-1-amine?\nAnswer (numerical number):", + "answer": [ + 22 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H25NO2?\nAnswer (numerical number):", + "answer": [ + "203.32" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 5-ethyl-3,5-dimethylhept-3-ene?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H13NS?\nAnswer (numerical number):", + "answer": [ + "155.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCCCCN(C)C(C)CCC\nAnswer:", + "answer": [ + "N-methyl-N-pentan-2-ylhexan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 8-[(2-methylpropan-2-yl)oxy]oct-1-yne?\nAnswer (numerical number):", + "answer": [ + "182.30" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C=CCC(=O)NC1CCCCC1CO\nAnswer:", + "answer": [ + "N-[2-(hydroxymethyl)cyclohexyl]but-3-enamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C12H26O4?\nAnswer (numerical number):", + "answer": [ + "234.33" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(CCC(C=C)C(C)O)O?\nAnswer (numerical number):", + "answer": [ + "158.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-methoxy-3-(4-methylpiperidin-3-yl)oxypropan-2-ol?\nAnswer:", + "answer": [ + "C10H21NO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-(2-fluoropropan-2-yl)-5-methylhexan-1-amine?\nAnswer (numerical number):", + "answer": [ + "175.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCCC(C#N)N?\nAnswer:", + "answer": [ + "C6H12N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(=COC)C(=O)O.Cl?\nAnswer:", + "answer": [ + "C5H9ClO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(CCN)(C1CCN(C1)C)F\nAnswer:", + "answer": [ + "3-fluoro-3-(1-methylpyrrolidin-3-yl)butan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H22O2?\nAnswer:", + "answer": [ + "(3S,6R)-3,7-dimethyloctane-1,6-diol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1CC(C1)C2=NOC(C2)N\nAnswer:", + "answer": [ + "3-cyclobutyl-4,5-dihydro-1,2-oxazol-5-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C15H32O2?\nAnswer:", + "answer": [ + "CCCCCCCCCCCCC(C)OOC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H20N2?\nAnswer (numerical number):", + "answer": [ + "180.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC(=O)C(C)C(C)O?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CC(SC1)C(CN)(F)F?\nAnswer (numerical number):", + "answer": [ + "167.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-(ethoxymethyl)-N-(2-methoxyethyl)-2-methylbut-3-en-1-amine?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CN1N=C(N=N1)CC(CO)CO?\nAnswer:", + "answer": [ + "C6H12N4O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C14H27Br?\nAnswer (numerical number):", + "answer": [ + "275.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C12H21NO?\nAnswer:", + "answer": [ + "[1-[(pent-3-ynylamino)methyl]cyclopentyl]methanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-but-2-en-2-yl-9-phosphabicyclo[3.3.1]nonane?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of COC1COC2C1OCC2OC\nAnswer:", + "answer": [ + "3,6-dimethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H14N2O2?\nAnswer:", + "answer": [ + "C1COCCC1C2CNC(=O)N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of O-(pyrrolidin-1-ylmethyl) methylsulfanylmethanethioate?\nAnswer:", + "answer": [ + "CSC(=S)OCN1CCCC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H13ClOS?\nAnswer:", + "answer": [ + "2-(3-chloro-2-methylprop-2-enyl)sulfanylpropan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCN(CCC#CC)C1CCNC1?\nAnswer (numerical number):", + "answer": [ + "180.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of pyrrolidin-2-ylboronic acid?\nAnswer (numerical number):", + "answer": [ + "114.94" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C6H13BrO2S?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CNC1CCCCCC1N2CCOCC2?\nAnswer:", + "answer": [ + "C12H24N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H12N2O?\nAnswer:", + "answer": [ + "C1CCC(C(C1)N)N=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H11ClN2S?\nAnswer (numerical number):", + "answer": [ + "178.68" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 6-propyl-6-azabicyclo[3.1.0]hexan-2-one?\nAnswer:", + "answer": [ + "C8H13NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H21NO?\nAnswer (numerical number):", + "answer": [ + "159.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H23NOS?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(CO)OCC(COC(C)CO)O\nAnswer:", + "answer": [ + "1,3-bis(1-hydroxypropan-2-yloxy)propan-2-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2R)-3-[[(2R)-butan-2-yl]amino]-1,1,1-trifluoropropan-2-ol?\nAnswer:", + "answer": [ + "CCC(C)NCC(C(F)(F)F)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H13FO2?\nAnswer (numerical number):", + "answer": [ + "172.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of methyl 4-amino-3-(propan-2-ylamino)butanoate?\nAnswer:", + "answer": [ + "CC(C)NC(CC(=O)OC)CN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1,1,2,3-tetraethylguanidine?\nAnswer (numerical number):", + "answer": [ + "171.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (5-ethyl-1-propan-2-ylpyrazol-3-yl)methanamine?\nAnswer (numerical number):", + "answer": [ + "167.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H22O?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(OS(=O)C(C)S)S?\nAnswer:", + "answer": [ + "C4H10O2S3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)(C)C1CC=NN1C?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 4,4-dimethyl-1-methylsulfanylhexane?\nAnswer:", + "answer": [ + "CCC(C)(C)CCCSC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of methyl (3S)-3-amino-4-methylhexanoate?\nAnswer:", + "answer": [ + "C8H17NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC1C(=O)NC(=S)S1?\nAnswer (numerical number):", + "answer": [ + "161.3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H10FNO?\nAnswer (numerical number):", + "answer": [ + "167.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H21NOS?\nAnswer:", + "answer": [ + "(1S,2S)-N-(2-methoxyethyl)-N-methyl-2-methylsulfanylcyclopentan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H17N3O?\nAnswer:", + "answer": [ + "CC(CNCC(=C)C)C(=NO)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H17N?\nAnswer:", + "answer": [ + "C1CCCC2C(CC1)CN2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (1S,2R)-N-ethyl-2-pyrrolidin-1-ylcycloheptan-1-amine?\nAnswer:", + "answer": [ + "CCNC1CCCCCC1N2CCCC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in ethyl 1-(methylaminomethyl)cyclopropane-1-carboxylate?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1CCC(C1)(CN)C(O)O\nAnswer:", + "answer": [ + "[1-(aminomethyl)cyclopentyl]methanediol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (2S)-N-[(2S)-butan-2-yl]morpholine-2-carboxamide?\nAnswer (numerical number):", + "answer": [ + "186.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-ethenyl-7-thiabicyclo[4.1.0]hept-1(6)-ene?\nAnswer (numerical number):", + "answer": [ + "138.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C12H27NO2?\nAnswer:", + "answer": [ + "1-(hexylamino)-4-methoxy-2-methylbutan-2-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in methyl 2-[3-(methylaminomethyl)cyclobutyl]oxyacetate?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1(CC1)CNCC(=C)Br?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H17NO3?\nAnswer (numerical number):", + "answer": [ + "175.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H14O?\nAnswer:", + "answer": [ + "CC12CCCC(C1C2)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C12H25NO?\nAnswer:", + "answer": [ + "N-ethyl-4-(oxan-3-yl)pentan-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-methoxy-3-(morpholin-2-ylmethoxy)propan-2-ol?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H10BrNS?\nAnswer (numerical number):", + "answer": [ + "244.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-(difluoromethyl)-5-methyl-1,2-oxazole?\nAnswer (numerical number):", + "answer": [ + 14 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H11FO2?\nAnswer (numerical number):", + "answer": [ + "134.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H17NOS?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of nitroxyl;1,3-thiazole?\nAnswer:", + "answer": [ + "C1=CSC=N1.N=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-amine?\nAnswer:", + "answer": [ + "C10H17N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H18ClNO?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC#CCCC(C1CCCCS1)O?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 4-(4-methylpiperidin-3-yl)oxybutan-2-ol?\nAnswer:", + "answer": [ + "CC1CCNCC1OCCC(C)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C5H11ClN2O?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (3S)-3-methyloxane-2-thiol?\nAnswer:", + "answer": [ + "C6H12OS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-[(E)-ethylideneamino]-2-methylguanidine?\nAnswer:", + "answer": [ + "C4H10N4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1(CN(C1)C(CO)COC)C\nAnswer:", + "answer": [ + "2-(3,3-dimethylazetidin-1-yl)-3-methoxypropan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H11I?\nAnswer:", + "answer": [ + "CCC#CC1=CC=CC(=C1)CI" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H9BrS?\nAnswer:", + "answer": [ + "(1S)-1-(4-bromophenyl)ethanethiol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(=O)C=CC=COO?\nAnswer:", + "answer": [ + "C6H8O3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C4H12O4?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H20N2S?\nAnswer:", + "answer": [ + "7-isothiocyanato-N,N-dimethylheptan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (E)-N-[(Z)-ethylideneamino]but-1-en-1-amine?\nAnswer:", + "answer": [ + "CCC=CNN=CC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 5-methyl-N-propan-2-ylpyrazin-2-amine?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (8R,8aS)-2,7-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol?\nAnswer:", + "answer": [ + "C9H16O4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C5H11NO3S?\nAnswer:", + "answer": [ + "C1CS(=O)(=O)CC1CNO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H18N2O?\nAnswer (numerical number):", + "answer": [ + "170.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H13F3N2?\nAnswer:", + "answer": [ + "CN1CCNCCC1C(F)(F)F" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-formyl-N-methylcyclopropanecarboxamide?\nAnswer:", + "answer": [ + "CN(C=O)C(=O)C1CC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-(3-chloro-2-methylprop-2-enyl)pentan-1-amine?\nAnswer:", + "answer": [ + "CCCCCNCC(=CCl)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(C)CCC(C)(O)O?\nAnswer:", + "answer": [ + "C8H18O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H21NO2?\nAnswer (numerical number):", + "answer": [ + "187.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC1=CSC(=N1)CC(C)O?\nAnswer:", + "answer": [ + "C8H13NOS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1(C(=O)N(N=N1)C)C?\nAnswer:", + "answer": [ + "C5H9N3O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C12H22O?\nAnswer (numerical number):", + "answer": [ + 35 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H20O?\nAnswer (numerical number):", + "answer": [ + "168.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H17NO2S?\nAnswer:", + "answer": [ + "C1CSCC1CNCC(CO)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H15N?\nAnswer:", + "answer": [ + "N-(2-methylbut-3-yn-2-yl)pent-3-yn-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCCCCCCCCC(C)OOOC?\nAnswer:", + "answer": [ + "C13H28O3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC#CC(C)(C)C=NC#CC?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 5-methylthiolan-2-ol?\nAnswer (numerical number):", + "answer": [ + 17 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H13N3?\nAnswer (numerical number):", + "answer": [ + "139.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H16O4?\nAnswer:", + "answer": [ + "COCC1C=CC(C(O1)OC)OC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (2R,4R)-2-methyl-4-thiophen-2-ylpiperidine?\nAnswer (numerical number):", + "answer": [ + "181.30" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CN(CC(=C)O)CC(=O)O\nAnswer:", + "answer": [ + "2-[2-hydroxyprop-2-enyl(methyl)amino]acetic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCNC(=O)NCCCC(C)N?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCOC(=O)C1CCCCC=CC1?\nAnswer:", + "answer": [ + "C11H18O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(C)(C)C#CCBr.P\nAnswer:", + "answer": [ + "1-bromo-4,4-dimethylpent-2-yne;phosphane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCC(CCC1CCCOC1)N\nAnswer:", + "answer": [ + "1-(oxan-3-yl)hexan-3-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in COCC(CCN1CC(C1=O)N)O?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of but-2-yne;ethane;propane;sulfanylidene-(sulfanylidene-\u00ce\u00bb4-sulfanylidene)-\u00ce\u00bb4-sulfane?\nAnswer:", + "answer": [ + "C9H20S4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-[[(2S)-1,4-dithian-2-yl]methyl]-3-prop-2-ynylurea?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-bromo-4-propyl-4,5-dihydro-1,3-thiazole?\nAnswer:", + "answer": [ + "C6H10BrNS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H19N?\nAnswer:", + "answer": [ + "1,4-dimethyl-6-propyl-3,6-dihydro-2H-pyridine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 5-[(1-methylimidazol-2-yl)amino]pentan-2-ol?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCC(C(=O)OCCOC)O?\nAnswer (numerical number):", + "answer": [ + "176.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H18O3?\nAnswer:", + "answer": [ + "CCCC(C(CC)(CO)O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2S)-2-piperazin-1-yl-1-azabicyclo[2.2.2]octane?\nAnswer:", + "answer": [ + "C1CN2CCC1CC2N3CCNCC3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H18N2O2?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2,2-difluoro-2-(oxan-2-yl)ethanamine?\nAnswer (numerical number):", + "answer": [ + "165.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H8O2?\nAnswer (numerical number):", + "answer": [ + "136.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (1S,2S)-2-aminocycloheptane-1-carboxamide?\nAnswer (numerical number):", + "answer": [ + "156.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(CNC1CCNCC1)N(C)C\nAnswer:", + "answer": [ + "(2S)-2-N,2-N-dimethyl-1-N-piperidin-4-ylpropane-1,2-diamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (2Z,4Z,6Z)-2,3-dimethoxyocta-2,4,6-triene?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H15NO?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H10F3NO2?\nAnswer (numerical number):", + "answer": [ + "185.14" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C)C(CCN)C1=NSC=N1?\nAnswer (numerical number):", + "answer": [ + "185.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-[(3-chlorocyclohexyl)methyl]-2-fluoroethanamine?\nAnswer (numerical number):", + "answer": [ + "193.69" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H16F2N2?\nAnswer:", + "answer": [ + "3,3-difluoro-3-piperidin-3-ylpropan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-methyl-2-(3-methylbutyl)aniline?\nAnswer (numerical number):", + "answer": [ + "177.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1C(C1(F)F)C(=O)O?\nAnswer:", + "answer": [ + "C4H4F2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 4-ethenoxybutyl formate?\nAnswer:", + "answer": [ + "C7H12O3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 5-(methylsulfanylmethyl)piperidin-3-ol?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-(4-bromobutoxy)pentane?\nAnswer (numerical number):", + "answer": [ + "223.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-(3-aminocyclobutyl)oxy-3-ethoxypropan-2-ol?\nAnswer (numerical number):", + "answer": [ + "189.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-chloro-1,2,2,2-tetrafluoro-1-methylsulfanylethane?\nAnswer:", + "answer": [ + "C3H3ClF4S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 5,6-dihydropyrrolo[3,2-c]pyrazole?\nAnswer:", + "answer": [ + "C5H5N3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-methyl-1,3,9,12-tetrathiacycloheptadecane?\nAnswer:", + "answer": [ + "CC1SCCCCCSCCSCCCCCS1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (4Z)-6-methyl-3-methylidenehepta-4,6-dienal?\nAnswer:", + "answer": [ + "CC(=C)C=CC(=C)CC=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(=CCNC1CC(C1)N)C?\nAnswer (numerical number):", + "answer": [ + "154.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (2R)-N-ethyl-N,3,3-trimethylpentan-2-amine?\nAnswer:", + "answer": [ + "C10H23N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H11NO2?\nAnswer:", + "answer": [ + "C1C2CC(=O)NCC2CC1=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H20N2?\nAnswer:", + "answer": [ + "CC(=CCNC1CCCNC1)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H18N2?\nAnswer:", + "answer": [ + "CC1C(NC(C(N1)C)C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-iodononan-4-ol?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-[[(2S)-1-methylpiperidin-2-yl]methyl]cyclohexanamine?\nAnswer (numerical number):", + "answer": [ + "210.36" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H17ClN2?\nAnswer:", + "answer": [ + "1-(3-chloro-2-methylprop-2-enyl)-N-methylpyrrolidin-3-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1CN1CC(C=C)O?\nAnswer (numerical number):", + "answer": [ + "127.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-(3-amino-2-methylpropyl)oxazinan-3-one?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C3H6ClN3S?\nAnswer (numerical number):", + "answer": [ + 14 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H15NOS2?\nAnswer:", + "answer": [ + "2-(2-methylsulfanylethylamino)-1-thiophen-3-ylethanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H17NOS?\nAnswer:", + "answer": [ + "3-(cyclohexen-1-ylsulfinyl)propan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H12O2?\nAnswer (numerical number):", + "answer": [ + 22 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H13N3O?\nAnswer:", + "answer": [ + "CC1(CCNC(=O)NC1)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-[(2S,3S)-2-methyloxetan-3-yl]acetic acid?\nAnswer (numerical number):", + "answer": [ + 19 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(COC(=O)C=C)OOCC=C?\nAnswer (numerical number):", + "answer": [ + "186.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H4Cl2O?\nAnswer (numerical number):", + "answer": [ + "163.00" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H8ClI?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-(1-fluoropropyl)-8-azabicyclo[3.2.1]octane?\nAnswer:", + "answer": [ + "CCC(C1CC2CCC(C1)N2)F" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CC(CNC1)OCOCC2CC2?\nAnswer:", + "answer": [ + "C10H19NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of [2-(4-methoxybutylamino)cyclopentyl]methanol?\nAnswer:", + "answer": [ + "COCCCCNC1CCCC1CO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of methyl 4-fluoro-2-(hydroxymethyl)cyclopentane-1-carboxylate?\nAnswer (numerical number):", + "answer": [ + "176.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (1S,2S,4R)-1-bromo-2-heptyl-4-methylcyclohexane?\nAnswer:", + "answer": [ + "CCCCCCCC1CC(CCC1Br)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CN1C(CCC1CN)CCN(C)C?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H17NOS?\nAnswer:", + "answer": [ + "CCOC1(CCSC1C)CN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-(methylamino)-1-thiophen-2-ylpropan-1-ol?\nAnswer:", + "answer": [ + "C8H13NOS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (Z)-1-N-(3-aminopropyl)-2-N-methylprop-1-ene-1,2-diamine?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1C(NCS1)C2=CON=N2\nAnswer:", + "answer": [ + "4-(1,3-thiazolidin-4-yl)oxadiazole" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1=NN(CN1C)C?\nAnswer:", + "answer": [ + "C5H11N3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H11N3S?\nAnswer:", + "answer": [ + "CCC1=NN=C(S1)C2CNC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-methyl-3,4,4a,5,6,7,8,8a-octahydroquinoline?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CH5ClN2O2?\nAnswer (numerical number):", + "answer": [ + "112.51" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H17NO2?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-(chloromethyl)-N-(3-ethylsulfanylpropyl)cyclopentan-1-amine?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2,2,2-trifluoro-1-(2-hydroxyethylamino)ethanol?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C4H13NOP2?\nAnswer:", + "answer": [ + "4-amino-1,1-bis(phosphanyl)butan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(CN)NCC(C)(CCOC)O?\nAnswer:", + "answer": [ + "C9H22N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-[(3S)-1-propylpyrrolidin-3-yl]acetonitrile?\nAnswer (numerical number):", + "answer": [ + "152.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCCCCC(CC(CC=C)O)OC?\nAnswer (numerical number):", + "answer": [ + 41 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H12BrF3?\nAnswer:", + "answer": [ + "CCC(=C(F)F)F.C=CCCBr" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (2R)-2-N,2-N-dimethyl-1-N-piperidin-4-ylpropane-1,2-diamine?\nAnswer:", + "answer": [ + "C10H23N3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(CC)NC1CCCC1C#N?\nAnswer:", + "answer": [ + "C11H20N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C12H25NOS?\nAnswer:", + "answer": [ + "4-propan-2-yloxy-N-(thiolan-3-ylmethyl)butan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C4H10N2OS?\nAnswer:", + "answer": [ + "C(CNC(=O)N)CS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H14N2O2?\nAnswer:", + "answer": [ + "CCCCC(C(=O)O)NN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1=CN=C(S1)C2COCCN2?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CN(C)CCC1CCN(C1)CCO\nAnswer:", + "answer": [ + "2-[(3R)-3-[2-(dimethylamino)ethyl]pyrrolidin-1-yl]ethanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-methoxy-N-propylhept-5-yn-2-amine?\nAnswer:", + "answer": [ + "C11H21NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 4-methyl-1,3-dioxolan-2-one;prop-1-ene?\nAnswer:", + "answer": [ + "C7H12O3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1CCCCC(C1)I\nAnswer:", + "answer": [ + "1-iodo-3-methylcycloheptane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1CN=C(N1)SI?\nAnswer (numerical number):", + "answer": [ + 12 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H16N2S?\nAnswer:", + "answer": [ + "CN(C1CCSC1)C2CNC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H10O?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(CCCNCC=C(C)C)Cl\nAnswer:", + "answer": [ + "4-chloro-N-(3-methylbut-2-enyl)pentan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-[2-(propylamino)ethoxy]propane-1,2-diol?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H14N2O2?\nAnswer:", + "answer": [ + "CCC(C)(C)ONC(=O)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CN1C(=CN=C1COCCN)Cl?\nAnswer (numerical number):", + "answer": [ + "189.64" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of COC1CC2=CC=CC=C2OC1?\nAnswer (numerical number):", + "answer": [ + "164.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 5-(2-hydroxyethylidene)-1-methylpyrrolidin-2-one?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-methyl-3,7,9-triazabicyclo[3.3.2]decan-10-one?\nAnswer:", + "answer": [ + "C8H15N3O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C12H24N2?\nAnswer:", + "answer": [ + "CCCCC(C)CCC=CN(C)C=N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H12N4OS?\nAnswer:", + "answer": [ + "COCC(CN)NC1=NC=NS1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H13NO2?\nAnswer:", + "answer": [ + "3-butyl-3-azabicyclo[3.1.0]hexane-2,4-dione" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in sulfanide;triethylazanium?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(C)COP(=O)(C)CCO?\nAnswer:", + "answer": [ + "C7H17O3P" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H15N3O?\nAnswer:", + "answer": [ + "2-(azetidin-3-yloxymethyl)-1-ethylimidazole" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCOC(=O)NC(CCN)C(C)C?\nAnswer:", + "answer": [ + "C9H20N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H22O?\nAnswer:", + "answer": [ + "CC(=C)CCCCCCCCO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of pent-2-yne-1-sulfinic acid?\nAnswer (numerical number):", + "answer": [ + "132.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H22N2?\nAnswer:", + "answer": [ + "(1R,2R)-N-ethyl-2-pyrrolidin-1-ylcyclopentan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in ethyl 2-(1-formylpyrrolidin-2-yl)acetate?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C(N)(N)SSC(=N)N?\nAnswer (numerical number):", + "answer": [ + 16 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H21NO2?\nAnswer (numerical number):", + "answer": [ + "187.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCC(C)COC(=O)OC(C)I\nAnswer:", + "answer": [ + "1-iodoethyl 2-methylbutyl carbonate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-azabicyclo[2.1.1]hexane-2-carbaldehyde?\nAnswer:", + "answer": [ + "C1C2CC1N(C2)C=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C12H21NO?\nAnswer (numerical number):", + "answer": [ + 35 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in propyl pyrrole-1-carboxylate?\nAnswer (numerical number):", + "answer": [ + 22 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H12N2?\nAnswer (numerical number):", + "answer": [ + "124.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC(CO)NCCCNC(CC)CO?\nAnswer (numerical number):", + "answer": [ + "218.34" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCCC(CC)NC(CCC)C#C?\nAnswer (numerical number):", + "answer": [ + "195.34" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(CCCC(=O)O)N\nAnswer:", + "answer": [ + "(5S)-5-aminohexanoic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCCC1(CCC(=O)O1)CC?\nAnswer (numerical number):", + "answer": [ + "170.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H18N2OS?\nAnswer:", + "answer": [ + "COCCNC1=NC2CCCC2CS1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CCC(=O)C(C1)C=O?\nAnswer:", + "answer": [ + "C7H10O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H20N2OS?\nAnswer:", + "answer": [ + "(2R)-2-(1,4-thiazepan-4-ylmethyl)morpholine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H10O2?\nAnswer:", + "answer": [ + "ethane;pyran-4-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C=CCOC1CCOC1\nAnswer:", + "answer": [ + "3-prop-2-enoxyoxolane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCOC(=O)CC(C)CCC(C)C\nAnswer:", + "answer": [ + "ethyl (3S)-3,6-dimethylheptanoate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1CCCN1C2=CC(=NS2)N?\nAnswer:", + "answer": [ + "C8H13N3S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCOC(=O)C(C)CCNC?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (Z)-3-cyclopropylbut-2-en-1-ol?\nAnswer:", + "answer": [ + "C7H12O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H12N4S?\nAnswer (numerical number):", + "answer": [ + "184.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-(chloromethyl)-N-(2-propan-2-yloxyethyl)cyclohexan-1-amine?\nAnswer:", + "answer": [ + "CC(C)OCCNC1CCCCC1CCl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H23NO2?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in methyl (2S)-2-(ethylideneamino)-3-hydroxypropanoate?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of sulfonyllead?\nAnswer (numerical number):", + "answer": [ + "271" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H12F3N?\nAnswer:", + "answer": [ + "1,1,1-trifluorooct-6-yn-3-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H12N4?\nAnswer:", + "answer": [ + "1-(3-methyltriazol-4-yl)pent-1-yn-3-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC#CCCN1CCNCC1C(=O)N\nAnswer:", + "answer": [ + "1-pent-3-ynylpiperazine-2-carboxamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-(1-pyridin-3-ylpropylidene)hydroxylamine?\nAnswer (numerical number):", + "answer": [ + "150.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H19NO3?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H18ClNO?\nAnswer:", + "answer": [ + "1-(3-chloro-2-methylprop-2-enoxy)-2-methylbutan-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C5H11NO2S?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1=NN(C=C1N)CC(C)OC?\nAnswer:", + "answer": [ + "C8H15N3O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C(C)S)C(C(=O)O)N?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H19NO2?\nAnswer:", + "answer": [ + "CCCC1(CNCC1C(=O)O)CC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H5BrN4?\nAnswer (numerical number):", + "answer": [ + "213.03" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H16N2?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CSCCCCNC1CC(=O)NC1\nAnswer:", + "answer": [ + "4-(4-methylsulfanylbutylamino)pyrrolidin-2-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC=CCCNC(C)(C)C\nAnswer:", + "answer": [ + "(E)-N-tert-butylpent-3-en-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(=O)ONC?\nAnswer (numerical number):", + "answer": [ + 13 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-[(2,2-difluoro-3-hydroxypropyl)amino]butan-2-ol?\nAnswer:", + "answer": [ + "C7H15F2NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C#N)OOCC=C?\nAnswer (numerical number):", + "answer": [ + "127.14" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H19NO2?\nAnswer:", + "answer": [ + "CCCCC(C(=O)O)NCCCC#C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H21NO2?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 4-dimethylarsanylbutanoic acid;hydrochloride?\nAnswer (numerical number):", + "answer": [ + "228.55" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H23NO3?\nAnswer (numerical number):", + "answer": [ + 38 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-(2,2-difluorocyclopropyl)prop-2-enenitrile?\nAnswer:", + "answer": [ + "C1C(C1(F)F)C=CC#N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCOCOCC1CCCC1CN\nAnswer:", + "answer": [ + "[2-(ethoxymethoxymethyl)cyclopentyl]methanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H25N3?\nAnswer (numerical number):", + "answer": [ + 38 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H21NO3?\nAnswer:", + "answer": [ + "1-[[(2R)-2-hydroxypropyl]amino]-4-methoxy-2-methylbutan-2-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H19NO?\nAnswer:", + "answer": [ + "4-(2-cyclopropylethylamino)-3-methylbutan-2-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (4,5,5-trimethyl-2,6-dihydro-1H-pyridin-3-yl)methanimine?\nAnswer:", + "answer": [ + "C9H16N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2,2-difluoro-3-(2-methylprop-2-enylamino)propan-1-ol?\nAnswer (numerical number):", + "answer": [ + "165.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H24N2S?\nAnswer (numerical number):", + "answer": [ + 38 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of COC=C(C#N)Cl\nAnswer:", + "answer": [ + "2-chloro-3-methoxyprop-2-enenitrile" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCOC1(CCCSC1)C=O\nAnswer:", + "answer": [ + "3-ethoxythiane-3-carbaldehyde" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-(1-hydroxy-3-methoxypropan-2-yl)formamide?\nAnswer (numerical number):", + "answer": [ + "133.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCOCCC(=O)NCCCC(C)N?\nAnswer (numerical number):", + "answer": [ + 39 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in [1-(3-chloro-2-methylprop-2-enyl)pyrrolidin-2-yl]methanamine?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of COC1CC(=C)CCC1F\nAnswer:", + "answer": [ + "1-fluoro-2-methoxy-4-methylidenecyclohexane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-(1,1,1-trifluoropent-2-en-2-yl)methanimine?\nAnswer (numerical number):", + "answer": [ + "151.13" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1=C(C=NC(=N1)NN)C#N?\nAnswer (numerical number):", + "answer": [ + 15 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H16O?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C(COCO)NC(=O)CBr\nAnswer:", + "answer": [ + "2-bromo-N-[2-(hydroxymethoxy)ethyl]acetamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C2H3ClOS?\nAnswer:", + "answer": [ + "ethenoxy thiohypochlorite" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(=CCl)CN(CCOC)CCCl?\nAnswer (numerical number):", + "answer": [ + "226.14" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H12O?\nAnswer:", + "answer": [ + "(2E,4Z)-2,4-dimethylhexa-2,4-dienal" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H23NO3?\nAnswer:", + "answer": [ + "CC(CCOC)(CNCCCCO)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-cyclopentylpentane-1,4-diol?\nAnswer:", + "answer": [ + "CC(CCC(C1CCCC1)O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CN(C)C(=S)SCC=COC\nAnswer:", + "answer": [ + "[(E)-3-methoxyprop-2-enyl] N,N-dimethylcarbamodithioate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCCCCC(CCC)OOCCC?\nAnswer:", + "answer": [ + "C13H28O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H17NO2S?\nAnswer:", + "answer": [ + "CN(CCC(=O)O)CC1CCSC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N'-hydroxy-2-(2-methylprop-2-enylamino)ethanimidamide?\nAnswer:", + "answer": [ + "CC(=C)CNCC(=NO)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-(azetidin-3-yloxy)butan-2-ol?\nAnswer (numerical number):", + "answer": [ + "145.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCN1CCC(CC1)NCCC#CC?\nAnswer:", + "answer": [ + "C13H24N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCSCCCNCC1CCC(CC1)Cl?\nAnswer:", + "answer": [ + "C12H24ClNS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H6O?\nAnswer (numerical number):", + "answer": [ + 16 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-methyl-2-(2-pentan-2-yloxyethyl)cyclopentan-1-amine?\nAnswer:", + "answer": [ + "C13H27NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1=CC=CC=C1CCONC?\nAnswer:", + "answer": [ + "C10H15NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H9N3?\nAnswer (numerical number):", + "answer": [ + 19 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2,2-difluoro-3-(1-methylpyrrolidin-2-yl)propan-1-amine?\nAnswer (numerical number):", + "answer": [ + "178.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (NE)-N-[[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]methylidene]hydroxylamine?\nAnswer:", + "answer": [ + "CC1(OCC(O1)(C)C=NO)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CN(C)C(=O)CC1CNCC1F?\nAnswer (numerical number):", + "answer": [ + "174.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCCCCCC(CC)OOOOCC?\nAnswer (numerical number):", + "answer": [ + 42 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in ethyl 2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetate?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CCC(=C(Cl)Cl)C1?\nAnswer (numerical number):", + "answer": [ + "151.03" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(CCCSC)(CBr)C=C?\nAnswer:", + "answer": [ + "C9H17BrS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-fluoro-3-[(propan-2-ylamino)methyl]cyclopentan-1-amine?\nAnswer (numerical number):", + "answer": [ + "174.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-(chloromethyl)-2-ethyl-N-methylbutan-1-amine?\nAnswer:", + "answer": [ + "CCC(CC)(CNC)CCl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCC1=NN(C=C1C)CC=O\nAnswer:", + "answer": [ + "2-(3-ethyl-4-methylpyrazol-1-yl)acetaldehyde" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (NZ)-N-[(3aR)-3,3a,4,5-tetrahydro-2H-pentalen-1-ylidene]hydroxylamine?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(=CCNCC(COCCOC)O)C?\nAnswer (numerical number):", + "answer": [ + "217.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 6-methyl-3,4-dihydro-1H-isothiochromene?\nAnswer (numerical number):", + "answer": [ + "164.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-[2-(pyrrolidin-3-ylmethoxy)ethoxy]ethanol?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (3-cyclobutyl-3-azabicyclo[3.1.0]hexan-2-yl)methanamine?\nAnswer:", + "answer": [ + "C10H18N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1C(CCS1)(C(=O)O)OC?\nAnswer:", + "answer": [ + "C7H12O3S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-[(1S,2R)-2,6,6-trimethylcyclohex-3-en-1-yl]acetonitrile?\nAnswer:", + "answer": [ + "CC1C=CCC(C1CC#N)(C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 4,4,4-trifluorobutanamide?\nAnswer (numerical number):", + "answer": [ + 15 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (4,5-dichloroimidazol-1-yl)methanamine?\nAnswer (numerical number):", + "answer": [ + "166.01" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C4H5ClN2?\nAnswer:", + "answer": [ + "3-chloro-3,6-dihydropyridazine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H18S2?\nAnswer (numerical number):", + "answer": [ + "190.4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C6H13N3?\nAnswer:", + "answer": [ + "N'-methyl-N-[(Z)-3-(methylamino)prop-1-enyl]methanimidamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in [(4S)-octan-4-yl] acetate?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H15NO3?\nAnswer (numerical number):", + "answer": [ + "161.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-N'-methyl-1-(methylideneamino)ethane-1,1-diamine?\nAnswer (numerical number):", + "answer": [ + "101.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-[2-(cyclopenten-1-yl)ethyl]-2-methylprop-2-en-1-amine?\nAnswer (numerical number):", + "answer": [ + "165.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC(COC)(C1=CCCCO1)O?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCC(=C=CC(=O)O)C\nAnswer:", + "answer": [ + "4-methylhexa-2,3-dienoic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H14N2O?\nAnswer:", + "answer": [ + "(1R)-1-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl)ethanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H19NO3?\nAnswer (numerical number):", + "answer": [ + "189.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1C(OC(C1O)CO)CI?\nAnswer:", + "answer": [ + "C6H11IO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C5H10N2O2S?\nAnswer:", + "answer": [ + "2-amino-4-methylsulfanyl-N-oxobutanamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCC(C)OCC(C)O?\nAnswer (numerical number):", + "answer": [ + "146.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC1CC1S?\nAnswer (numerical number):", + "answer": [ + 16 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 4,4-dihydroxyhexan-2-one?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H21NO?\nAnswer:", + "answer": [ + "(2S)-N,2-diethylhexanamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H7FO?\nAnswer (numerical number):", + "answer": [ + 17 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H11BrN2O?\nAnswer:", + "answer": [ + "C1=C(NC=C1C(CCN)O)Br" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H18O?\nAnswer:", + "answer": [ + "(5R)-2-methyl-5-propan-2-ylcyclohex-2-en-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H8N4S?\nAnswer (numerical number):", + "answer": [ + "168.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-chlorocyclohexa-1,4-diene-1-carbonitrile?\nAnswer:", + "answer": [ + "C7H6ClN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H10NP?\nAnswer:", + "answer": [ + "CCN1C=CC(=C1)P" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-ethyl-2-(oxiran-2-yl)piperidine?\nAnswer:", + "answer": [ + "C9H17NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H15NO?\nAnswer:", + "answer": [ + "(2R,4S)-2-ethyl-4-methoxypyrrolidine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(C)CCOCCNC(COC)CCl?\nAnswer:", + "answer": [ + "C11H24ClNO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(=O)CC(=O)NC(=O)C?\nAnswer (numerical number):", + "answer": [ + "143.14" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(C)NC(C)SC\nAnswer:", + "answer": [ + "N-(1-methylsulfanylethyl)propan-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H17NO2?\nAnswer:", + "answer": [ + "1-[3-(methoxymethoxy)cyclobutyl]-N-methylmethanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H17ClO?\nAnswer:", + "answer": [ + "7-chloro-2,6-dimethylhept-6-en-3-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCOCC(C)(C)NCC(C)CC?\nAnswer:", + "answer": [ + "C12H27NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CNCC(C(=O)NC)(F)F?\nAnswer:", + "answer": [ + "C5H10F2N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H19Cl?\nAnswer:", + "answer": [ + "1-chlorobutane;cyclopentane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in COC1CC(OC=CCO1)OC?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H16O?\nAnswer:", + "answer": [ + "CC(C)C1CCC(C1)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C4H7NO4S?\nAnswer (numerical number):", + "answer": [ + "165.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H17NO2S?\nAnswer:", + "answer": [ + "C1CSCC1CNCCCC(=O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CNCC1=CSC=C1\nAnswer:", + "answer": [ + "N-methyl-1-thiophen-3-ylmethanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H18N2O?\nAnswer:", + "answer": [ + "CCC(CC)(CNCC#N)CO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(C)(CN)C(=O)NCCO\nAnswer:", + "answer": [ + "3-amino-N-(2-hydroxyethyl)-2,2-dimethylpropanamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(C)NCC1=NC=NC=C1?\nAnswer:", + "answer": [ + "C9H15N3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (2S,4S)-2-butyl-1-ethylpiperidin-4-amine?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H19NO2?\nAnswer:", + "answer": [ + "CC(CCOC(C)CNC)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C5H13NO2?\nAnswer:", + "answer": [ + "[ethyl(methyl)amino]-methoxymethanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-N-cyclopropyl-2-N-methyl-1-N-(2-methylsulfanylethyl)propane-1,2-diamine?\nAnswer (numerical number):", + "answer": [ + 35 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCCCC=CC1=CCCCC1=O?\nAnswer (numerical number):", + "answer": [ + "192.30" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H15NO2?\nAnswer:", + "answer": [ + "CCC(CO)OCCN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of ethane;6-ethyl-2-methyl-2H-pyran?\nAnswer (numerical number):", + "answer": [ + "154.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCNC1=NOC(=N1)C?\nAnswer (numerical number):", + "answer": [ + "127.14" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(=O)OC1CC1?\nAnswer (numerical number):", + "answer": [ + "100.12" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H19NO?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H22N2?\nAnswer:", + "answer": [ + "(5R)-5,6-dimethylheptane-1,6-diamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-N,4-N,4-N-trimethylcyclohex-2-ene-1,4-diamine?\nAnswer:", + "answer": [ + "C9H18N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C13H28N2?\nAnswer (numerical number):", + "answer": [ + 43 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CNCC(OC1)C2=CN=CS2?\nAnswer:", + "answer": [ + "C8H12N2OS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCNCCOCC1(CCCCC1)O?\nAnswer (numerical number):", + "answer": [ + "201.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C16H31N?\nAnswer (numerical number):", + "answer": [ + "237.42" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H11ClS?\nAnswer (numerical number):", + "answer": [ + "174.69" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-(cyclopenten-1-yl)-N-[2-(2-methylpropoxy)ethyl]ethanamine?\nAnswer:", + "answer": [ + "C13H25NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CC(C1)C(CC=O)C(F)F?\nAnswer (numerical number):", + "answer": [ + "162.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-(1-hydroxyethyl)cyclobutane-1-carboxylic acid?\nAnswer:", + "answer": [ + "C7H12O3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H9N3O?\nAnswer:", + "answer": [ + "N-methyl-N-(pyridin-4-ylmethyl)nitrous amide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCCCNC1CC(=O)NC1\nAnswer:", + "answer": [ + "4-(pentylamino)pyrrolidin-2-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-(1-ethenylimidazol-2-yl)-N,N-dimethylethanamine?\nAnswer:", + "answer": [ + "CN(C)CCC1=NC=CN1C=C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCCC1CNC(CN1)C?\nAnswer:", + "answer": [ + "C9H20N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CCC2C(CO2)C(=O)CC1?\nAnswer (numerical number):", + "answer": [ + "154.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-[3-(oxolan-2-yl)propyl]hex-1-yn-3-amine?\nAnswer (numerical number):", + "answer": [ + "209.33" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H13NO2?\nAnswer:", + "answer": [ + "(2S)-2-(pent-3-ynylamino)propanoic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H22N2?\nAnswer:", + "answer": [ + "CCNCC1CCN(C1)C2CCC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CN1CCCC1CC(C=O)(F)F?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(=CCl)CN(C)CCCCCCl?\nAnswer (numerical number):", + "answer": [ + "224.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of ethyl (2R)-2-(3-methylbutylamino)propanoate?\nAnswer:", + "answer": [ + "CCOC(=O)C(C)NCCC(C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCN(C)CC1CNCCO1?\nAnswer (numerical number):", + "answer": [ + "158.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H13NO2S?\nAnswer:", + "answer": [ + "CNCC(C1=C(C=CO1)SC)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C6H13F2NO?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(C)NC(=O)C1CCNCC1?\nAnswer:", + "answer": [ + "C10H20N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of COC(=CC(=O)OCC=C)CCl?\nAnswer (numerical number):", + "answer": [ + "190.62" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CCC2CC2=CC1?\nAnswer:", + "answer": [ + "C8H12" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H18ClNS?\nAnswer:", + "answer": [ + "CC(=CCl)CNCC(C)(C)SC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C5H8N2O?\nAnswer:", + "answer": [ + "CC(=N)N(C=C)C=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCC=CC(=CCC)C(=N)C?\nAnswer:", + "answer": [ + "C11H19N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-(1,1-difluoropropan-2-yl)pent-1-yn-3-amine?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H22O2?\nAnswer (numerical number):", + "answer": [ + "174.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H15N3?\nAnswer:", + "answer": [ + "N-(1H-pyrazol-5-ylmethyl)hex-1-yn-3-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1COC2C1OCC2C#C?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C5H13NO2S?\nAnswer (numerical number):", + "answer": [ + "151.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C(CP(Cl)Cl)CP(Cl)Cl?\nAnswer (numerical number):", + "answer": [ + 15 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H21NOS?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 5-bromo-1-(oxolan-3-yl)pyrazole?\nAnswer:", + "answer": [ + "C1COCC1N2C(=CC=N2)Br" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-butoxyperoxyhexane?\nAnswer:", + "answer": [ + "CCCCCCOOOCCCC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in butane;cyclohexane;prop-1-ene?\nAnswer (numerical number):", + "answer": [ + 41 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-methoxy-N-propylnon-7-yn-4-amine?\nAnswer (numerical number):", + "answer": [ + 40 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-(chloromethyl)-N-pentan-3-ylcyclohexan-1-amine?\nAnswer:", + "answer": [ + "C12H24ClN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H16O?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCN1C(=O)C=CC=C1CNC?\nAnswer (numerical number):", + "answer": [ + "166.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of [ethyl-bis(phosphanyl)-\u00ce\u00bb4-sulfanyl]phosphane?\nAnswer (numerical number):", + "answer": [ + "160.10" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H14N2?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (3R,4R)-4-iodo-3-propan-2-yloxycyclohexene?\nAnswer:", + "answer": [ + "CC(C)OC1C=CCCC1I" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-(5-ethyl-2-methyloctyl)-2-methylhydrazine?\nAnswer (numerical number):", + "answer": [ + "200.36" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CNC1CCOCC1N2CCCC2\nAnswer:", + "answer": [ + "(3S,4S)-N-methyl-3-pyrrolidin-1-yloxan-4-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H23NO?\nAnswer (numerical number):", + "answer": [ + "185.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of COCCCNC1CCCC1CO?\nAnswer (numerical number):", + "answer": [ + "187.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-(3-chloro-2-methylprop-2-enyl)oxan-3-amine?\nAnswer:", + "answer": [ + "CC(=CCl)CNC1CCCOC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC=CC=CC(C)CC=C?\nAnswer:", + "answer": [ + "C10H16" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CNCCC(C1=CC=CC=C1)F\nAnswer:", + "answer": [ + "3-fluoro-N-methyl-3-phenylpropan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C5H9N3?\nAnswer (numerical number):", + "answer": [ + "111.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C(=COC(=O)N)O\nAnswer:", + "answer": [ + "[(E)-2-hydroxyethenyl] carbamate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)(C(C1CCCCC1)F)N?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H19NO?\nAnswer:", + "answer": [ + "1-(oxolan-3-yl)hept-5-yn-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(C(=O)OCC)OCCNC?\nAnswer:", + "answer": [ + "C9H19NO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H19Cl2N?\nAnswer:", + "answer": [ + "4-chloro-N-(3-chloro-2-methylprop-2-enyl)-2-ethylbutan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H18FN?\nAnswer (numerical number):", + "answer": [ + "171.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(C)OC1=NC(=NCC1)F?\nAnswer:", + "answer": [ + "C7H11FN2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-methyl-5-(thiolan-3-yl)-4,5-dihydroimidazol-2-amine?\nAnswer:", + "answer": [ + "C8H15N3S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1=C(N(N=N1)C)I?\nAnswer (numerical number):", + "answer": [ + "223.02" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-[(1R,2R)-2-(sulfanylamino)cyclohexyl]thiohydroxylamine?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-butan-2-yl-1-(thiolan-3-yl)ethane-1,2-diamine?\nAnswer:", + "answer": [ + "CCC(C)NC(CN)C1CCSC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2S)-N-(2-aminoethyl)morpholine-2-carboxamide?\nAnswer:", + "answer": [ + "C1COC(CN1)C(=O)NCCN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CC(NC1)(C(=O)O)O?\nAnswer (numerical number):", + "answer": [ + "131.13" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CN1CC(=C(C1)C=O)C=O?\nAnswer (numerical number):", + "answer": [ + 19 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H10S?\nAnswer (numerical number):", + "answer": [ + "138.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (1R,4R,5S)-5-methoxybicyclo[2.2.2]oct-2-ene?\nAnswer:", + "answer": [ + "C9H14O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (1S)-1-[3-(2-methylpropoxy)propoxy]propan-1-ol?\nAnswer:", + "answer": [ + "C10H22O3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H21NO?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of COC(CCCN=O)C=C?\nAnswer (numerical number):", + "answer": [ + "143.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 6H-1,4-diazepine-2-carboxamide?\nAnswer (numerical number):", + "answer": [ + "137.14" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC(C)NC=O?\nAnswer (numerical number):", + "answer": [ + "101.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of COCCCOCCNCCC1=CCCC1?\nAnswer:", + "answer": [ + "C13H25NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H25NO?\nAnswer (numerical number):", + "answer": [ + "187.32" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1CNC(CN1)CC2=CSN=N2\nAnswer:", + "answer": [ + "4-(piperazin-2-ylmethyl)thiadiazole" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCC1CC(=O)CCC1=O?\nAnswer (numerical number):", + "answer": [ + "154.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H14N2S?\nAnswer (numerical number):", + "answer": [ + "182.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-methyl-5-(methylamino)-2H-pyridin-4-ol?\nAnswer:", + "answer": [ + "C7H12N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-methyl-2,5-dihydro-1H-imidazole?\nAnswer (numerical number):", + "answer": [ + "84.12" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H19NOS?\nAnswer:", + "answer": [ + "CCC(CN)C(C1CCSC1)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)NCC1CCC1?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-(oxolan-3-yl)hex-4-yn-1-ol?\nAnswer:", + "answer": [ + "CC#CCCC(C1CCOC1)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (Z)-2-(prop-1-en-2-ylamino)but-2-enoic acid?\nAnswer:", + "answer": [ + "C7H11NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C)(COC1CCCC1O)N?\nAnswer (numerical number):", + "answer": [ + "173.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1=NC(=CN1C)Br?\nAnswer (numerical number):", + "answer": [ + "175.03" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H15NS?\nAnswer:", + "answer": [ + "CSCCC(C(=C)C=C)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-butylhept-6-enal?\nAnswer:", + "answer": [ + "C11H20O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H13NO2?\nAnswer (numerical number):", + "answer": [ + "131.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]propanal?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of tert-butyl [(E)-prop-1-enyl] carbonate?\nAnswer (numerical number):", + "answer": [ + "158.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in methyl 2-[3-(propan-2-ylamino)propoxy]acetate?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in COCCOCCCNCC(CO)(F)F?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C(C)(C)C1CO1)O?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H18O2?\nAnswer:", + "answer": [ + "1,2-dioxacycloundecane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H16N2O?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of [2-[(1-amino-2-methylbutan-2-yl)amino]cyclopentyl]methanol?\nAnswer:", + "answer": [ + "C11H24N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-[(3S)-1-butylpyrrolidin-3-yl]acetonitrile?\nAnswer:", + "answer": [ + "C10H18N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C14H29N?\nAnswer (numerical number):", + "answer": [ + "211.39" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC.CC1OCCCO1?\nAnswer (numerical number):", + "answer": [ + "132.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H23N?\nAnswer:", + "answer": [ + "2-ethenyl-N,2-dimethylheptan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H20O2?\nAnswer:", + "answer": [ + "CCCCCCC1CCOCO1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (1S,2S,5S)-bicyclo[3.2.0]hept-3-en-2-ol?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H16O?\nAnswer (numerical number):", + "answer": [ + "140.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H19NO?\nAnswer (numerical number):", + "answer": [ + "145.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(CC(=CCO)C)OC?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (2S)-2-bromo-2-cyano-N,N-dimethylacetamide?\nAnswer (numerical number):", + "answer": [ + 16 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H16S?\nAnswer:", + "answer": [ + "CCCCCC=CSC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H10N2?\nAnswer:", + "answer": [ + "(1R,3R)-3-(cyanomethyl)-2,2-dimethylcyclopropane-1-carbonitrile" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H15NO2S?\nAnswer (numerical number):", + "answer": [ + "189.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-[(1S,2S)-2-methoxycyclopentyl]thian-4-amine?\nAnswer:", + "answer": [ + "COC1CCCC1NC2CCSCC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of [(5S)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-5-yl]methanol?\nAnswer (numerical number):", + "answer": [ + "138.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 5-methyl-4-[[(2S)-pyrrolidin-2-yl]methyl]-1,2-thiazole?\nAnswer:", + "answer": [ + "CC1=C(C=NS1)CC2CCCN2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C6H13ClFN?\nAnswer:", + "answer": [ + "(2S)-2-(fluoromethyl)piperidine;hydrochloride" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H17NO2?\nAnswer:", + "answer": [ + "N-methyl-2-(4-methyl-1,3-dioxetan-2-yl)butan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-[2-(1,3-thiazol-5-yl)ethyl]cyclopropan-1-amine?\nAnswer:", + "answer": [ + "C8H12N2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in [1-(ethylamino)cyclopentyl]methyl formate?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H25N?\nAnswer:", + "answer": [ + "(2S)-N-methyldecan-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (6aS)-6a-methyl-1,4,5,6-tetrahydropentalen-2-one?\nAnswer:", + "answer": [ + "CC12CCCC1=CC(=O)C2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-(3-methylbut-2-enyl)hept-6-en-1-amine?\nAnswer:", + "answer": [ + "C12H23N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H14F2O?\nAnswer:", + "answer": [ + "3-(difluoromethyl)-5-methylhexanal" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C(CC=CC=CCCCC=O)CC=O?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CNC(C=CC=CONC)N?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-methyl-4-(oxan-3-yl)pentan-2-amine?\nAnswer:", + "answer": [ + "CC(CC(C)NC)C1CCCOC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-(hydroxymethyl)pyrazolidin-4-ol?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCN(CC)CC1C(O1)(C)C\nAnswer:", + "answer": [ + "N-[[(2S)-3,3-dimethyloxiran-2-yl]methyl]-N-ethylethanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H18?\nAnswer:", + "answer": [ + "CC=C(C)CC(=CC(=C)C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H24N2?\nAnswer:", + "answer": [ + "3-butyl-3-ethyl-1-methylpiperazine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(CN)NC(CO)COC\nAnswer:", + "answer": [ + "2-(1-aminopropan-2-ylamino)-3-methoxypropan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-cyclopentyloxyhexan-3-amine?\nAnswer (numerical number):", + "answer": [ + "185.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCN1CCCC(C1)C(CO)F?\nAnswer:", + "answer": [ + "C9H18FNO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H18N2?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H14N2?\nAnswer:", + "answer": [ + "CCNC1CCCC1C#N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCC(CC)(CN)NCC#CC?\nAnswer (numerical number):", + "answer": [ + "182.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CN1CCCCC1CN2CCCNCC2?\nAnswer (numerical number):", + "answer": [ + "211.35" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C1CC1)NC(C)C(=O)O?\nAnswer (numerical number):", + "answer": [ + "157.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C(C(O)(O)Cl)(O)O.P?\nAnswer:", + "answer": [ + "C2H8ClO4P" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H11NO3?\nAnswer:", + "answer": [ + "2-formamidohept-5-ynoic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-ethyl-5-methyl-1H-1,2,4-triazol-3-one?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-(2-methoxyethoxymethyl)-4-methylcyclohexane?\nAnswer (numerical number):", + "answer": [ + "186.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)N(C(=O)O)NC1CC1?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CC=C(C1)CCNCC(CO)O?\nAnswer:", + "answer": [ + "C10H19NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-(4,4-difluoro-1-methylpyrrolidin-3-yl)propan-1-amine?\nAnswer:", + "answer": [ + "CN1CC(C(C1)(F)F)CCCN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H13N?\nAnswer:", + "answer": [ + "(2E,5Z)-N-methylocta-2,5,7-trien-4-imine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CC(C2=CC=CC=C2C1)I?\nAnswer:", + "answer": [ + "C10H11I" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H18ClNO?\nAnswer:", + "answer": [ + "N-(1-chloro-3-methoxypropan-2-yl)butan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC=CS(=S)O?\nAnswer:", + "answer": [ + "C3H6OS2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(C#N)NCC=C(C)C?\nAnswer:", + "answer": [ + "C8H14N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1=C(C=C(S1)CCCl)Br\nAnswer:", + "answer": [ + "3-bromo-5-(2-chloroethyl)-2-methylthiophene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-methylphosphanylcarbonylazepan-2-one?\nAnswer:", + "answer": [ + "C8H14NO2P" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-[methyl-[(1S,2R)-2-methylsulfanylcyclopentyl]amino]propan-1-ol?\nAnswer:", + "answer": [ + "C10H21NOS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C4H12N2O2S?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C5H11NO3?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C[Se]CCS?\nAnswer (numerical number):", + "answer": [ + "155.13" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-(1,1-dimethoxypropan-2-yl)pent-1-yn-3-amine?\nAnswer:", + "answer": [ + "CCC(C#C)NC(C)C(OC)OC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1=CC=CC1Br?\nAnswer (numerical number):", + "answer": [ + 14 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1CCC1C(=C)C?\nAnswer (numerical number):", + "answer": [ + 22 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C(CO)C(CC(Cl)Cl)O\nAnswer:", + "answer": [ + "5,5-dichloropentane-1,3-diol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H16O2?\nAnswer (numerical number):", + "answer": [ + "156.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-amino-2-hex-1-yn-3-ylguanidine?\nAnswer (numerical number):", + "answer": [ + "154.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H14O?\nAnswer (numerical number):", + "answer": [ + "162.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1(CCN(C1)CCCCS)O?\nAnswer:", + "answer": [ + "C9H19NOS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-(5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)-N-methoxymethanamine?\nAnswer (numerical number):", + "answer": [ + 22 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H13NS?\nAnswer:", + "answer": [ + "CC(C)C(=C)NC(=S)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-(methylamino)-N-propylprop-2-enamide?\nAnswer:", + "answer": [ + "CCCNC(=O)C(=C)NC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H16S2?\nAnswer:", + "answer": [ + "(3E)-4,7-bis(methylsulfanyl)hepta-1,3-diene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H20N2O2?\nAnswer (numerical number):", + "answer": [ + "188.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2,2-dimethyloct-6-yn-3-amine?\nAnswer:", + "answer": [ + "C10H19N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of COC=CC(=N)N?\nAnswer (numerical number):", + "answer": [ + "100.12" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H17N3O?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCCC(CC)COC(C)(C)C?\nAnswer (numerical number):", + "answer": [ + "186.33" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H19NS?\nAnswer:", + "answer": [ + "(E)-N-propyl-3-(thiolan-3-yl)prop-2-en-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H12O2?\nAnswer:", + "answer": [ + "(1R,3S,5R)-6-methylidene-8-oxabicyclo[3.2.1]octan-3-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(C(C1CCCC1)(F)F)N\nAnswer:", + "answer": [ + "1-cyclopentyl-1,1-difluoropropan-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-ethyl-3a,7a-dihydro-1H-indole?\nAnswer:", + "answer": [ + "C10H13N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N'-hydroxy-3-(pent-1-yn-3-ylamino)propanimidamide?\nAnswer (numerical number):", + "answer": [ + "169.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H11NO?\nAnswer (numerical number):", + "answer": [ + "113.16" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H20FN?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(CSC1=NN=CN1N)N?\nAnswer:", + "answer": [ + "C5H11N5S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1C(C(CS1)F)CN.Cl?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H22N2O?\nAnswer:", + "answer": [ + "N-methyl-N-[[(2R)-morpholin-2-yl]methyl]cyclopentanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-butylsulfanyl-5-methylsulfanylpentane?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC(C)CC(C=CCC=O)O?\nAnswer (numerical number):", + "answer": [ + "170.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCC(=NNCCC)C1CCCC1?\nAnswer (numerical number):", + "answer": [ + "196.33" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-methoxy-3-(2-methylphenyl)propan-1-ol?\nAnswer:", + "answer": [ + "CC1=CC=CC=C1CC(CO)OC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H17NOS?\nAnswer:", + "answer": [ + "[1-(thiolan-3-ylmethylamino)cyclopropyl]methanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-(heptylamino)-1-methylpyrrolidin-2-one?\nAnswer:", + "answer": [ + "CCCCCCCNC1CCN(C1=O)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (E)-5-hydroxy-3,4-dimethylpent-3-en-2-one?\nAnswer:", + "answer": [ + "C7H12O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H15N3O2S?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H16O3?\nAnswer:", + "answer": [ + "CC(OC)OCCCCO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-(2,2,2-trifluoroethoxymethoxymethyl)pyrrolidine?\nAnswer:", + "answer": [ + "C8H14F3NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC=CC1=C(C=CC=C1Cl)F?\nAnswer (numerical number):", + "answer": [ + 19 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H7NO2?\nAnswer:", + "answer": [ + "CC(=O)C1=C(NC=C1)C=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1COCCN1CNC2=NN=CS2\nAnswer:", + "answer": [ + "N-(morpholin-4-ylmethyl)-1,3,4-thiadiazol-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(=O)CCCCC1CCSS1\nAnswer:", + "answer": [ + "6-[(3S)-dithiolan-3-yl]hexan-2-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C14H28ClN?\nAnswer (numerical number):", + "answer": [ + "245.83" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C6H14N2O2?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H20N2O?\nAnswer:", + "answer": [ + "CCCC(CC)(CC(=O)N)NC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(=CC=CCF)S?\nAnswer (numerical number):", + "answer": [ + "132.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1COCC(C1CCO)(F)F\nAnswer:", + "answer": [ + "2-(3,3-difluorooxan-4-yl)ethanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1=CNSSC=C1?\nAnswer:", + "answer": [ + "C4H5NS2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H14F2O?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H19NO3?\nAnswer:", + "answer": [ + "CCCNCCOC(C)C(=O)OC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-methyl-3-(oxolan-2-ylmethylamino)pentan-1-ol?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-(3-chloro-2-methylprop-2-enoxy)-N-propan-2-ylpropan-1-amine?\nAnswer:", + "answer": [ + "C10H20ClNO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H16O3?\nAnswer (numerical number):", + "answer": [ + "172.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCCCCCNCC1CCCOC1?\nAnswer (numerical number):", + "answer": [ + "213.36" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-[[(2R)-1-methylpiperidin-2-yl]methyl]-5,6-dihydro-4H-1,3-thiazin-2-amine?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (3R)-N-[2-[(2S)-oxolan-2-yl]ethyl]thiolan-3-amine?\nAnswer:", + "answer": [ + "C1CC(OC1)CCNC2CCSC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCC(CCC=C)NCC1CCCC1O\nAnswer:", + "answer": [ + "(1S,2S)-2-[[[(3R)-hept-6-en-3-yl]amino]methyl]cyclopentan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CN1CCC(CC1)CCN(C)O?\nAnswer:", + "answer": [ + "C9H20N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2,3-dimethyloxirane;ethane?\nAnswer (numerical number):", + "answer": [ + "102.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H17NO?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H22?\nAnswer (numerical number):", + "answer": [ + "154.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H10F2?\nAnswer:", + "answer": [ + "2-ethyl-1,5-difluoro-3-methylbenzene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC=C(CI)C(=O)O\nAnswer:", + "answer": [ + "(E)-2-(iodomethyl)but-2-enoic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H10O?\nAnswer:", + "answer": [ + "(1S,4S)-bicyclo[2.2.1]hept-2-ene-2-carbaldehyde" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C4H5F2N3?\nAnswer:", + "answer": [ + "C1=C(C=NN1C(F)F)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (1R,5S,6S)-tricyclo[4.2.1.03,8]nonan-5-ol?\nAnswer:", + "answer": [ + "C1C2CC3C2CC1C(C3)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (2R)-2-butanoyloxypropanoic acid?\nAnswer:", + "answer": [ + "C7H12O4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2,5-dimethyl-1-pent-3-ynylpiperazine?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCCCC(CCCC)CO?\nAnswer (numerical number):", + "answer": [ + "172.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H12N2O?\nAnswer:", + "answer": [ + "(3-ethoxyphenyl)methyldiazene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H18N2S2?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1=C(SC=C1C=O)C(F)F?\nAnswer:", + "answer": [ + "C6H4F2OS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2R)-2-(ethylamino)butanenitrile?\nAnswer:", + "answer": [ + "CCC(C#N)NCC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-(2-methylthiolan-3-yl)morpholin-4-amine?\nAnswer (numerical number):", + "answer": [ + "202.32" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C5H11NO3?\nAnswer:", + "answer": [ + "C1COCC[N+]1(CO)[O-]" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-cyclopentyl-2-pentan-2-yloxyethanamine?\nAnswer (numerical number):", + "answer": [ + "199.33" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-(5-bromopyridin-3-yl)propanenitrile?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (7S,8S)-7,8-dimethyl-1-azaspiro[4.4]nonane?\nAnswer (numerical number):", + "answer": [ + "153.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C6H13NO2?\nAnswer:", + "answer": [ + "(3S,4R)-3,4-dimethoxypyrrolidine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H14O3S?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC1C(=NN(C1=O)C)C?\nAnswer:", + "answer": [ + "C7H12N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H20ClNO2?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H9NO2?\nAnswer:", + "answer": [ + "methyl (2E)-2-[(methylideneamino)methylidene]but-3-enoate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CN1C(=C(NC1=O)CS)O?\nAnswer (numerical number):", + "answer": [ + "160.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-[3-(1-hydroxycyclopropyl)propyl]cyclopropan-1-ol?\nAnswer:", + "answer": [ + "C1CC1(CCCC2(CC2)O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H13BrS?\nAnswer:", + "answer": [ + "CC1C2(CCS1)CC2CBr" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1=NC2=C(S1)CN(C2)N?\nAnswer (numerical number):", + "answer": [ + 19 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC#CCCC(CC1CCCCO1)N\nAnswer:", + "answer": [ + "1-(oxan-2-yl)hept-5-yn-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H15P?\nAnswer (numerical number):", + "answer": [ + "166.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (2-bromo-1-fluoroethyl)cyclopropane?\nAnswer:", + "answer": [ + "C5H8BrF" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H19NO4?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1=NN=C(C1=NN)N?\nAnswer (numerical number):", + "answer": [ + 13 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-[(thiolan-3-ylmethylamino)methyl]pentan-1-ol?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-propylcyclohex-2-en-1-one?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCSC#N.C1CCSC1?\nAnswer:", + "answer": [ + "C8H15NS2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(C)SCP(=O)(O)O?\nAnswer:", + "answer": [ + "C4H11O3PS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-ethenyl-4-ethyl-2-methylhexan-1-amine?\nAnswer:", + "answer": [ + "CCC(CC)CC(C)(CN)C=C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC=C(C)C(C)C(=CC=C)C?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H11NO?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H15NO2?\nAnswer:", + "answer": [ + "1-(azetidin-3-yloxy)-2-methylpropan-2-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-pent-1-yn-3-ylpent-1-yn-3-amine?\nAnswer (numerical number):", + "answer": [ + "149.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C#CCCCC#CO\nAnswer:", + "answer": [ + "hepta-1,6-diyn-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CN1C=NC(=C1N)C2CCSC2\nAnswer:", + "answer": [ + "3-methyl-5-(thiolan-3-yl)imidazol-4-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (2S)-N,2-dimethyl-3-(1-methylpyrazol-4-yl)propan-1-amine?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 4-chloro-N-(2-methoxypropyl)butanamide?\nAnswer (numerical number):", + "answer": [ + "193.67" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-[ethyl(methylamino)amino]-3-(methylamino)pentan-2-ol?\nAnswer:", + "answer": [ + "CCC(C(CN(CC)NC)O)NC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of COC1C=COO1\nAnswer:", + "answer": [ + "3-methoxy-3H-dioxole" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC.C1=CC=NC(=C1)CO\nAnswer:", + "answer": [ + "ethane;pyridin-2-ylmethanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCNCCOCC1=NC=CN1CC?\nAnswer (numerical number):", + "answer": [ + "197.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (2S,4R)-4-(cyclohexylmethyl)-2-methylpyrrolidine?\nAnswer (numerical number):", + "answer": [ + "181.32" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in [(1S,3R)-3-methylcyclohexyl]oxyphosphane?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-ethyl-3-(2-methylprop-2-enyl)urea?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of methyl N-prop-1-enylpropanimidate?\nAnswer (numerical number):", + "answer": [ + "127.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1CC(N(C(C=N1)C)C)C?\nAnswer (numerical number):", + "answer": [ + "154.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H14O2?\nAnswer:", + "answer": [ + "2-(3-ethynylcyclohex-3-en-1-yl)ethane-1,1-diol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (buta-1,2-dienylamino) cyanate?\nAnswer (numerical number):", + "answer": [ + "110.11" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1COCCNC1C2=CSC=C2?\nAnswer (numerical number):", + "answer": [ + "183.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2,2-difluoro-3-[[(2R)-2-hydroxypropyl]amino]propan-1-ol?\nAnswer:", + "answer": [ + "CC(CNCC(CO)(F)F)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC=CCCOC1CCCCO1?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H18O2?\nAnswer:", + "answer": [ + "CC(C)C1CCCC1C(=O)OC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1(CC1)CNCCC(C)(C)O?\nAnswer:", + "answer": [ + "C10H21NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC1=CNC(CC1)CO?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H13ClO2?\nAnswer:", + "answer": [ + "CCCCC1CC(C(=O)O1)Cl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H14ClNS?\nAnswer:", + "answer": [ + "CC(CN)SCC(=CCl)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H9N?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1C=NC2=NC=NC=C21\nAnswer:", + "answer": [ + "5H-pyrrolo[2,3-d]pyrimidine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H8N2S2?\nAnswer:", + "answer": [ + "CC1=CC(=S)N=C(N1)SC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(=C(C)N)C(N)NC?\nAnswer (numerical number):", + "answer": [ + "129.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1CC(CCNC1)O\nAnswer:", + "answer": [ + "6-methylazepan-4-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-chloroethyl 4-oxopentanoate?\nAnswer (numerical number):", + "answer": [ + 22 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCN1CCCN(C1=O)C2CC2\nAnswer:", + "answer": [ + "1-cyclopropyl-3-ethyl-1,3-diazinan-2-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H16O3?\nAnswer:", + "answer": [ + "pentan-3-yl 2-ethenoxyacetate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H19N3?\nAnswer (numerical number):", + "answer": [ + "169.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-(3-bromopropyl)-N-methylcyclopropanecarboxamide?\nAnswer:", + "answer": [ + "CN(CCCBr)C(=O)C1CC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2S,4S)-2,5-diamino-4-fluoropentanoic acid?\nAnswer:", + "answer": [ + "C(C(CN)F)C(C(=O)O)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1CCCCS1\nAnswer:", + "answer": [ + "(2R)-2-methylthiane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H14O2S?\nAnswer (numerical number):", + "answer": [ + "162.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC=COOOO\nAnswer:", + "answer": [ + "(Z)-1-hydroperoxyperoxyprop-1-ene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1CN(CS1)C(=O)C?\nAnswer:", + "answer": [ + "C6H11NOS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3,3-diaminopropanoic acid;hydrochloride?\nAnswer:", + "answer": [ + "C(C(N)N)C(=O)O.Cl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1=NN=NN1CCC(=O)O?\nAnswer (numerical number):", + "answer": [ + 16 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(C)CCCCCCCCOC=O\nAnswer:", + "answer": [ + "9-methyldecyl formate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (2R)-bicyclo[2.2.1]heptane-2-carbaldehyde?\nAnswer:", + "answer": [ + "C8H12O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-(3-hydroxypropyl)octan-2-one?\nAnswer (numerical number):", + "answer": [ + "186.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-(thiolan-3-ylmethyl)cyclohex-2-en-1-amine?\nAnswer:", + "answer": [ + "C11H19NS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C6H10OS2?\nAnswer:", + "answer": [ + "1,1,1,3-tetradeuterio-4,4-bis(methylsulfanyl)but-3-en-2-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (E)-3-(cyclohexen-1-yl)prop-2-ene-1,1-diol?\nAnswer:", + "answer": [ + "C9H14O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(=CCl)CN1CCOCC1CBr\nAnswer:", + "answer": [ + "3-(bromomethyl)-4-(3-chloro-2-methylprop-2-enyl)morpholine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H14O3?\nAnswer:", + "answer": [ + "1-(furan-2-yl)pentane-1,4-diol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H23Cl?\nAnswer (numerical number):", + "answer": [ + 35 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(CO)COCCC1CCNC1?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-methoxy-2-methylpentane-1,3-diol?\nAnswer:", + "answer": [ + "CCC(C(C)C(O)OC)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H16N4O?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H17NO2S?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C5H11IN2S?\nAnswer:", + "answer": [ + "CSC1=[NH+]CCCN1.[I-]" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1=CSC=C1C(CNCCF)O?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-[[(2S)-oxan-2-yl]methyl]-1-[(3S)-oxolan-3-yl]methanamine?\nAnswer (numerical number):", + "answer": [ + 35 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-(4-methoxybutan-2-yl)-N'-methylmethanimidamide?\nAnswer:", + "answer": [ + "C7H16N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C=CC=CCCCCC=CC#N?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-methyl-N-[(2-methylcyclopentyl)methyl]thiolan-3-amine?\nAnswer (numerical number):", + "answer": [ + "213.38" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H13NO?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCC(C#C)NC1CCCC1CN\nAnswer:", + "answer": [ + "2-(aminomethyl)-N-hex-1-yn-3-ylcyclopentan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C#CCCCCNCC1CCSC1\nAnswer:", + "answer": [ + "N-(thiolan-3-ylmethyl)hex-5-yn-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H20ClNO2?\nAnswer (numerical number):", + "answer": [ + "209.71" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-ethoxy-N-(2-propylsulfonylethyl)ethanamine?\nAnswer:", + "answer": [ + "CCCS(=O)(=O)CCNCCOCC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H12O2?\nAnswer:", + "answer": [ + "2-methoxy-6-methylcyclohex-2-en-1-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H13I?\nAnswer (numerical number):", + "answer": [ + "212.07" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-[[(3-chloro-2-methylprop-2-enyl)amino]methyl]cyclopentan-1-ol?\nAnswer:", + "answer": [ + "C10H18ClNO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-(3-methylfuran-2-yl)prop-2-yn-1-amine?\nAnswer:", + "answer": [ + "C8H9NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCCCCOC(=O)C1CN1CCO?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(C)(C)C(=O)CN(C)F?\nAnswer:", + "answer": [ + "C7H14FNO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C6H9ClO2?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-piperidin-4-ylpentan-2-ol?\nAnswer (numerical number):", + "answer": [ + "171.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(C(=O)O)NC1CCSCC1?\nAnswer:", + "answer": [ + "C8H15NO2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (3S)-N,N,3-trihydroxypyrrolidine-1-carboxamide?\nAnswer (numerical number):", + "answer": [ + "162.14" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1(C2CCC1C=C2)C.S?\nAnswer:", + "answer": [ + "C9H16S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCCNC1=NC(=O)C=NN1\nAnswer:", + "answer": [ + "3-(butylamino)-2H-1,2,4-triazin-5-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1CC1C2=C(C2)C?\nAnswer:", + "answer": [ + "C8H12" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H19ClN2?\nAnswer:", + "answer": [ + "CCN(C)CCNCC(=CCl)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1=NC(=NC=C1)CC(C)N?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H18N2?\nAnswer:", + "answer": [ + "C=CCCN1CCCC(C1)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H14O2?\nAnswer:", + "answer": [ + "CC=CCC(C)(C=C)C(=O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H20N2O?\nAnswer:", + "answer": [ + "N-[2-(1-methylpiperidin-4-yl)ethoxy]methanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C=CC(=O)OC1CCOC1=C?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H17F2N?\nAnswer:", + "answer": [ + "CCCC(CC1CCCN1)(F)F" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(CCCOCC(F)(F)F)Cl?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C)C(=O)N(C)C?\nAnswer (numerical number):", + "answer": [ + "115.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H10INO?\nAnswer (numerical number):", + "answer": [ + "239.05" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1=NC=NC=C1C2CNCCO2?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-propan-2-ylsulfanylhept-5-yn-2-one?\nAnswer:", + "answer": [ + "CC#CCCC(=O)CSC(C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C6H12ClNO?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H15NS?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H9N3O?\nAnswer (numerical number):", + "answer": [ + "139.16" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (2R)-3-(1H-imidazol-5-yl)-2-(methylamino)propane-1-thiol?\nAnswer:", + "answer": [ + "C7H13N3S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H19NO?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C(=O)OC)(NC=O)OC?\nAnswer (numerical number):", + "answer": [ + "161.16" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC(C)CCCCCC1=CC=CO1?\nAnswer (numerical number):", + "answer": [ + "194.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of pentan-2-yl (2R)-2-aminopropanoate?\nAnswer (numerical number):", + "answer": [ + "159.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (3R)-3-methylnonanal?\nAnswer (numerical number):", + "answer": [ + "156.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 6-methyl-2,3,4,5-tetrahydropyridine-3-carboxamide?\nAnswer:", + "answer": [ + "CC1=NCC(CC1)C(=O)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C12H15NO?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C6H8Br2O2?\nAnswer:", + "answer": [ + "(7R)-8,8-dibromo-3,5-dioxabicyclo[5.1.0]octane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CCCCC=CCC=CCCC1?\nAnswer (numerical number):", + "answer": [ + "178.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(C(C(=O)N)O)NCl?\nAnswer:", + "answer": [ + "C5H11ClN2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C5H8ClN?\nAnswer:", + "answer": [ + "CC(C#N)C(C)Cl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H22ClNO?\nAnswer:", + "answer": [ + "N-(3-butoxypropyl)-3-chloro-2-methylprop-2-en-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H9ClINO2?\nAnswer (numerical number):", + "answer": [ + "289.50" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1CC1NCC2=CN=C(N2)C?\nAnswer:", + "answer": [ + "C9H15N3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCC(CC)C1CCCCN1\nAnswer:", + "answer": [ + "2-hexan-3-ylpiperidine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-(1,2-dihydroxy-3-sulfanylpropyl)sulfanylpropanal?\nAnswer:", + "answer": [ + "CC(C=O)SC(C(CS)O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H16O4?\nAnswer (numerical number):", + "answer": [ + "176.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-(1-chloro-3-methoxypropan-2-yl)octan-1-amine?\nAnswer:", + "answer": [ + "C12H26ClNO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(CO)N1CC2CC2C1?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H21NO2S?\nAnswer:", + "answer": [ + "4-butylsulfonyl-N-methylbutan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H18ClNO?\nAnswer:", + "answer": [ + "3-[[(E)-3-chloroprop-2-enyl]amino]-3-methylpentan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(=O)C(C)(C)OCCOCCO?\nAnswer (numerical number):", + "answer": [ + "190.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(=O)C1=CC=CCC=CC1\nAnswer:", + "answer": [ + "1-cycloocta-1,3,6-trien-1-ylethanone" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H7ClOS?\nAnswer:", + "answer": [ + "CC=C(C=O)SC(=C)Cl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CSCC(N1)C2=NC=CO2?\nAnswer:", + "answer": [ + "C7H10N2OS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of methyl 2-(hydroxymethyl)-1-methylpyrrolidine-2-carboxylate?\nAnswer:", + "answer": [ + "CN1CCCC1(CO)C(=O)OC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in fluoroethane;fluoromethane;fluoromethoxymethoxyethane?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1C(C(COCO1)O)NS?\nAnswer:", + "answer": [ + "C5H11NO3S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-cyclopropyl-2-ethoxy-N,2-dimethylpropan-1-amine?\nAnswer:", + "answer": [ + "CCOC(C)(CC1CC1)CNC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1=C(C(=S)N=CN1)N?\nAnswer:", + "answer": [ + "C5H7N3S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H18N2O?\nAnswer:", + "answer": [ + "CCCN1CCCCC1C(=O)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C4H8N2O?\nAnswer (numerical number):", + "answer": [ + 15 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H20N2O2?\nAnswer (numerical number):", + "answer": [ + "188.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-(1,3-dioxetan-2-yl)pyrrolidine?\nAnswer:", + "answer": [ + "C1CCN(C1)C2OCO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of [ethoxy(methoxy)methyl] carbamate?\nAnswer:", + "answer": [ + "CCOC(OC)OC(=O)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H16O2?\nAnswer:", + "answer": [ + "CC(C)C(C)C(C)C(=O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCC(C(=O)O)OCCNCC?\nAnswer (numerical number):", + "answer": [ + "189.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 9-methyl-2,4-dioxaspiro[5.5]undec-9-ene?\nAnswer:", + "answer": [ + "CC1=CCC2(CC1)COCOC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2S)-1-[(3S)-oxolan-3-yl]oxypropan-2-ol?\nAnswer:", + "answer": [ + "CC(COC1CCOC1)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-ethyl-N-hexan-3-ylpentan-2-amine?\nAnswer:", + "answer": [ + "C13H29N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H15NO2S?\nAnswer:", + "answer": [ + "methyl 2-[(2-methylthiolan-3-yl)amino]acetate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N,N-dimethyl-2-[(5S)-1-methyl-1,4-diazepan-5-yl]ethanamine?\nAnswer:", + "answer": [ + "CN1CCC(NCC1)CCN(C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCC(C=CC=CCCO)O\nAnswer:", + "answer": [ + "nona-3,5-diene-1,7-diol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C4H9NO?\nAnswer (numerical number):", + "answer": [ + "87.12" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-[1-(2-aminoethyl)piperidin-2-yl]-N,N-dimethylpropan-1-amine?\nAnswer:", + "answer": [ + "C12H27N3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-[(trifluoromethylamino)methyl]cyclopentan-1-amine?\nAnswer:", + "answer": [ + "C1CC(CC1CNC(F)(F)F)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H17ClN2?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1CNC(CO1)CC(C)C?\nAnswer (numerical number):", + "answer": [ + "157.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CCCC(CC1)CN2CCCC2?\nAnswer:", + "answer": [ + "C12H23N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C(C)(C#N)Br)Br?\nAnswer (numerical number):", + "answer": [ + "240.92" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H12N2?\nAnswer:", + "answer": [ + "CC(C)N1C=C(C=N1)C=C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1CC2CC1CC2C(=O)Cl?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of COC1=C(C=CN=C1F)C#N\nAnswer:", + "answer": [ + "2-fluoro-3-methoxypyridine-4-carbonitrile" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-methyl-3-prop-1-en-2-ylhexa-1,3-diene?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-hydroxyhexyl thiocyanate?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCC(CC)(CN)N(CC)CC?\nAnswer (numerical number):", + "answer": [ + "186.34" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H20N2O?\nAnswer:", + "answer": [ + "C1CC(CCC1CNC2CNC2)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpropan-1-one?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)CC(CC1=CSC=N1)N?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1CCCCN1CC(C)C?\nAnswer:", + "answer": [ + "C10H21N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of COC1=NC=C(C=C1)CN=O?\nAnswer:", + "answer": [ + "C7H8N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (3R)-3-butoxy-2-oxobutanal?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(CCO)NCCNC(C)CCO\nAnswer:", + "answer": [ + "3-[2-(4-hydroxybutan-2-ylamino)ethylamino]butan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(=C)C=CC1CCC(CC1)N?\nAnswer (numerical number):", + "answer": [ + "165.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1=CC=CC=C1C(CO)OC\nAnswer:", + "answer": [ + "2-methoxy-2-(2-methylphenyl)ethanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of ethyl (4R)-4-methyl-4H-imidazole-5-carboxylate?\nAnswer:", + "answer": [ + "C7H10N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CC1C2=NC=CNC2=S?\nAnswer (numerical number):", + "answer": [ + "152.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H14O?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C(=CS(=O)(=O)C=CF)F\nAnswer:", + "answer": [ + "1-fluoro-2-(2-fluoroethenylsulfonyl)ethene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H7FN2O2?\nAnswer:", + "answer": [ + "C1=C(C=NN1CCC(=O)O)F" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-methylidene-N-propylpent-3-enamide?\nAnswer:", + "answer": [ + "C9H15NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-(pent-3-ynoxymethyl)pentan-3-amine?\nAnswer:", + "answer": [ + "CCC(CC)(COCCC#CC)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-methyl-2-(5,6,7,8-tetrahydroindolizin-2-yl)ethanamine?\nAnswer (numerical number):", + "answer": [ + "178.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C12H26N2?\nAnswer (numerical number):", + "answer": [ + "198.35" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C14H22?\nAnswer:", + "answer": [ + "4-propylideneundeca-1,5,8-triene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H17NS2?\nAnswer:", + "answer": [ + "N-[(4-methylthiophen-3-yl)methyl]-1-(thiolan-3-yl)methanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-fluoro-N-methyl-3-(oxan-4-yl)propan-1-amine?\nAnswer (numerical number):", + "answer": [ + "175.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CNOCC1CCCCS1?\nAnswer (numerical number):", + "answer": [ + "161.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C2H6NPS?\nAnswer:", + "answer": [ + "CCP(#N)S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H17NO?\nAnswer:", + "answer": [ + "CCN(CC)CC#CC(C)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C4H6ClN5?\nAnswer (numerical number):", + "answer": [ + "159.58" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-amino-2-methyl-3-(3-methylcyclopentyl)guanidine?\nAnswer:", + "answer": [ + "C8H18N4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CSCC1CNC2CC(C2)O?\nAnswer (numerical number):", + "answer": [ + "187.30" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-N-methyldodecane-1,3,12-triamine?\nAnswer (numerical number):", + "answer": [ + "229.41" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-(7-oxoheptyl)formamide?\nAnswer:", + "answer": [ + "C(CCCNC=O)CCC=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C5H7N3S?\nAnswer (numerical number):", + "answer": [ + 16 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1C=CCCC1(C)C=O?\nAnswer:", + "answer": [ + "C9H14O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-cyclopentylhex-4-yn-1-one?\nAnswer (numerical number):", + "answer": [ + "164.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H13N?\nAnswer:", + "answer": [ + "CC1=CC2CCCC2N1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H19NO2?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H13N3?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H12N2S?\nAnswer:", + "answer": [ + "1-(pyridin-4-ylmethylamino)ethanethiol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C5H9BrN4?\nAnswer (numerical number):", + "answer": [ + "205.06" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-[(2R)-1-methoxypropan-2-yl]-2,5-dimethylpyrrole?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCC(C)NC(=O)CCC?\nAnswer:", + "answer": [ + "C9H19NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 4-(difluoromethylsulfanyl)piperidine?\nAnswer:", + "answer": [ + "C1CNCCC1SC(F)F" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H6F2N2S?\nAnswer:", + "answer": [ + "CSC1=NC=NC(=C1)C(F)F" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-bromopiperidine-2,6-dione?\nAnswer (numerical number):", + "answer": [ + 15 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H18O2?\nAnswer (numerical number):", + "answer": [ + "170.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1CCC(C(C1)(O)F)C?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCCCCSCC(C)(C)C?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1,1-difluoro-1-(oxan-2-yl)propan-2-ol?\nAnswer (numerical number):", + "answer": [ + "180.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1COCCNC1C2=CSC=N2?\nAnswer:", + "answer": [ + "C8H12N2OS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC(C)(CCO)NCCCCO?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H16OS?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H10O2?\nAnswer:", + "answer": [ + "5-ethenyloxan-2-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H12N2O3?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 4-(hex-1-yn-3-ylamino)-2-methylbutan-2-ol?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(C)(C)OCCCN1CCOCC1\nAnswer:", + "answer": [ + "4-[3-[(2-methylpropan-2-yl)oxy]propyl]morpholine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H14N4O?\nAnswer (numerical number):", + "answer": [ + "182.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CON1C(=C)CC(C1=C)O?\nAnswer (numerical number):", + "answer": [ + "141.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCCCCCCCCCC=CCS\nAnswer:", + "answer": [ + "tetradec-2-ene-1-thiol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H14N2?\nAnswer:", + "answer": [ + "CCCC(C)C(C#N)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC(CC)C(CC(=O)C=C)O?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (Z)-1-N-methyl-1-N-prop-1-en-2-ylprop-1-ene-1,2-diamine?\nAnswer:", + "answer": [ + "CC(=C)N(C)C=C(C)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CC1C2C3CCC(C3CN2)N?\nAnswer (numerical number):", + "answer": [ + "166.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 7-ethyl-3-methyl-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole?\nAnswer (numerical number):", + "answer": [ + "167.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (3S)-4-methyl-3-(nitrosomethyl)morpholine?\nAnswer:", + "answer": [ + "CN1CCOCC1CN=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in [(Z)-3-methylpent-3-en-2-yl] acetate?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H13F3O?\nAnswer:", + "answer": [ + "CCC(C(F)(F)F)OC(C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 5-methoxy-4,5-dimethylhept-2-enal?\nAnswer (numerical number):", + "answer": [ + "170.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H16ClNO?\nAnswer:", + "answer": [ + "CC(=CCl)CN1CCC(C1)CO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(COC(=O)CBr)O?\nAnswer:", + "answer": [ + "C6H11BrO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-[(2R)-2-bromopropyl]-4-methyl-1,3-thiazole?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H19NO2?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(C#C)C1(CC1)C(=O)C?\nAnswer:", + "answer": [ + "C9H12O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-methylidenethiolane?\nAnswer (numerical number):", + "answer": [ + 14 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC.CC.C1=CC(C=C1)I?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H14N2O?\nAnswer:", + "answer": [ + "C1CC(C(C1)NCCO)C#N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H18N2?\nAnswer (numerical number):", + "answer": [ + "142.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1C=NC2=C(S1)C=NC=C2?\nAnswer (numerical number):", + "answer": [ + "150.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of S-methyl dodecanethioate?\nAnswer:", + "answer": [ + "CCCCCCCCCCCC(=O)SC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-(1-methyl-5-propylpyrazol-3-yl)propan-1-amine?\nAnswer (numerical number):", + "answer": [ + "181.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-methoxy-2-(methylsulfamoylamino)propan-1-ol?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H13NO?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-ethenyl-2-methyl-N-propan-2-ylpentan-1-amine?\nAnswer:", + "answer": [ + "C11H23N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-ethyl-2-methylpentan-3-imine?\nAnswer:", + "answer": [ + "CCC(=NCC)C(C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H16O?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC=C(CCCN)C(=O)OC?\nAnswer:", + "answer": [ + "C8H15NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C13H28N2?\nAnswer (numerical number):", + "answer": [ + 43 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (3R)-3-(5-methylthiophen-2-yl)piperidine?\nAnswer (numerical number):", + "answer": [ + "181.30" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (2S)-1-amino-2-(1-methylpiperidin-4-yl)propan-2-ol?\nAnswer (numerical number):", + "answer": [ + "172.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-hydroxy-3-(oxan-3-yl)butanal?\nAnswer:", + "answer": [ + "C9H16O3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-cycloheptyl-2-fluoropropan-1-ol?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of ethyl N-(propan-2-ylamino)carbamate?\nAnswer:", + "answer": [ + "C6H14N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC(CN1C=C(NC1=O)O)O?\nAnswer (numerical number):", + "answer": [ + "172.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H14N2O3?\nAnswer:", + "answer": [ + "CC(C1CNCCN1C(=O)O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)CNC(C#N)C1CCSC1?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-ethynyl-5-fluorocyclohexa-1,3-diene?\nAnswer (numerical number):", + "answer": [ + 16 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(CO)(COC)C=O?\nAnswer:", + "answer": [ + "C6H12O3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1=S(CCN1C)C?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H22N2O?\nAnswer:", + "answer": [ + "(3R,4R)-N-ethyl-3-pyrrolidin-1-yloxan-4-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H22N2?\nAnswer (numerical number):", + "answer": [ + "182.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-[[(2S)-butan-2-yl]oxymethyl]prop-2-enamide?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-(1H-imidazol-2-yl)hex-4-yn-1-one?\nAnswer:", + "answer": [ + "C9H10N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H19ClO?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC(CC)(COCCNCC)O?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H17NO2?\nAnswer:", + "answer": [ + "ethyl 2-[(2S)-1-methylpyrrolidin-2-yl]acetate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in [2-(oxetan-3-ylamino)cyclopentyl]methanol?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1CC2(CCNC2)CC1C(F)F?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C=CCCCOCl?\nAnswer (numerical number):", + "answer": [ + 16 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (Z)-4-methylidene-6-(methylideneamino)hex-5-en-3-one?\nAnswer:", + "answer": [ + "CCC(=O)C(=C)C=CN=C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(CCCNCCCCOC)Cl?\nAnswer (numerical number):", + "answer": [ + 35 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H20ClN?\nAnswer:", + "answer": [ + "2-(cyclobutylmethyl)piperidine;hydrochloride" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-[(3-chloro-2-methylprop-2-enyl)amino]-2-methylpropan-1-ol?\nAnswer:", + "answer": [ + "CC(=CCl)CNC(C)(C)CO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (2S)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carbaldehyde?\nAnswer (numerical number):", + "answer": [ + "139.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H20O2?\nAnswer:", + "answer": [ + "(1R,3R)-1-cyclohexylpent-4-ene-1,3-diol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1CC(=O)N(C1=O)CC#N\nAnswer:", + "answer": [ + "2-[(3R)-3-methyl-2,5-dioxopyrrolidin-1-yl]acetonitrile" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-(diethylamino)ethyl methanesulfonate?\nAnswer (numerical number):", + "answer": [ + "195.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H23NO?\nAnswer (numerical number):", + "answer": [ + "185.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H20N2O?\nAnswer:", + "answer": [ + "N-[(1-ethylpyrrol-2-yl)methyl]-2-methoxypropan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H17N?\nAnswer:", + "answer": [ + "CC=CC=C(C=CC)N(C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H19FN2?\nAnswer (numerical number):", + "answer": [ + "174.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3,3,3-trifluoro-N-(thiolan-3-ylmethyl)propan-1-amine?\nAnswer (numerical number):", + "answer": [ + "213.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCNC(=O)OCCP(=O)(O)O?\nAnswer:", + "answer": [ + "C5H12NO5P" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCC(C)OC(=O)C(CN)O?\nAnswer:", + "answer": [ + "C8H17NO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)(C(=O)OCCON)Br?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H15N?\nAnswer:", + "answer": [ + "N-tert-butylbut-2-en-1-imine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-oxaspiro[4.5]decan-4-ylmethanamine?\nAnswer:", + "answer": [ + "C1CCC2(CC1)C(CCO2)CN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H12O?\nAnswer:", + "answer": [ + "(5S)-2,5-dimethylcyclohex-2-en-1-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of methylsulfanylsulfinyloxysulfanylmethane?\nAnswer (numerical number):", + "answer": [ + "158.3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H16N2?\nAnswer:", + "answer": [ + "N-(3-methylbut-2-enyl)azetidin-3-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H19N?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1CNCCC1C=C(C(=O)O)F\nAnswer:", + "answer": [ + "(Z)-2-fluoro-3-piperidin-4-ylprop-2-enoic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C(OS(=O)O)(I)(I)I?\nAnswer (numerical number):", + "answer": [ + "473.80" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-[(3E)-3-methylhexa-1,3-dien-2-yl]ethanimine?\nAnswer:", + "answer": [ + "CCC=C(C)C(=C)N=CC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-(3-hydroxy-3-methylpyrrolidin-1-yl)acetaldehyde?\nAnswer:", + "answer": [ + "CC1(CCN(C1)CC=O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-(ethylamino)-N-methylsulfonylacetamide?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (Z)-3-amino-N'-ethyl-N-methylidenebut-2-enimidamide?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-piperazin-1-yl-1,3-thiazole?\nAnswer:", + "answer": [ + "C1CN(CCN1)C2=NC=CS2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H16N2S?\nAnswer (numerical number):", + "answer": [ + "184.30" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-butan-2-yl-2-(chloromethyl)cyclohexan-1-amine?\nAnswer (numerical number):", + "answer": [ + "203.75" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(=O)CN(C)CN(C)C?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-[(propan-2-ylamino)methylidene]cyclohexan-1-one?\nAnswer (numerical number):", + "answer": [ + "167.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2R)-2-[(3-methylthiophen-2-yl)methyl]pyrrolidine?\nAnswer:", + "answer": [ + "CC1=C(SC=C1)CC2CCCN2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C12H23N?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[1,2-a]azepin-9-ylmethanol?\nAnswer (numerical number):", + "answer": [ + "169.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H12N2O2?\nAnswer (numerical number):", + "answer": [ + "156.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (E)-N-propan-2-ylpent-3-enamide?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (6R,10S)-10-methyl-4-oxa-1-azaspiro[5.5]undecane?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C5H11P?\nAnswer:", + "answer": [ + "dimethyl(propylidyne)-\u00ce\u00bb5-phosphane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H13NS?\nAnswer (numerical number):", + "answer": [ + "155.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H19NS?\nAnswer (numerical number):", + "answer": [ + "185.33" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (3aR,6aS)-5-methyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,3]oxazol-2-one?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCCOC(=O)COC(C)CNC\nAnswer:", + "answer": [ + "butyl 2-[1-(methylamino)propan-2-yloxy]acetate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (5-oxopyrrolidin-3-yl)cyanamide?\nAnswer (numerical number):", + "answer": [ + "125.13" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1CCCN2C1CC(C2)C?\nAnswer:", + "answer": [ + "C10H19N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C4H7N5S?\nAnswer (numerical number):", + "answer": [ + 17 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-[(Z)-but-2-en-2-yl]propan-1-imine?\nAnswer:", + "answer": [ + "CCC=NC(=CC)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)N1CCC(=O)N1CCN?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-ethyl-2-propylhexane-1-thiol?\nAnswer:", + "answer": [ + "C11H24S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCN(CC)CCNCC=CC?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CN1CCCN(CC1=O)CCCC#N?\nAnswer (numerical number):", + "answer": [ + "195.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 4-oxononyl acetate?\nAnswer:", + "answer": [ + "CCCCCC(=O)CCCOC(=O)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in COC(=O)C1CC=CCO1?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H19Br?\nAnswer:", + "answer": [ + "1-bromopentylcyclopentane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 4-(2,2-difluoroethyl)-4-fluoropiperidine?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C(CCN)CC(C(=O)O)N?\nAnswer (numerical number):", + "answer": [ + "151.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H17BrO?\nAnswer:", + "answer": [ + "CCC(CCCCBr)C(=O)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCNC(CC=NCCC)C(=O)C\nAnswer:", + "answer": [ + "3-(propylamino)-5-propyliminopentan-2-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-bromo-7-methyl-4,5,6,7-tetrahydrofuro[3,2-c]pyridine?\nAnswer (numerical number):", + "answer": [ + "216.07" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of [(2R)-2,3-dimethylbutyl] acetate?\nAnswer:", + "answer": [ + "C8H16O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of methyl N-(1-amino-4-methylpentan-3-yl)carbamate?\nAnswer:", + "answer": [ + "CC(C)C(CCN)NC(=O)OC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1COCC(N1)C2COCCO2\nAnswer:", + "answer": [ + "3-(1,4-dioxan-2-yl)morpholine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1CN(C2=C1C=CN=C2)C\nAnswer:", + "answer": [ + "1,3-dimethyl-2,3-dihydropyrrolo[2,3-c]pyridine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCC=CC#CCCBr\nAnswer:", + "answer": [ + "(E)-1-bromonon-5-en-3-yne" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-amino-2-formylcyclopropane-1-carboxamide?\nAnswer:", + "answer": [ + "C1C(C1(C(=O)N)N)C=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H16S?\nAnswer (numerical number):", + "answer": [ + "156.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-cycloheptylpropane-1,2-diol?\nAnswer (numerical number):", + "answer": [ + "172.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 9-ethyl-3-oxatricyclo[5.2.0.02,4]nonane?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (Z)-1-iodo-4-[(2-methylpropan-2-yl)oxy]but-1-ene?\nAnswer (numerical number):", + "answer": [ + "254.11" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCNCCOCCCCCC(=O)OCC?\nAnswer (numerical number):", + "answer": [ + "231.33" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-amino-N-(3-hydroxypropyl)propanamide?\nAnswer (numerical number):", + "answer": [ + "146.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H16O2?\nAnswer:", + "answer": [ + "[(2S,3S)-3-hex-5-enyloxiran-2-yl]methanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H13NS?\nAnswer:", + "answer": [ + "[CH2-][NH+]1CCCCS1=C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC=CCC(=CC)C(C)(C)O?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C3H8N2OS?\nAnswer:", + "answer": [ + "2-hydroxyethylthiourea" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CN(C)NC1=CCCC=C1?\nAnswer (numerical number):", + "answer": [ + "138.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-(ethylamino)-N-[2-(hydroxymethyl)cyclopentyl]propanamide?\nAnswer (numerical number):", + "answer": [ + "214.30" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H15N?\nAnswer (numerical number):", + "answer": [ + "137.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-(4-methylsulfanylbutyl)hex-1-yn-3-amine?\nAnswer (numerical number):", + "answer": [ + "199.36" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-butylperoxydecane?\nAnswer (numerical number):", + "answer": [ + "230.39" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCOCOC(CCl)CCl\nAnswer:", + "answer": [ + "1,3-dichloro-2-(ethoxymethoxy)propane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (3S)-N-(4-methoxybutyl)thiolan-3-amine?\nAnswer:", + "answer": [ + "C9H19NOS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-[2-(aminomethyl)cyclopentyl]oxypropan-2-ol?\nAnswer:", + "answer": [ + "CC(COC1CCCC1CN)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (3R)-3-methyl-3-(methylamino)oct-7-en-2-one?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-(3-hydroxy-4-methoxybutyl)-2-sulfanylacetamide?\nAnswer:", + "answer": [ + "C7H15NO3S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H21NO?\nAnswer:", + "answer": [ + "CCCC1(CCCC(=NOC1)C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-ethylpenta-2,4-dien-1-imine?\nAnswer:", + "answer": [ + "C7H11N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H18N2S?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N'-ethyl-N'-propyl-N-(thiolan-3-ylmethyl)ethane-1,2-diamine?\nAnswer (numerical number):", + "answer": [ + "230.42" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1C=CN(N=C1I)I?\nAnswer (numerical number):", + "answer": [ + 12 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CNCCOCC1(CCCCC1)O?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-(thiolan-3-ylmethyl)but-3-yn-1-amine?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC(CC1=CN(N=N1)C)N?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1CN=C(S1)C?\nAnswer (numerical number):", + "answer": [ + "115.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H9NO2?\nAnswer:", + "answer": [ + "3-ethyl-1,2-benzoxazol-7-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H21NOS?\nAnswer (numerical number):", + "answer": [ + "215.36" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCC1=C(C=NN1CC)CCNC\nAnswer:", + "answer": [ + "2-(1,5-diethylpyrazol-4-yl)-N-methylethanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-ethyl-4-hydroxy-3-methylpyrrolidin-2-one?\nAnswer:", + "answer": [ + "C7H13NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1C(C2=CC=CC=C12)C\nAnswer:", + "answer": [ + "(7S,8S)-7,8-dimethylbicyclo[4.2.0]octa-1,3,5-triene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-[3-[hydroxy(methoxy)phosphinothioyl]oxypropyldisulfanyl]propan-1-ol?\nAnswer:", + "answer": [ + "C7H17O4PS3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H21NO2?\nAnswer (numerical number):", + "answer": [ + "199.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1CC2COC(C1)O2\nAnswer:", + "answer": [ + "6,8-dioxabicyclo[3.2.1]octane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(=O)OC1CC(NC1)CO?\nAnswer (numerical number):", + "answer": [ + "159.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H18O3?\nAnswer (numerical number):", + "answer": [ + "174.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(C)(C)CCCCNC\nAnswer:", + "answer": [ + "N,5,5-trimethylhexan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H19NO2S?\nAnswer:", + "answer": [ + "N-(1-hydroxy-3-methylpentan-3-yl)-3-sulfanylpropanamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C12H23N?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1C(=O)CO1\nAnswer:", + "answer": [ + "(2R)-2-methyloxetan-3-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H18N2?\nAnswer:", + "answer": [ + "2-(dimethylamino)-2-ethylpentanenitrile" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C4H12O2S2?\nAnswer:", + "answer": [ + "2-sulfanylethanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H17N5?\nAnswer:", + "answer": [ + "N-(2H-tetrazol-5-ylmethyl)hexan-3-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC1CC(C(CO1)O)O?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C4H6N2OS?\nAnswer (numerical number):", + "answer": [ + 14 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H17NO2S?\nAnswer (numerical number):", + "answer": [ + "179.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C4H5N3OS?\nAnswer:", + "answer": [ + "CN1C=C(N=N1)C(=O)S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 4-methyl-2,3,3a,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol;hydrochloride?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-cyclopentylsulfanyl-N-methylhept-5-yn-2-amine?\nAnswer (numerical number):", + "answer": [ + 38 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C(CC(CCCN)CCC(N)N)CN?\nAnswer:", + "answer": [ + "C10H26N4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 4-methyl-3-(oxan-3-yl)piperidine?\nAnswer (numerical number):", + "answer": [ + "183.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCCCS(=O)C=CC(=O)O?\nAnswer:", + "answer": [ + "C8H14O3S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2R)-4-(azetidin-3-yl)-2-ethylmorpholine?\nAnswer:", + "answer": [ + "CCC1CN(CCO1)C2CNC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-[(2S,3R)-2-methyloxetan-3-yl]acetic acid?\nAnswer (numerical number):", + "answer": [ + 19 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CC2=CC=CC=C2C1N?\nAnswer:", + "answer": [ + "C9H11N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H14F2N2?\nAnswer (numerical number):", + "answer": [ + "164.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H10N4OS?\nAnswer:", + "answer": [ + "CN(CC1=NN2CCSC2=N1)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of [2-[[(3-chloro-2-methylprop-2-enyl)amino]methyl]cyclopentyl]methanol?\nAnswer (numerical number):", + "answer": [ + "217.73" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C)N(C(=N)N)C(=O)S?\nAnswer (numerical number):", + "answer": [ + "161.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(C)CNCCCCC1CCSC1\nAnswer:", + "answer": [ + "N-(2-methylpropyl)-4-(thiolan-3-yl)butan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of dideuteriomethyl 5-sulfanylidene-4H-1,3-thiazole-4-carboxylate?\nAnswer (numerical number):", + "answer": [ + "177.2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H18N2O?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCCCC(=O)NCCCC(C)Cl?\nAnswer (numerical number):", + "answer": [ + "219.75" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H18O3?\nAnswer:", + "answer": [ + "butyl (4R)-4-hydroxypentanoate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H8N2O3?\nAnswer (numerical number):", + "answer": [ + "156.14" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CN1CCCN(CC1=O)CCCC#C\nAnswer:", + "answer": [ + "1-methyl-4-pent-4-ynyl-1,4-diazepan-2-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCC=C(CCC)CCC?\nAnswer:", + "answer": [ + "C11H22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1(OCC(O1)C(=O)CI)C?\nAnswer (numerical number):", + "answer": [ + "270.06" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H17F?\nAnswer:", + "answer": [ + "CC(CCCCCCC#C)F" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1CC2=CC=CCCC2=NC1?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CSCC(=O)NCC1CCCNCC1?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H16N2O?\nAnswer:", + "answer": [ + "CC(CNCC1=CNC=C1)OC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 4-(2-bromoethyl)-5-methyl-1H-pyrazole?\nAnswer (numerical number):", + "answer": [ + "189.05" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-[1-(2-methylhydrazinyl)ethylidene]acetamide?\nAnswer:", + "answer": [ + "C5H11N3O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1=NNC2=C1C=NN2?\nAnswer (numerical number):", + "answer": [ + "108.10" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC(CCBr)NCC(=CCl)C?\nAnswer (numerical number):", + "answer": [ + "254.59" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1CN(CCN1)C=S\nAnswer:", + "answer": [ + "piperazine-1-carbothialdehyde" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-(fluoromethyl)cyclooctyne?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-(3,3-difluoropyrrolidin-1-yl)acetic acid?\nAnswer:", + "answer": [ + "C6H9F2NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H15NOS?\nAnswer (numerical number):", + "answer": [ + "173.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-[(2-methoxyphenyl)methoxy]methanamine?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(CSC1CCCCC1N)N\nAnswer:", + "answer": [ + "2-(2-aminopropylsulfanyl)cyclohexan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C5H13N5?\nAnswer:", + "answer": [ + "5-ethyl-2,4-dihydro-1,3,5-triazine-2,3-diamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-[2-(3-methylbutoxy)ethyl]pent-3-yn-1-amine?\nAnswer:", + "answer": [ + "C12H23NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H11N3?\nAnswer:", + "answer": [ + "(2R)-1-pyrimidin-2-ylpropan-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (3R)-1-(cyclobutylmethyl)piperidin-3-amine?\nAnswer:", + "answer": [ + "C1CC(C1)CN2CCCC(C2)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C4H6N4O?\nAnswer (numerical number):", + "answer": [ + 15 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of COCCOCCNC1CCCCCC1C#N\nAnswer:", + "answer": [ + "(1S,2R)-2-[2-(2-methoxyethoxy)ethylamino]cycloheptane-1-carbonitrile" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)SCSCSCSSC(C)C?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-[(6S)-6-methylcyclohex-2-en-1-yl]-2,3-dihydropyridine?\nAnswer:", + "answer": [ + "CC1CCC=CC1C2CN=CC=C2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(=CCNC1CCC(C1)N)C?\nAnswer:", + "answer": [ + "C10H20N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC.CC1=NN(C(=N1)C)C?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC(C#C)NC(CCCN)COC?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H15NO2S?\nAnswer (numerical number):", + "answer": [ + "189.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 4-ethylhexane-1,3,5-triol?\nAnswer (numerical number):", + "answer": [ + "162.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC(C)(C(N)N)N(C)C?\nAnswer (numerical number):", + "answer": [ + "145.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N'-but-1-en-2-ylethane-1,2-diamine?\nAnswer:", + "answer": [ + "C6H14N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C13H25NO?\nAnswer:", + "answer": [ + "(1S,2S)-2-[[[(3S)-hept-6-en-3-yl]amino]methyl]cyclopentan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H17NO2?\nAnswer:", + "answer": [ + "CC(C)(COCCNC)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1=CC=C(N1)C(C)(C)O?\nAnswer (numerical number):", + "answer": [ + "139.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H17NOS?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1CC(CC2(C1)OCCO2)CN\nAnswer:", + "answer": [ + "1,4-dioxaspiro[4.5]decan-7-ylmethanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(C)CCC(=C)C#N?\nAnswer:", + "answer": [ + "C9H15N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H12OS?\nAnswer:", + "answer": [ + "2-ethyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C12H25NO2?\nAnswer:", + "answer": [ + "1-[2-(propylamino)ethoxymethyl]cyclohexan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H23NO?\nAnswer:", + "answer": [ + "3-(oxan-3-yl)-N-propylpropan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (1R,2S)-1-bromo-2-(2-ethoxyethyl)cyclohexane?\nAnswer (numerical number):", + "answer": [ + "235.16" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC#CCCC(C1CCOCC1)NC\nAnswer:", + "answer": [ + "N-methyl-1-(oxan-4-yl)hex-4-yn-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (5S)-5-methyl-2-sulfanylidene-1,3-thiazinan-4-one?\nAnswer:", + "answer": [ + "C5H7NOS2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in butyl 2-(pyrrolidin-3-ylmethoxy)acetate?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H14N2O2?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCCNCC1=CC=C(O1)C?\nAnswer (numerical number):", + "answer": [ + "167.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(CNCCCCN)NC(=O)C?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(C)CC(C)(CBr)C=C?\nAnswer:", + "answer": [ + "C10H19Br" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CCN(C1)CC=C2CCNCC2?\nAnswer (numerical number):", + "answer": [ + "180.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C(CCCCCS)CCCCC(N)O?\nAnswer:", + "answer": [ + "C11H25NOS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H14F2N2O?\nAnswer (numerical number):", + "answer": [ + "180.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of methyl 3-[(3-chloro-2-methylprop-2-enyl)amino]propanoate?\nAnswer:", + "answer": [ + "C8H14ClNO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-methyl-1-azacyclodeca-3,9-diyn-2-one?\nAnswer (numerical number):", + "answer": [ + "161.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C1=CCSCC1)C(=O)O?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-(thiolan-3-ylmethyl)pyridin-2-amine?\nAnswer:", + "answer": [ + "C10H14N2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (3aS,7aR)-1,3-dihydroxy-7a-methyl-2,3a,4,5,6,7-hexahydrobenzimidazole?\nAnswer (numerical number):", + "answer": [ + "172.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-N,1-N-diethylheptane-1,6-diamine?\nAnswer (numerical number):", + "answer": [ + "186.34" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H11NOS?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 4-(pent-3-ynylamino)cyclohexan-1-ol?\nAnswer (numerical number):", + "answer": [ + "181.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-methyl-4-pent-2-en-2-ylpiperidine?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H9IN2?\nAnswer (numerical number):", + "answer": [ + "248.06" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (1S,2S)-2-(propan-2-ylamino)cycloheptane-1-carbonitrile?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CC(C(C1)F)CCN.Cl?\nAnswer:", + "answer": [ + "C7H15ClFN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C3H5KO2S?\nAnswer (numerical number):", + "answer": [ + "144.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H19NS?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H24O3?\nAnswer (numerical number):", + "answer": [ + "204.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1CC(NC(=S)N1)O\nAnswer:", + "answer": [ + "4-hydroxy-6-methyl-1,3-diazinane-2-thione" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1=NC(=N)C=CC1=C?\nAnswer (numerical number):", + "answer": [ + "120.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCCC(CC)C1C(CCN1)C?\nAnswer (numerical number):", + "answer": [ + 38 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H19NO?\nAnswer:", + "answer": [ + "CC(CNCC1(CC1)C)OC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1CCC(C(C1)CC(C)C)O?\nAnswer:", + "answer": [ + "C11H22O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (2S)-2-[[(2S)-pyrrolidin-2-yl]methoxymethyl]pyrrolidine?\nAnswer (numerical number):", + "answer": [ + "184.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCC(CC)(CO)N1CCNCC1\nAnswer:", + "answer": [ + "2-ethyl-2-piperazin-1-ylpentan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(CCNC1CCC(CC1)O)O?\nAnswer:", + "answer": [ + "C11H23NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H23NO2?\nAnswer (numerical number):", + "answer": [ + "201.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCCCCC=CC(F)(F)Cl?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C4H9O6P?\nAnswer:", + "answer": [ + "ethoxycarbonyl(methylperoxy)phosphinic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(=C)CC(CC=C)O?\nAnswer (numerical number):", + "answer": [ + "126.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H12O3?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C2H9NO3Si?\nAnswer (numerical number):", + "answer": [ + "123.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H21ClO?\nAnswer:", + "answer": [ + "1-chloro-5-pentan-2-yloxypentane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-chloro-2-methyl-N-[(1-methylpiperidin-2-yl)methyl]prop-2-en-1-amine?\nAnswer (numerical number):", + "answer": [ + 35 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-[(1R)-1-cyclopropylethyl]-1,4-diazepane?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H11NO2S?\nAnswer (numerical number):", + "answer": [ + "161.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (2Z,4Z)-5,6-dimethylhepta-2,4,6-trien-2-amine?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCSSCC1(CSSCN1)N?\nAnswer (numerical number):", + "answer": [ + "242.5" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of COC(=O)C1(CCC1)OC=C?\nAnswer (numerical number):", + "answer": [ + "156.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC=CC1OCC(O1)CCl?\nAnswer (numerical number):", + "answer": [ + "162.61" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-pentan-2-yloxyhex-1-ene?\nAnswer (numerical number):", + "answer": [ + "170.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC=CCCNCC(=CCl)C?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H13ClO?\nAnswer:", + "answer": [ + "CC(CCC(=CCl)C)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C12H25NO3?\nAnswer (numerical number):", + "answer": [ + 41 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H23NOS?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(CO)SC(=NC)N\nAnswer:", + "answer": [ + "1-hydroxypropan-2-yl N'-methylcarbamimidothioate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of [(1R)-2-(2-methoxyphenyl)cyclopropyl]methanamine?\nAnswer (numerical number):", + "answer": [ + "177.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 5-[(1-aminocyclopentyl)methoxy]pentan-1-ol?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H21NO?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1,2,3,5,6,7,4,8-hexathiadiazocane?\nAnswer:", + "answer": [ + "N1SSSNSSS1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 6-butoxy-5-hydroxyhexan-3-one?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1=NN(C2=C1CCN=C2)C?\nAnswer (numerical number):", + "answer": [ + "149.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCC(C)OC=S?\nAnswer:", + "answer": [ + "C6H12OS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of [1-(thiolan-3-ylmethyl)pyrrolidin-3-yl]methanol?\nAnswer:", + "answer": [ + "C10H19NOS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H8F2O2S?\nAnswer (numerical number):", + "answer": [ + "182.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C6H15NO2S?\nAnswer:", + "answer": [ + "3-[ethyl(methyl)amino]propane-1-sulfinic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H20N2O?\nAnswer (numerical number):", + "answer": [ + "184.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (3S)-5-methyl-3-(trifluoromethyl)hexan-1-amine?\nAnswer (numerical number):", + "answer": [ + "183.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 4-bromo-1-(chloromethyl)-3,5-dimethylpyrazole?\nAnswer:", + "answer": [ + "C6H8BrClN2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C13H25NO2?\nAnswer:", + "answer": [ + "2-(4-methylpiperidin-3-yl)oxycycloheptan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 6-hydroxy-1-methyl-2-methylsulfanylpyrimidin-4-one?\nAnswer:", + "answer": [ + "C6H8N2O2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 6-chloro-3-ethyl-5-methylhex-5-en-2-ol?\nAnswer (numerical number):", + "answer": [ + "176.68" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-[2-(oxetan-3-yl)pyrazol-3-yl]ethanamine?\nAnswer:", + "answer": [ + "CC(C1=CC=NN1C2COC2)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H11NO3?\nAnswer (numerical number):", + "answer": [ + "157.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C5H8Br4?\nAnswer (numerical number):", + "answer": [ + "387.73" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of [(2R)-4-methyl-1-oxopentan-2-yl]carbamic acid?\nAnswer:", + "answer": [ + "CC(C)CC(C=O)NC(=O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N,N,3-triethylpentan-2-amine?\nAnswer:", + "answer": [ + "CCC(CC)C(C)N(CC)CC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-methyl-1-[5-(2-methylpropyl)-1H-pyrazol-4-yl]methanamine?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (1R,2S)-2-(2-methylpropylamino)cyclopentane-1-carbonitrile?\nAnswer:", + "answer": [ + "CC(C)CNC1CCCC1C#N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-imino-1-N'-(methylideneamino)propane-1,1-diamine?\nAnswer:", + "answer": [ + "C=NNC(CC=N)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (Z)-3-hydroxyundec-2-enenitrile?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (4R)-4-methyl-3-pentyl-1,3-oxazolidin-2-one?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CNCCC(=O)NCCC1=CCCC1?\nAnswer:", + "answer": [ + "C11H20N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-(4-methylpent-3-enyl)-2-propylcyclopropane?\nAnswer:", + "answer": [ + "C12H22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCOCOCCC1CCCNC1?\nAnswer (numerical number):", + "answer": [ + "187.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of [4-(oxan-3-yl)morpholin-3-yl]methanamine?\nAnswer:", + "answer": [ + "C1CC(COC1)N2CCOCC2CN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H17F2N?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(CC(CCCCCCO)O)O?\nAnswer (numerical number):", + "answer": [ + 35 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(=O)C1=CC=CC=C1I?\nAnswer:", + "answer": [ + "C8H7IO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-piperidin-3-ylpentan-3-imine?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-chloro-5-methyl-1,3-oxazole?\nAnswer:", + "answer": [ + "C4H4ClNO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H12N2S?\nAnswer (numerical number):", + "answer": [ + "180.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H13N?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H18O2?\nAnswer (numerical number):", + "answer": [ + "170.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCOCCOCCOCCOCCC(=O)F?\nAnswer:", + "answer": [ + "C11H21FO5" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (2S)-2-(5-methoxy-1H-pyrazol-4-yl)propan-1-amine?\nAnswer:", + "answer": [ + "C7H13N3O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H16O?\nAnswer:", + "answer": [ + "(4S)-tricyclo[4.3.1.03,8]decan-4-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 4-cyclopentyl-3-methoxybutan-1-amine?\nAnswer (numerical number):", + "answer": [ + "171.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (1-bromo-4-methoxybutyl)cyclopentane?\nAnswer:", + "answer": [ + "COCCCC(C1CCCC1)Br" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (1S)-2-amino-1-[(4R)-1-methylazepan-4-yl]ethanol?\nAnswer (numerical number):", + "answer": [ + "172.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H18O2?\nAnswer (numerical number):", + "answer": [ + "170.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H10O?\nAnswer:", + "answer": [ + "(2Z,7Z)-5-methylcycloocta-2,4,7-trien-1-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H18N2O2?\nAnswer (numerical number):", + "answer": [ + "174.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1=C(C=C(OSOC1=O)O)O?\nAnswer (numerical number):", + "answer": [ + 15 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCCCCCCOC(=O)C(CO)O?\nAnswer:", + "answer": [ + "C11H22O4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H17ClN2O?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H18O2S?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H13NO?\nAnswer (numerical number):", + "answer": [ + "151.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H17ClO2?\nAnswer:", + "answer": [ + "4-(chloromethyl)-2-ethyl-2-propyl-1,3-dioxolane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-[5-(1-aminopropan-2-yl)pyrazol-1-yl]ethanol?\nAnswer (numerical number):", + "answer": [ + "169.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 4-methoxy-3-methyloxane?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of ethyl (2E)-2-chloro-2-hydrazinylideneacetate?\nAnswer:", + "answer": [ + "CCOC(=O)C(=NN)Cl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CCC(C1)(CI)O?\nAnswer (numerical number):", + "answer": [ + "226.06" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H17N3?\nAnswer:", + "answer": [ + "N'-[(E)-4-(propan-2-ylamino)but-3-en-2-yl]methanimidamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC(CC)(C1CCCOC1)O?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-ethyl-N-hex-1-yn-3-ylhexan-1-amine?\nAnswer (numerical number):", + "answer": [ + "209.37" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H24O3?\nAnswer (numerical number):", + "answer": [ + 38 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of diazaphosphiridine?\nAnswer (numerical number):", + "answer": [ + "62.011" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (3R)-3-methoxypentanal?\nAnswer (numerical number):", + "answer": [ + "116.16" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C=CNC(CS)C=O?\nAnswer (numerical number):", + "answer": [ + "131.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of morpholin-3-yl hydrogen carbonate?\nAnswer:", + "answer": [ + "C5H9NO4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in COC1=CC=CC2=C1CC2CO?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H13FO3?\nAnswer (numerical number):", + "answer": [ + "176.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 4-methyl-1,2,3,4,5,6-hexahydroisoquinoline?\nAnswer (numerical number):", + "answer": [ + "149.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-[2-[[(1S,2R)-2-cyanocyclopentyl]amino]ethyl]acetamide?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-(2-amino-2-ethylbutoxy)cyclopentan-1-ol?\nAnswer:", + "answer": [ + "CCC(CC)(COC1CCCC1O)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC#CCCC(CC1CCCCO1)O?\nAnswer (numerical number):", + "answer": [ + "196.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H13OPS2?\nAnswer (numerical number):", + "answer": [ + "196.3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-(2-aminopyridin-3-yl)ethenol?\nAnswer:", + "answer": [ + "C7H8N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1COCCN1SCP(=O)(O)O?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1=CC=CC=C1OCCN=N\nAnswer:", + "answer": [ + "2-(2-methylphenoxy)ethyldiazene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 5-(chloromethyl)-1-methyl-4,5-dihydroimidazole;hydrochloride?\nAnswer (numerical number):", + "answer": [ + "169.05" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (3R,4R)-3-ethoxy-4-iodocycloheptene?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 4-(2-oxoethoxy)but-2-ynoic acid?\nAnswer:", + "answer": [ + "C(C=O)OCC#CC(=O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCCCCCCCCC1CCN(C1)C\nAnswer:", + "answer": [ + "3-decyl-1-methylpyrrolidine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CCC(C(CC1)OCCN)O?\nAnswer (numerical number):", + "answer": [ + "173.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1(CC1)CNCCCC(=O)NC\nAnswer:", + "answer": [ + "N-methyl-4-[(1-methylcyclopropyl)methylamino]butanamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C3H5NO2S?\nAnswer:", + "answer": [ + "(3Z)-3-sulfinoiminoprop-1-ene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C(CN)C(CC(C(=O)O)N)O?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 4-[(3-ethylsulfanylpropylamino)methyl]cyclohexan-1-ol?\nAnswer (numerical number):", + "answer": [ + "231.40" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-methyl-N-pent-3-ynylpiperidin-4-amine?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H16OS?\nAnswer:", + "answer": [ + "CCSC1C=CCCC1C(=O)C=C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1C(CC(=O)O1)I\nAnswer:", + "answer": [ + "(4S,5S)-4-iodo-5-methyloxolan-2-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CN(C)CCC1CNC(=O)CC1N\nAnswer:", + "answer": [ + "(4R,5R)-4-amino-5-[2-(dimethylamino)ethyl]piperidin-2-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-pyridin-4-yl-1,2,4-thiadiazole?\nAnswer (numerical number):", + "answer": [ + 16 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C4H14N4?\nAnswer (numerical number):", + "answer": [ + "118.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCCCCCCCCCOOOCC?\nAnswer (numerical number):", + "answer": [ + 44 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1=C(OCC(=C)N1)C\nAnswer:", + "answer": [ + "5,6-dimethyl-3-methylidene-4H-1,4-oxazine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H19NO2?\nAnswer (numerical number):", + "answer": [ + "173.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of COCC(CCl)NCC1=CC=CS1?\nAnswer:", + "answer": [ + "C9H14ClNOS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 5-[(1R)-1-[(3S)-pyrrolidin-3-yl]ethyl]-1,3-thiazole?\nAnswer (numerical number):", + "answer": [ + "182.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(C)C(=CNC(=O)C)C=C\nAnswer:", + "answer": [ + "N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]acetamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H21NO2?\nAnswer (numerical number):", + "answer": [ + "187.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(C)CCN=CC(C)C?\nAnswer:", + "answer": [ + "C9H19N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2,8-dimethyl-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepine?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N,N-dimethylmethanamine;undecane?\nAnswer (numerical number):", + "answer": [ + 48 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in COCCCCNCC1CCCC(C1)Cl?\nAnswer (numerical number):", + "answer": [ + 39 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H16O2?\nAnswer:", + "answer": [ + "CCCCC(C(C)O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1CC(CCN1)C2=CC=CS2?\nAnswer:", + "answer": [ + "C10H15NS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-(bromomethyl)-5-butoxy-3-methylpent-1-ene?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)C1(CCC(C1)Cl)C?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 8,8-bis(sulfanyl)nonanoic acid?\nAnswer (numerical number):", + "answer": [ + "222.4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC=CC=CC1=CC=CC=N1\nAnswer:", + "answer": [ + "2-[(1Z,3Z)-penta-1,3-dienyl]pyridine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2,3-dihydropyrrolo[2,1-b][1,3]oxazol-7-ylmethanamine?\nAnswer:", + "answer": [ + "C1COC2=C(C=CN21)CN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H11NO2?\nAnswer (numerical number):", + "answer": [ + "141.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCNS(=O)(=O)C?\nAnswer:", + "answer": [ + "C4H11NO2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H16N4O?\nAnswer (numerical number):", + "answer": [ + "196.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H12O3?\nAnswer (numerical number):", + "answer": [ + "168.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H18ClNO?\nAnswer:", + "answer": [ + "CC(=CCl)CNCCCCOC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N,N-dimethylmethanamine;N,N-dimethylpentan-1-amine?\nAnswer:", + "answer": [ + "C10H26N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (4R)-4-ethyl-2,2-dimethylcyclopentan-1-one?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCC(C#C)NC(C)(C)CN\nAnswer:", + "answer": [ + "2-N-hex-1-yn-3-yl-2-methylpropane-1,2-diamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H13N3?\nAnswer (numerical number):", + "answer": [ + "139.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H21N?\nAnswer:", + "answer": [ + "(2R,3R)-3-cyclopropyl-2-(2-methylpropyl)pyrrolidine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)C(CCN)C1CCOCC1?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1CCNC(C1)C2CCCSC2\nAnswer:", + "answer": [ + "(2S)-2-[(3S)-thian-3-yl]piperidine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCCCC=CC(CC=C)O?\nAnswer (numerical number):", + "answer": [ + "168.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCC(C#C)NC1CCC(CC1)O\nAnswer:", + "answer": [ + "4-(pent-1-yn-3-ylamino)cyclohexan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-iodo-4-methylcyclohex-2-en-1-one?\nAnswer (numerical number):", + "answer": [ + "236.05" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H11N3OS?\nAnswer:", + "answer": [ + "CC1=NSN=C1C2CNCCO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-(chloromethyl)-N-propylcyclopentan-1-amine?\nAnswer:", + "answer": [ + "CCCNC1CCCC1CCl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(=N)COOOC\nAnswer:", + "answer": [ + "1-methoxyperoxypropan-2-imine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1,2,4-oxadiazol-3-yl(thiolan-3-yl)methanamine?\nAnswer:", + "answer": [ + "C1CSCC1C(C2=NOC=N2)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-ethyl-3-ethylperoxydecane?\nAnswer (numerical number):", + "answer": [ + 46 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H23N3?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(COC)CON?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H20O3?\nAnswer (numerical number):", + "answer": [ + "176.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 7-methyl-5-methylidene-3,3a,4,6,7,7a-hexahydro-2H-1-benzofuran?\nAnswer:", + "answer": [ + "C10H16O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C12H23NO?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H18O3?\nAnswer:", + "answer": [ + "3-(hydroxymethyl)heptane-1,4-diol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in methyl 2-(methylamino)-4,5-dihydro-1,3-thiazole-5-carboxylate?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-[2-(methylamino)ethyl]-4,5-dihydro-1,3-oxazole-4-carboxylic acid?\nAnswer (numerical number):", + "answer": [ + "172.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-(2-aminoethoxy)-1-(oxan-3-yl)ethanone?\nAnswer:", + "answer": [ + "C9H17NO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)COCCNC1CCCC1CCl?\nAnswer (numerical number):", + "answer": [ + 39 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H22O4?\nAnswer:", + "answer": [ + "2,2-diethoxyethyl pentanoate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCOC(C)CNC1CCC(CC1)O?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of imidazo[1,2-d][1,2,4]oxadiazole-5-carbaldehyde?\nAnswer (numerical number):", + "answer": [ + "137.10" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCC(C)(C)CS(=O)O?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C1(CCCC1)CN)(F)F?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-methyl-1,4-dihydropyrimidin-4-amine?\nAnswer:", + "answer": [ + "C5H9N3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCC(CC)NC1CC(=O)NC1?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H18N2O2?\nAnswer:", + "answer": [ + "2-N-(1,3-dioxan-2-ylmethyl)propane-1,2-diamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C12H25NO?\nAnswer:", + "answer": [ + "CCCC(C)OCCC1CCCCN1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of pentan-2-yl 2-(methylamino)butanoate?\nAnswer:", + "answer": [ + "CCCC(C)OC(=O)C(CC)NC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H24O?\nAnswer (numerical number):", + "answer": [ + "172.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H18N2?\nAnswer:", + "answer": [ + "(1S,2S)-2-(propylamino)cyclohexane-1-carbonitrile" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC(C#C)NC1=NCCC1?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H17NO2?\nAnswer:", + "answer": [ + "5-(azetidin-3-yloxy)pentan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H15Cl?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C=C(C=O)N(CC=O)NN\nAnswer:", + "answer": [ + "2-[hydrazinyl(2-oxoethyl)amino]prop-2-enal" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H24N2O2?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(=O)COCC(=O)N(C)C?\nAnswer:", + "answer": [ + "C7H13NO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N,N-dimethylpenta-1,4-dien-3-amine?\nAnswer:", + "answer": [ + "C7H13N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H14N4?\nAnswer:", + "answer": [ + "3-(5-ethyl-1,2,4-triazin-3-yl)propan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C4H6BrNO3?\nAnswer (numerical number):", + "answer": [ + "196.00" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C6H7F3O3?\nAnswer:", + "answer": [ + "2,2,2-trifluoroethyl 2-ethenoxyacetate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 4-cyclopropyl-1H-pyridazin-6-one?\nAnswer:", + "answer": [ + "C7H8N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H14N2?\nAnswer (numerical number):", + "answer": [ + "150.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C(C)O)C(C(=O)OC)O?\nAnswer (numerical number):", + "answer": [ + "162.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H25N?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 4-N-pent-1-yn-3-ylcyclohexane-1,4-diamine?\nAnswer (numerical number):", + "answer": [ + "180.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (2S)-2-[[(2R)-1-methylpiperidin-2-yl]methylamino]propanenitrile?\nAnswer (numerical number):", + "answer": [ + "181.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (3R)-1,3-dichlorobutan-2-one?\nAnswer:", + "answer": [ + "C4H6Cl2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1C(=O)N(CO1)CC(=O)O?\nAnswer (numerical number):", + "answer": [ + 17 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2,2-dimethylpropoxymethylcyclohexane?\nAnswer:", + "answer": [ + "CC(C)(C)COCC1CCCCC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (3-bromopyrazin-2-yl) hypochlorite?\nAnswer (numerical number):", + "answer": [ + 11 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of chloro 2-(chloromethylidene)pentanoate?\nAnswer:", + "answer": [ + "C6H8Cl2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N,N,3-trimethylpent-4-en-1-amine?\nAnswer:", + "answer": [ + "C8H17N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(=NO)C(=O)C1CCCCC1?\nAnswer:", + "answer": [ + "C9H15NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-(aminomethyl)-N-(2-methoxypropyl)cyclohexan-1-amine?\nAnswer:", + "answer": [ + "C11H24N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C4H6Si2?\nAnswer (numerical number):", + "answer": [ + "110.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H21NO?\nAnswer (numerical number):", + "answer": [ + "183.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(C#C)NC(CN)C1CCSC1?\nAnswer:", + "answer": [ + "C10H18N2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC#CCCC(C1=CSC=N1)O?\nAnswer:", + "answer": [ + "C9H11NOS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H19NO4?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of methyl 5-ethyl-1,2,3,6-tetrahydropyridine-4-carboxylate?\nAnswer:", + "answer": [ + "C9H15NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 5-fluoro-1-methyl-3-methylidene-2H-pyridin-6-one?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCC(C)OCCNC1CC1\nAnswer:", + "answer": [ + "N-(2-pentan-2-yloxyethyl)cyclopropanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-ethyl-3-methylcyclohexane-1,2-dione?\nAnswer:", + "answer": [ + "C9H14O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H17NO4?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1CN(C(=C)C1C)C?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1=CC=C(NC=C1)OC=O?\nAnswer (numerical number):", + "answer": [ + "137.14" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(C)(CC)OC=S?\nAnswer:", + "answer": [ + "C7H14OS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in benzene;2,3-dihydrothiophene?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC(CC(=O)CCCl)Cl?\nAnswer (numerical number):", + "answer": [ + "183.07" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1=CCC1.S?\nAnswer (numerical number):", + "answer": [ + "102.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCN(CC)CC1CCCN1CCN\nAnswer:", + "answer": [ + "2-[2-(diethylaminomethyl)pyrrolidin-1-yl]ethanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H13NO3?\nAnswer (numerical number):", + "answer": [ + "171.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H14N2O2?\nAnswer (numerical number):", + "answer": [ + "158.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-methyl-2,6-diazaspiro[4.5]decan-1-one?\nAnswer (numerical number):", + "answer": [ + "168.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-[(dimethylamino)methyl]-4-methyl-1,2-oxazol-5-amine?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-ethyl-3-imino-N-(methylideneamino)propan-1-amine?\nAnswer:", + "answer": [ + "CCN(CCC=N)N=C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of COCC1CCCC(C1)CCO?\nAnswer (numerical number):", + "answer": [ + "172.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H19N3O?\nAnswer:", + "answer": [ + "2-butylpiperazine-2-carboxamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C12H27N3?\nAnswer:", + "answer": [ + "2-[1-(2-aminoethyl)pyrrolidin-2-yl]-N,N-diethylethanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 4-methyl-1,5-dihydroimidazole-2-thione?\nAnswer:", + "answer": [ + "C4H6N2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (E)-1-iodo-4,4-dimethoxy-2-methylbut-1-ene?\nAnswer:", + "answer": [ + "C7H13IO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC1CN2CCC1CC2CN?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H8N2O?\nAnswer:", + "answer": [ + "C1CC(C(=NO)C1)C#N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H14N4?\nAnswer (numerical number):", + "answer": [ + "154.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-[(1E,4E)-1-amino-5-aminooxyhexa-1,4-dien-3-ylidene]methanimidamide?\nAnswer:", + "answer": [ + "CC(=CC(=NC=N)C=CN)ON" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H19NO2?\nAnswer:", + "answer": [ + "C1CNCC(OC1)C2CCOCC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1(CCNCCC1F)C(=O)O?\nAnswer (numerical number):", + "answer": [ + "175.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C(CCOP(=O)(O)O)CCS?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H23NOS?\nAnswer (numerical number):", + "answer": [ + "217.37" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-(2,2-dimethylhydrazinyl)-2-methylpropanenitrile?\nAnswer:", + "answer": [ + "C6H13N3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-methyl-4-[(3R)-piperidin-3-yl]-1,2,5-thiadiazole?\nAnswer:", + "answer": [ + "CC1=NSN=C1C2CCCNC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-amino-2-(1-fluoroethyl)pentanoic acid?\nAnswer (numerical number):", + "answer": [ + "163.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H16O3?\nAnswer:", + "answer": [ + "CCC(=O)C.CC(=O)C.C=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-(1,4-dithian-2-yl)hex-4-yn-1-ol?\nAnswer:", + "answer": [ + "C10H16OS2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC#CCCNC(C)C1CCCCC1?\nAnswer (numerical number):", + "answer": [ + "193.33" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H14?\nAnswer (numerical number):", + "answer": [ + 22 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H18O?\nAnswer:", + "answer": [ + "CCC=CC1C2(O1)CCCCC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(C)CC(=O)N1CCCCC1O?\nAnswer:", + "answer": [ + "C10H19NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-ethyl-2-[(3-methylimidazol-4-yl)methoxy]ethanamine?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-fluoro-2-methylbutanal?\nAnswer:", + "answer": [ + "CCC(C)(C=O)F" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2R)-N-(2-methylpropyl)morpholine-2-carboxamide?\nAnswer:", + "answer": [ + "CC(C)CNC(=O)C1CNCCO1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H8INO?\nAnswer:", + "answer": [ + "N-cyclopenta-2,4-dien-1-yl-2-iodoacetamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCCCC1=NC(=NC=C1)SC?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(C)CCCC(C)C(C)C=O\nAnswer:", + "answer": [ + "(2S,3S)-2,3,7-trimethyloctanal" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-methyl-N-(pyrrolidin-2-ylmethyl)-1-(thiolan-3-yl)methanamine?\nAnswer (numerical number):", + "answer": [ + "214.37" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-ethoxy-4-propan-2-yloxybutane-1,3-diol?\nAnswer (numerical number):", + "answer": [ + "192.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCCCC#CCC#CC=CCBr?\nAnswer:", + "answer": [ + "C13H17Br" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(CC1CCCSC1)C(=O)O?\nAnswer (numerical number):", + "answer": [ + "188.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-aminobutanamide?\nAnswer (numerical number):", + "answer": [ + 17 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of COC1=C2C=CC=C2C=CO1\nAnswer:", + "answer": [ + "1-methoxycyclopenta[c]pyran" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C5H11FN2O?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H8ClNS?\nAnswer (numerical number):", + "answer": [ + "161.65" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C(CO)C(CO)C(CCO)CO\nAnswer:", + "answer": [ + "(4R)-3,4-bis(hydroxymethyl)hexane-1,6-diol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (3S,4S)-4-butyl-3-ethyloxetan-2-one?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C4H7NO3S?\nAnswer (numerical number):", + "answer": [ + 16 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CNC1CCCCC1OCCO?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-(hydroxyamino)-4,5-dihydro-1H-pyrimidin-6-one?\nAnswer (numerical number):", + "answer": [ + 16 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H17NO2?\nAnswer:", + "answer": [ + "N-[2-(methoxymethoxy)ethyl]propan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (E,3R)-3,7-dimethylnon-6-en-1-yn-3-ol?\nAnswer:", + "answer": [ + "C11H18O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H14OS?\nAnswer:", + "answer": [ + "CCC(C(C)C)OC=S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC=CC(CC(=O)O)(S)S?\nAnswer:", + "answer": [ + "C6H10O2S2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C12H24?\nAnswer:", + "answer": [ + "CC1CCC(CCC1(C)C)(C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC.C1CCC2(C1)CCCNC2?\nAnswer (numerical number):", + "answer": [ + "183.33" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H21NO3?\nAnswer:", + "answer": [ + "butyl 2-[2-(ethylamino)ethoxy]acetate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-methyl-1-(3-methylfuran-2-yl)prop-2-yn-1-amine?\nAnswer (numerical number):", + "answer": [ + "149.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H16N2?\nAnswer:", + "answer": [ + "CNC1CCCCCC1C#N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCOC(=O)C(=NC)N?\nAnswer (numerical number):", + "answer": [ + "130.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-(2-methylbut-1-enoxy)nonane?\nAnswer (numerical number):", + "answer": [ + 43 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 4-hex-1-yn-3-yl-1H-1,2,4-triazol-5-one?\nAnswer:", + "answer": [ + "C8H11N3O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H18N2O?\nAnswer:", + "answer": [ + "CCCC(CCC#CN)C(N)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-(cyclopropylamino)-N-(2-methoxypropyl)acetamide?\nAnswer:", + "answer": [ + "C9H18N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H16O2?\nAnswer (numerical number):", + "answer": [ + "168.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H14N2O?\nAnswer:", + "answer": [ + "(5aR,8aR)-2,3,4,5,5a,6,8,8a-octahydro-1H-furo[3,4-b][1,4]diazepine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (4R)-4-amino-4-methyl-1,2-oxazolidin-3-one?\nAnswer (numerical number):", + "answer": [ + "116.12" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2,10-diazaspiro[4.6]undecan-1-one?\nAnswer:", + "answer": [ + "C9H16N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (2R,6S)-4-chloro-2,6-dipropyloxane?\nAnswer:", + "answer": [ + "C11H21ClO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCN(CC)CCC(CCC#CC)NC\nAnswer:", + "answer": [ + "1-N,1-N-diethyl-3-N-methyloct-6-yne-1,3-diamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1CCCCC1(C)N\nAnswer:", + "answer": [ + "(1S,2R)-1,2-dimethylcyclohexan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-(1-fluoroethyl)thietane-3-carboxylic acid?\nAnswer:", + "answer": [ + "CC(C1(CSC1)C(=O)O)F" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(=O)N(C)P(C)OC?\nAnswer (numerical number):", + "answer": [ + "149.13" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1=NN(C=C1Cl)CC(C)N?\nAnswer (numerical number):", + "answer": [ + "173.64" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in [2-(pent-4-ynylamino)cyclopentyl]methanol?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (3R,5R)-3-methyl-5-thiophen-2-ylpiperidine?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C5H10N2O2S?\nAnswer (numerical number):", + "answer": [ + "162.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-(ethylaminomethyl)benzaldehyde?\nAnswer:", + "answer": [ + "C10H13NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-N,2-N,1-trimethylpyrrolidine-2,3-diamine?\nAnswer:", + "answer": [ + "C7H17N3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-sulfanylidene-2H-1,2,4-triazin-5-one?\nAnswer (numerical number):", + "answer": [ + 11 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C12H24ClNO?\nAnswer:", + "answer": [ + "2-(chloromethyl)-N-(2-propoxyethyl)cyclohexan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H18N2O2?\nAnswer (numerical number):", + "answer": [ + "186.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC1CC(OC1OC)OC?\nAnswer (numerical number):", + "answer": [ + "160.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1=CC(=CC=C1)CC(C)I?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (E)-N-ethyl-2-phenylethenamine?\nAnswer:", + "answer": [ + "C10H13N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-[2-(2-formamidoethylamino)ethyl]acetamide?\nAnswer:", + "answer": [ + "CC(=O)NCCNCCNC=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-methyl-N-[(2S)-pentan-2-yl]azetidin-3-amine?\nAnswer (numerical number):", + "answer": [ + "156.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1=CNC(=O)C(=C1N)O?\nAnswer:", + "answer": [ + "C5H6N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC1(CN=C(SC1)NCC)CC?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1COC(C(C1F)O)CO?\nAnswer:", + "answer": [ + "C7H13FO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H19ClO?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H15NO?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H23NO2?\nAnswer:", + "answer": [ + "C1CC(C1)N(CCCCO)CCCO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-[(2Z,4E)-hexa-2,4-dien-2-yl]ethanimine?\nAnswer:", + "answer": [ + "C8H13N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C=CC=CC#CC#CC#C)O?\nAnswer (numerical number):", + "answer": [ + "170.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(C)C(CCN)C1=NC=NS1?\nAnswer:", + "answer": [ + "C8H15N3S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 4-ethylfuran-3-one?\nAnswer (numerical number):", + "answer": [ + "112.13" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H15NO2?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-(4-methoxypyrrolidin-3-yl)propanoic acid?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H21NO?\nAnswer:", + "answer": [ + "3-methyl-3-(pent-1-yn-3-ylamino)pentan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H21NO?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-[2-[(dimethylamino)methyl]piperidin-1-yl]-N-methylethanamine?\nAnswer:", + "answer": [ + "C11H25N3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H15NO2?\nAnswer:", + "answer": [ + "CCCCC(=O)NOCC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N'-[1-[methyl(methylamino)amino]propyl]methanimidamide?\nAnswer (numerical number):", + "answer": [ + "144.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H15F2NO?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCN1C(=C2CNCC2=N1)CO?\nAnswer:", + "answer": [ + "C8H13N3O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H14O4?\nAnswer:", + "answer": [ + "(3-methoxy-3-oxopropyl) butanoate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C12H22O2?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H18ClNO2?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H12N4O2?\nAnswer:", + "answer": [ + "CNC1=C(NOCN(C1=O)C)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCNCC(C)(CC(C)C)C=C?\nAnswer (numerical number):", + "answer": [ + "169.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H9ClN2?\nAnswer:", + "answer": [ + "(1S)-1-(2-chloropyridin-3-yl)ethanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-methyl-1-(oxan-3-yl)azetidin-3-ol?\nAnswer:", + "answer": [ + "CC1(CN(C1)C2CCCOC2)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C6H11NO2?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCOC(CO)C(CC=O)O?\nAnswer:", + "answer": [ + "C8H16O4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H14N2O?\nAnswer:", + "answer": [ + "CC(=CCN1CCNC1=O)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (5R)-5-hydroxy-6-methylhept-1-en-3-one?\nAnswer:", + "answer": [ + "CC(C)C(CC(=O)C=C)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CN=C(NC=O)SC?\nAnswer:", + "answer": [ + "C4H8N2OS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H15N3O?\nAnswer:", + "answer": [ + "C(CC(CC(=O)N)N)CN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCN(C)C(N(C)C)O\nAnswer:", + "answer": [ + "dimethylamino-[methyl(propyl)amino]methanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCCCCCCCC(CC)OOOOCC?\nAnswer:", + "answer": [ + "C14H30O4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 4-[(3-methylimidazol-4-yl)methoxy]piperidine?\nAnswer:", + "answer": [ + "CN1C=NC=C1COC2CCNCC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C5H11NO4?\nAnswer:", + "answer": [ + "(2S,3R,4S,5S)-4-aminooxane-2,3,5-triol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-ethyl-2-methylsulfanylcyclohexane?\nAnswer:", + "answer": [ + "C9H18S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C5H11NO2?\nAnswer:", + "answer": [ + "O-(cyclopropylmethoxymethyl)hydroxylamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-chloro-N-(5-oxopyrrolidin-3-yl)acetamide?\nAnswer:", + "answer": [ + "C1C(CNC1=O)NC(=O)CCl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (1R)-1-hydroperoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H11NO?\nAnswer (numerical number):", + "answer": [ + "137.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H12O?\nAnswer:", + "answer": [ + "CC1CCC2=C1C=CC=C2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (E)-1-chloro-1,1-difluoronon-2-en-4-yne?\nAnswer:", + "answer": [ + "CCCCC#CC=CC(F)(F)Cl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H12O?\nAnswer (numerical number):", + "answer": [ + "148.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H10N2O?\nAnswer (numerical number):", + "answer": [ + "150.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1CC(CS1)NCC(C)OC?\nAnswer:", + "answer": [ + "C9H19NOS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCCCCCC(C)NCC=C(C)C?\nAnswer:", + "answer": [ + "C14H29N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-methyl-4-propan-2-ylcyclohexan-1-one?\nAnswer:", + "answer": [ + "CC1CC(=O)CCC1C(C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-cyclopentyl-5-fluoropentan-1-ol?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 5-N-pent-4-ynyl-1,2,4-thiadiazole-3,5-diamine?\nAnswer:", + "answer": [ + "C#CCCCNC1=NC(=NS1)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-[2-(1,2-thiazol-5-yl)ethyl]cyclopropan-1-amine?\nAnswer (numerical number):", + "answer": [ + "168.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC#CCCOCC1CCCNC1?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of [1-(hydrazinylmethyl)cycloheptyl]methanol?\nAnswer (numerical number):", + "answer": [ + "172.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-[azocan-4-yl(methyl)amino]propane-1-thiol?\nAnswer:", + "answer": [ + "CN(CCCS)C1CCCCNCC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H3ClN2?\nAnswer (numerical number):", + "answer": [ + "138.55" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1C(C1C(C)C2CC2)C\nAnswer:", + "answer": [ + "1-(1-cyclopropylethyl)-2,3-dimethylcyclopropane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H19NOS?\nAnswer:", + "answer": [ + "CCC(CO)NCC1CCSC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-[4-(1-aminopropyl)triazol-1-yl]ethanol?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-ethyl-3-methoxypiperidine-3-carbaldehyde?\nAnswer:", + "answer": [ + "C9H17NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H13ClO2?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3H-dioxepine-4-carboxylic acid?\nAnswer:", + "answer": [ + "C1C(=CC=COO1)C(=O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H21NO?\nAnswer (numerical number):", + "answer": [ + "171.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-(2-aminocyclopentyl)oxypropan-2-ol?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2,4-diethyl-3-fluoro-1H-pyrazol-5-one?\nAnswer:", + "answer": [ + "CCC1=C(N(NC1=O)CC)F" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-(4-fluorooxan-4-yl)-2-methylpropan-1-amine?\nAnswer:", + "answer": [ + "C9H18FNO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(CNCC=C)C(=O)N?\nAnswer:", + "answer": [ + "C8H16N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1(CNCC1C(=O)O)C?\nAnswer:", + "answer": [ + "C7H13NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H14N2S?\nAnswer:", + "answer": [ + "3-methyl-4-[(3R)-piperidin-3-yl]-1,2-thiazole" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (1S,2S)-N-methyl-2-(4-methylpiperidin-1-yl)cyclopentan-1-amine?\nAnswer (numerical number):", + "answer": [ + "196.33" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-(1,3-thiazol-5-yl)ethanol?\nAnswer:", + "answer": [ + "CC(C1=CN=CS1)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C=CC1CCC(C(C1)O)N?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCOC(C(CCC#CC)NC)OCC?\nAnswer (numerical number):", + "answer": [ + "213.32" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CC(C(C1)NCCCF)CO?\nAnswer:", + "answer": [ + "C9H18FNO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H19NO?\nAnswer:", + "answer": [ + "CC(C)CC(C(C1CC1)O)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CN(C)C(C=O)N1C=CN=C1?\nAnswer (numerical number):", + "answer": [ + "153.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCC(C#C)NCCOCCC(C)C?\nAnswer (numerical number):", + "answer": [ + "211.34" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H20O?\nAnswer (numerical number):", + "answer": [ + "168.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C3H3ClN2S?\nAnswer:", + "answer": [ + "CC1=C(SN=N1)Cl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-[(3-chloro-2-methylprop-2-enyl)-ethylamino]ethanol?\nAnswer (numerical number):", + "answer": [ + "177.67" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1C(CNC1=O)NC2COC2?\nAnswer:", + "answer": [ + "C7H12N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H12?\nAnswer:", + "answer": [ + "(2E,4E)-3-methylocta-2,4-dien-6-yne" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-[2-[(3-chloro-2-methylprop-2-enyl)amino]ethoxy]ethanol?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C2H6AsClO2?\nAnswer:", + "answer": [ + "C=C[AsH](O)(O)Cl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-[3-(2-methoxyethoxy)propylamino]-3-methylpentan-1-ol?\nAnswer:", + "answer": [ + "CCC(C)(CCO)NCCCOCCOC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H10O2?\nAnswer (numerical number):", + "answer": [ + "114.14" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(C)(CCO)N1CCCC1C?\nAnswer:", + "answer": [ + "C11H23NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C6H8O3S?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-ethyl-3-hydroxy-2-propylhexanenitrile?\nAnswer:", + "answer": [ + "CCCC(C#N)C(CC)(CCC)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-(2-butoxyethyl)hex-1-yn-3-amine?\nAnswer:", + "answer": [ + "C12H23NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H13N3S?\nAnswer:", + "answer": [ + "CC1=C(SN=C1N)NC2CCC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H10N2O?\nAnswer (numerical number):", + "answer": [ + "138.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2S,4S)-4-cyclohexyl-2-methylpiperidine?\nAnswer:", + "answer": [ + "CC1CC(CCN1)C2CCCCC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H12O2?\nAnswer:", + "answer": [ + "CC1(CC1C(=O)O)C2CC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CN1CCCC1CC2CCCNC2?\nAnswer (numerical number):", + "answer": [ + 35 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1C(CCO1)S(=O)CCCOC\nAnswer:", + "answer": [ + "(2R,3S)-3-[(S)-3-methoxypropylsulfinyl]-2-methyloxolane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CCSC(C1)CNCC2CCSC2?\nAnswer (numerical number):", + "answer": [ + "231.4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-methyl-1,2-dihydro-1,3,2-diazaborole?\nAnswer:", + "answer": [ + "C3H7BN2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-[[(2R)-morpholin-2-yl]methyl]cyclopropanamine?\nAnswer:", + "answer": [ + "C8H16N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CNCCOC1CCCCNC1=O?\nAnswer:", + "answer": [ + "C9H18N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-ethyl-1-(3-methylfuran-2-yl)propan-1-amine?\nAnswer:", + "answer": [ + "CCC(C1=C(C=CO1)C)NCC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(CC1=CN(N=N1)C)N?\nAnswer (numerical number):", + "answer": [ + "140.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC#CCCNC1CCCC(C1C)C?\nAnswer (numerical number):", + "answer": [ + "193.33" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1(CCN2C1O2)C\nAnswer:", + "answer": [ + "4,4-dimethyl-6-oxa-1-azabicyclo[3.1.0]hexane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCC(C)CC(=NCCO)CC\nAnswer:", + "answer": [ + "2-[[(5S)-5-methylheptan-3-ylidene]amino]ethanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H16N2O?\nAnswer (numerical number):", + "answer": [ + "168.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-(3-methyloxiran-2-yl)acetamide?\nAnswer:", + "answer": [ + "CC1C(O1)NC(=O)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1CC2CCCN(C1)C2?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H16O?\nAnswer:", + "answer": [ + "CCCCC1COC1C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (5S)-5-methyloct-6-en-3-ol?\nAnswer:", + "answer": [ + "CCC(CC(C)C=CC)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1C(CN1)OCCN2C=CN=C2?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C12H23NO?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H13NO2?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C)NCCOCOCC1CC1?\nAnswer (numerical number):", + "answer": [ + "187.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C6H13NS2?\nAnswer (numerical number):", + "answer": [ + 22 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H14O2?\nAnswer:", + "answer": [ + "CCC=CC(C=CC)OO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-(2,2-difluoro-3-hydroxypropyl)-2-(methylamino)acetamide?\nAnswer:", + "answer": [ + "C6H12F2N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1C2=C(C=NC=C2)N=C1N?\nAnswer (numerical number):", + "answer": [ + 17 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (3-chloro-2-hydroxypropyl) hexanoate?\nAnswer:", + "answer": [ + "CCCCCC(=O)OCC(CCl)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCC1CC2CCC2N1CC\nAnswer:", + "answer": [ + "2,3-diethyl-2-azabicyclo[3.2.0]heptane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC#CCCN1CCCC1CNC?\nAnswer:", + "answer": [ + "C11H20N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-[(1-methylimidazol-2-yl)methoxy]piperidine?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1(C(CC1OC)N)C?\nAnswer:", + "answer": [ + "C7H15NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCSC=NNC?\nAnswer:", + "answer": [ + "C4H10N2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H14O5?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of methyl 3-fluoro-4-hydroxycyclopentane-1-carboxylate?\nAnswer:", + "answer": [ + "C7H11FO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H18O3?\nAnswer:", + "answer": [ + "(3S)-3-[(3S)-oxan-3-yl]pentanoic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (3S,6S,11S)-11-methyl-1,4-dioxaspiro[5.5]undecan-3-ol?\nAnswer:", + "answer": [ + "C10H18O3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1,2,4,5-tetrahydropyrrolo[2,3-c]pyrazole-3-carbaldehyde?\nAnswer:", + "answer": [ + "C1CN=C2C1=C(NN2)C=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1CC(C(C(=C1)O)O)O?\nAnswer (numerical number):", + "answer": [ + 22 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)(C(CCN)C1CCC1)F?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCC(C)OCC(=C)C(=O)O\nAnswer:", + "answer": [ + "2-(pentan-2-yloxymethyl)prop-2-enoic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C5H10BrNOS?\nAnswer (numerical number):", + "answer": [ + "212.11" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1CC2CCC=NC2=NC1?\nAnswer (numerical number):", + "answer": [ + 22 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H13N3O?\nAnswer:", + "answer": [ + "(1R)-N,N-dimethyl-1-(1,2-oxazol-4-yl)ethane-1,2-diamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H7IS?\nAnswer (numerical number):", + "answer": [ + "262.11" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1CN(CC(O1)C)CS?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H18FNO?\nAnswer:", + "answer": [ + "2-fluoro-2-(1-propan-2-ylpyrrolidin-3-yl)ethanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCC1=C(CC(=O)C=N1)C\nAnswer:", + "answer": [ + "6-ethyl-5-methyl-4H-pyridin-3-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-(2,4-dimethylpentan-3-yl)-1,3-dioxetan-2-amine?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of methyl 4-(thiolan-3-ylmethylamino)butanoate?\nAnswer:", + "answer": [ + "C10H19NO2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of COCC1=NOC(=C1)N.Cl?\nAnswer (numerical number):", + "answer": [ + "164.59" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-(2-methoxyethyl)-N,2-dimethylbut-3-en-1-amine?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H14INO2?\nAnswer:", + "answer": [ + "CC(C)(C(=O)NCCCO)I" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in [(2R)-1,4-difluorobutan-2-yl] hydrogen carbonate?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-(5-bromopyridin-3-yl)-N-methylethanamine?\nAnswer:", + "answer": [ + "CNCCC1=CC(=CN=C1)Br" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1C2CC3C2CC1C(C3)O\nAnswer:", + "answer": [ + "(1S,5S,6R)-tricyclo[4.2.1.03,8]nonan-5-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CC=CC=CC=CCCC=C1?\nAnswer (numerical number):", + "answer": [ + "160.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 4-methyl-5-[[(2R)-pyrrolidin-2-yl]methyl]-1,3-thiazole?\nAnswer (numerical number):", + "answer": [ + "182.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCCCCCC(CC=C)C=CC\nAnswer:", + "answer": [ + "4-prop-1-enylundec-1-ene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 6-oxa-2,4,7,8-tetrazabicyclo[3.2.1]octa-1(8),2,4-triene?\nAnswer:", + "answer": [ + "C1=NC2=NC(=N1)ON2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1COC(CN1C=O)C(=O)O?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-(4-methylcyclohexyl)propane-1,3-diol?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H18ClN?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCN(CC)CC(CC(=O)O)N?\nAnswer:", + "answer": [ + "C8H18N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H14FNS?\nAnswer (numerical number):", + "answer": [ + "175.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1=CC(=S)NN=C1?\nAnswer (numerical number):", + "answer": [ + "126.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H15N?\nAnswer:", + "answer": [ + "N-benzyl-N-methylprop-2-en-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-(oxan-2-yl)morpholine?\nAnswer:", + "answer": [ + "C9H17NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(=O)C(CCC(=O)ON)N?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C[Se]CCCC(=O)O\nAnswer:", + "answer": [ + "4-methylselanylbutanoic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of ethane;isothiocyanatoethane?\nAnswer:", + "answer": [ + "CC.CCN=C=S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1=NOC=C1C2CNCCCO2?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H15NO2?\nAnswer:", + "answer": [ + "5-(1,3-dioxolan-2-yl)-1-methyl-3,6-dihydro-2H-pyridine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H13NO2S?\nAnswer:", + "answer": [ + "CSCC(=O)N1CCCC1C=O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (4S)-4-bromohexanamide?\nAnswer (numerical number):", + "answer": [ + "194.07" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H23NO2?\nAnswer:", + "answer": [ + "CC(C)NCCCCCCCC(=O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-fluoro-2-methyl-3-piperidin-4-ylpropan-1-amine?\nAnswer (numerical number):", + "answer": [ + "174.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H14O4?\nAnswer:", + "answer": [ + "ethyl 4-(ethoxymethoxy)but-2-ynoate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (E)-5-amino-2-propan-2-ylidenepent-4-enoic acid?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-bis(methylideneamino)phosphinimylmethanimine?\nAnswer:", + "answer": [ + "C3H7N4P" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H19NO3?\nAnswer (numerical number):", + "answer": [ + "177.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H24N2O2?\nAnswer (numerical number):", + "answer": [ + 38 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of S-ethyl N-(2-methylprop-2-enoyl)carbamothioate?\nAnswer:", + "answer": [ + "C7H11NO2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(=CC1CCSC1)CNC2CC2?\nAnswer:", + "answer": [ + "C11H19NS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H9F3O?\nAnswer:", + "answer": [ + "CC=CCC(C(F)(F)F)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-[(2R)-butan-2-yl]-N'-tert-butylethane-1,2-diamine?\nAnswer:", + "answer": [ + "CCC(C)NCCNC(C)(C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-(2-aminophenyl)sulfanylprop-1-ene-2-thiol?\nAnswer:", + "answer": [ + "C9H11NS2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H7N?\nAnswer (numerical number):", + "answer": [ + "117.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C5H9BrZn?\nAnswer (numerical number):", + "answer": [ + "214.4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (2R)-2-amino-2-cyanoacetamide?\nAnswer (numerical number):", + "answer": [ + "99.09" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C12H21N?\nAnswer (numerical number):", + "answer": [ + "179.30" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-ethenoxy-N-(thiolan-3-ylmethyl)propan-1-amine?\nAnswer:", + "answer": [ + "C=COCCCNCC1CCSC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1CCC(CC1)C(CNN)CO?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-methyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-amine?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (2S)-2-[[(3S)-thiolan-3-yl]amino]propanoic acid?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H15Br?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 5-ethyl-2-propan-2-yl-2,5-dihydro-1,3-thiazole?\nAnswer:", + "answer": [ + "CCC1C=NC(S1)C(C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H17NS?\nAnswer:", + "answer": [ + "5-butyl-2-propan-2-yl-1,3-thiazole" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCCOC(C=CC)OCCCC\nAnswer:", + "answer": [ + "1,1-dibutoxybut-2-ene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H18N2O2?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H17NO2S?\nAnswer:", + "answer": [ + "(1R,2S)-N-ethyl-2-methylsulfonylcyclopentan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of [(1E)-2,3-dimethylbuta-1,3-dienyl]cyclohexane?\nAnswer (numerical number):", + "answer": [ + "164.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H23NO3?\nAnswer (numerical number):", + "answer": [ + "217.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H15NO2?\nAnswer (numerical number):", + "answer": [ + "157.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H19N3S?\nAnswer (numerical number):", + "answer": [ + "213.35" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CN(CC1CCCCO1)C2CNC2?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H19Cl?\nAnswer:", + "answer": [ + "CCCCC(C1CCCC1)Cl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H13O3P?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-ethyl-2-methylhex-1-en-3-ol?\nAnswer (numerical number):", + "answer": [ + "142.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCC(CC)C(CC)NCCC\nAnswer:", + "answer": [ + "4-ethyl-N-propylheptan-3-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CNCCOC1C2=NC=NS2?\nAnswer (numerical number):", + "answer": [ + "185.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (Z)-2-ethylhept-2-en-1-ol?\nAnswer:", + "answer": [ + "C9H18O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C5H8N4?\nAnswer (numerical number):", + "answer": [ + 17 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-methyl-3-(thiolan-3-ylmethylamino)butan-1-ol?\nAnswer (numerical number):", + "answer": [ + "203.35" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H21N?\nAnswer:", + "answer": [ + "3-ethyl-5-methylhexan-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-(3-ethoxyoxan-3-yl)-N-methylmethanamine?\nAnswer:", + "answer": [ + "CCOC1(CCCOC1)CNC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-[(1-hydroxy-3-methylpentan-3-yl)amino]propane-1,2-diol?\nAnswer (numerical number):", + "answer": [ + "191.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCOC(=O)C(C)NCCC(C)C?\nAnswer:", + "answer": [ + "C10H21NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-methyl-1-propan-2-ylsulfonylpropane?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H17Cl2N?\nAnswer (numerical number):", + "answer": [ + "210.14" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (5S)-5-(5-methyl-2H-triazol-4-yl)-1,4-oxazepane?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (3R,4S)-3,4-dimethylheptan-1-ol?\nAnswer:", + "answer": [ + "CCCC(C)C(C)CCO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H20ClNO?\nAnswer (numerical number):", + "answer": [ + "193.71" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2R)-2-[(3-chloro-2-methylprop-2-enyl)amino]propanoic acid?\nAnswer:", + "answer": [ + "CC(C(=O)O)NCC(=CCl)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-methyl-3-(oxan-3-yl)cyclopentan-1-amine?\nAnswer (numerical number):", + "answer": [ + "183.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CCCC(CC1)OCC(CN)O?\nAnswer:", + "answer": [ + "C10H21NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CON1CCCN1\nAnswer:", + "answer": [ + "1-methoxypyrazolidine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-methylpiperazin-2-one?\nAnswer:", + "answer": [ + "C5H10N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1COCC1(CC(F)F)CN?\nAnswer (numerical number):", + "answer": [ + "165.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C5H6N2O2S2?\nAnswer:", + "answer": [ + "2-(4-methylthiadiazol-5-yl)sulfanylacetic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-(prop-2-ynylamino)butanoic acid?\nAnswer:", + "answer": [ + "C7H11NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCOC(C)C(=O)C1CCCOC1?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-[(3-chloro-2-methylprop-2-enoxy)methyl]piperidine?\nAnswer:", + "answer": [ + "CC(=CCl)COCC1CCCCN1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H17NO2?\nAnswer:", + "answer": [ + "3-ethyl-1-hydroxyazocan-2-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2Z)-2-(4-oxobutylidene)octanenitrile?\nAnswer:", + "answer": [ + "CCCCCCC(=CCCC=O)C#N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-chloro-N-(3-iodopropyl)-2-methylprop-2-en-1-amine?\nAnswer (numerical number):", + "answer": [ + "273.54" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-pentan-2-yloxypropanal?\nAnswer (numerical number):", + "answer": [ + "144.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CNC1=C(C=CC(=C1)CN)N?\nAnswer (numerical number):", + "answer": [ + "151.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C5H3IO2?\nAnswer (numerical number):", + "answer": [ + 11 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(CC(=O)O)C1CCCOCC1?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H14N4?\nAnswer (numerical number):", + "answer": [ + "166.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H12O?\nAnswer:", + "answer": [ + "tricyclo[3.2.1.02,4]octan-6-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-iodo-5-phosphanylphenol?\nAnswer (numerical number):", + "answer": [ + "251.99" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N'-(3-chloro-2-methylprop-2-enyl)propane-1,3-diamine?\nAnswer (numerical number):", + "answer": [ + "162.66" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (6-amino-6-oxohexyl) prop-2-enoate?\nAnswer:", + "answer": [ + "C9H15NO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1=COOC2=NC2=C1\nAnswer:", + "answer": [ + "2,3-dioxa-8-azabicyclo[5.1.0]octa-1(8),4,6-triene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in [3-[2-aminoethyl(methyl)amino]-1,2,4-oxadiazol-5-yl]methanol?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1(CCNC1C2=CC=CS2)C?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2,5-dihydro-1,2-oxazole-5-carboxylic acid?\nAnswer:", + "answer": [ + "C1=CNOC1C(=O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC=CC(=N)C?\nAnswer (numerical number):", + "answer": [ + 15 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (4R)-4-ethyl-4,5-dihydro-1,3-oxazole?\nAnswer:", + "answer": [ + "C5H9NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H22N4?\nAnswer (numerical number):", + "answer": [ + 36 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CNCC(OC1)C2CCOCC2?\nAnswer (numerical number):", + "answer": [ + "185.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H19BrN2O?\nAnswer:", + "answer": [ + "2-bromo-N-[2-[ethyl(propyl)amino]ethyl]acetamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCOCCOCCOCCOC(F)(F)F\nAnswer:", + "answer": [ + "1-ethoxy-2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H22ClNO?\nAnswer:", + "answer": [ + "1-chloro-N-(cyclohexylmethyl)-3-methoxypropan-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H23NO3?\nAnswer:", + "answer": [ + "CCOCC(COC1CCCCC1N)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C12H19N?\nAnswer:", + "answer": [ + "C#CCCCNCCC1=CCCC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C12H25NO3?\nAnswer:", + "answer": [ + "CNC(CCOCCOC)C1CCCOC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (E)-3,4-diaminohex-3-ene-2,5-diol?\nAnswer:", + "answer": [ + "C6H14N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCSCC(CCC#CC)O?\nAnswer:", + "answer": [ + "C10H18OS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1COCCC1C(C(=O)Cl)F?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H13NO3?\nAnswer (numerical number):", + "answer": [ + "171.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C6H7N3S?\nAnswer:", + "answer": [ + "(2-methylsulfanylpyridin-3-yl)diazene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-ethoxyperoxyoctane?\nAnswer:", + "answer": [ + "C10H22O3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H20BrNO?\nAnswer (numerical number):", + "answer": [ + "250.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1=CC=C(C=C1)C=CCCF?\nAnswer:", + "answer": [ + "C10H11F" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C5H10O4?\nAnswer:", + "answer": [ + "C1C(CC(OC1O)O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CN1CCC(C1)CC(CN)(F)F\nAnswer:", + "answer": [ + "2,2-difluoro-3-(1-methylpyrrolidin-3-yl)propan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C2H5ClO2?\nAnswer (numerical number):", + "answer": [ + "96.51" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C3H3NO3?\nAnswer:", + "answer": [ + "C(=O)C(=N)C(=O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-aminooxy-1-cycloheptylethanone?\nAnswer (numerical number):", + "answer": [ + "171.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-methyl-1-pyridin-2-ylpropan-2-ol?\nAnswer (numerical number):", + "answer": [ + "151.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of COC1=C(C=CC=C1Br)CF?\nAnswer:", + "answer": [ + "C8H8BrFO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CN1CC(CC1C2CCCC2)CN\nAnswer:", + "answer": [ + "[(3S,5R)-5-cyclopentyl-1-methylpyrrolidin-3-yl]methanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-methylsulfonyl-N-prop-2-enylpropan-1-amine?\nAnswer (numerical number):", + "answer": [ + "177.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H23NS?\nAnswer:", + "answer": [ + "3-methyl-N-(thiolan-3-ylmethyl)pentan-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(=O)OCC=CCOCC=O?\nAnswer:", + "answer": [ + "C8H12O4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H21N3O?\nAnswer:", + "answer": [ + "N-[2-[(1-ethylimidazol-2-yl)methoxy]ethyl]propan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCOC1(CCN(C1)C)CC=O\nAnswer:", + "answer": [ + "2-(3-ethoxy-1-methylpyrrolidin-3-yl)acetaldehyde" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCNCC(=O)N1CCC(C1)C?\nAnswer:", + "answer": [ + "C9H18N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (3S)-2-(methylaminooxy)-5-methylsulfanylpent-1-en-3-amine?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 5-(methoxymethyl)-2-methylpyrazol-3-amine?\nAnswer (numerical number):", + "answer": [ + "141.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (5-fluoro-2-methyl-1,2-dihydropyridin-3-yl)methanol?\nAnswer (numerical number):", + "answer": [ + "143.16" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 4,5-dimethyl-5-prop-2-enylcyclopent-2-en-1-one?\nAnswer:", + "answer": [ + "C10H14O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (4R)-4-ethylcyclohexa-1,5-dien-1-ol?\nAnswer:", + "answer": [ + "C8H12O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in [(2R)-heptan-2-yl] N-prop-2-ynylcarbamate?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (Z)-N-(2-but-3-enoxyethyl)-3-chloro-2-methylprop-2-en-1-amine?\nAnswer:", + "answer": [ + "CC(=CCl)CNCCOCCC=C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCNC(=O)OCC1=NC=CS1?\nAnswer:", + "answer": [ + "C7H10N2O2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CNCC(C1=CN=C(S1)OC)O\nAnswer:", + "answer": [ + "(1R)-1-(2-methoxy-1,3-thiazol-5-yl)-2-(methylamino)ethanol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(CN)N1C(=O)COC1=O\nAnswer:", + "answer": [ + "3-(1-aminopropan-2-yl)-1,3-oxazolidine-2,4-dione" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H11NO?\nAnswer:", + "answer": [ + "CC(=O)C1=CC=CN1C2CC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(=O)N1C=CC=CC1=NC\nAnswer:", + "answer": [ + "1-(2-methyliminopyridin-1-yl)ethanone" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H17FN2?\nAnswer:", + "answer": [ + "C1CC2CC(CCN2C1)(CN)F" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1,4,7-trioxacyclonona-2,5,8-triyne?\nAnswer (numerical number):", + "answer": [ + "120.06" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC.C1CCNS(=O)(=O)CC1\nAnswer:", + "answer": [ + "ethane;thiazepane 1,1-dioxide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2,5-dimethyl-1-prop-2-enylpiperazine?\nAnswer (numerical number):", + "answer": [ + "154.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CN(C)CCNC1CCCC1C#N\nAnswer:", + "answer": [ + "(1S,2R)-2-[2-(dimethylamino)ethylamino]cyclopentane-1-carbonitrile" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H21N?\nAnswer (numerical number):", + "answer": [ + "167.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H11NOS?\nAnswer:", + "answer": [ + "CC(=O)NC1=CC=CC=C1SC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCC1CC1NC(=O)C(F)F?\nAnswer (numerical number):", + "answer": [ + "177.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-[2-[cyclopropyl(ethyl)amino]ethylamino]propanenitrile?\nAnswer:", + "answer": [ + "C10H19N3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-but-2-ynyl-3-chloro-2-methylprop-2-en-1-amine?\nAnswer (numerical number):", + "answer": [ + "157.64" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H18FN?\nAnswer:", + "answer": [ + "2-(2-cyclopropyl-2-fluoroethyl)piperidine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H10O2S?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC(C)CCC(C)C(=O)NC?\nAnswer (numerical number):", + "answer": [ + "171.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C12H18O2?\nAnswer (numerical number):", + "answer": [ + "194.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-(4-methylidenecyclohexyl)acetaldehyde?\nAnswer (numerical number):", + "answer": [ + "138.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 4-(aminomethyl)-3-chloro-1H-pyridin-2-one?\nAnswer:", + "answer": [ + "C1=CNC(=O)C(=C1CN)Cl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(=S)C1=CC=CC=N1\nAnswer:", + "answer": [ + "1-pyridin-2-ylethanethione" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C6H14N2O2?\nAnswer:", + "answer": [ + "CC(C(=O)OCCCN)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of [2-(1-aminohexan-2-ylamino)cyclohexyl]methanol?\nAnswer (numerical number):", + "answer": [ + "228.37" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1CN(CCC1N)C2CCSC2C?\nAnswer (numerical number):", + "answer": [ + "214.37" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CCCC=CC=CCC1?\nAnswer (numerical number):", + "answer": [ + "136.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCCC1C(CO1)C?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-fluoro-N-methyl-2-(oxan-3-yl)propan-1-amine?\nAnswer (numerical number):", + "answer": [ + "175.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H22O?\nAnswer (numerical number):", + "answer": [ + "158.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C11H25NO?\nAnswer (numerical number):", + "answer": [ + "187.32" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-[(5-amino-3-hydroxy-1-methyl-2,3-dihydropyrrol-4-yl)amino]acetaldehyde?\nAnswer:", + "answer": [ + "C7H13N3O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCC=COC=C\nAnswer:", + "answer": [ + "1-ethenoxypent-1-ene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCN1C=CN=C1NCCCC(C)N?\nAnswer:", + "answer": [ + "C10H20N4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N,2-bis(2-methoxyethyl)-2-methylbut-3-en-1-amine?\nAnswer (numerical number):", + "answer": [ + 37 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (7R)-7-thiophen-2-yl-1,4-oxazepane?\nAnswer:", + "answer": [ + "C9H13NOS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (3R)-4-methyl-3-(oxan-4-yl)pentan-1-amine?\nAnswer (numerical number):", + "answer": [ + "185.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CON=C1CCC2=C1N=CC=C2\nAnswer:", + "answer": [ + "(Z)-N-methoxy-5,6-dihydrocyclopenta[b]pyridin-7-imine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C12H23NO?\nAnswer:", + "answer": [ + "CCCNC(=O)CCC1CCCCC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-ethyl-2-N-(2-methoxyethyl)pentane-1,2-diamine?\nAnswer (numerical number):", + "answer": [ + "188.31" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 5-methoxy-4,4-dimethylhex-2-en-1-ol?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(COCC1CNCC(O1)C)O?\nAnswer:", + "answer": [ + "C10H21NO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H14N2?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N'-hydroxy-5-(2-methylprop-2-enylamino)pentanimidamide?\nAnswer (numerical number):", + "answer": [ + "185.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCCCOC(=C)CCCC(=C)S?\nAnswer (numerical number):", + "answer": [ + "214.37" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H17Cl?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (2E,4E)-6-hydroxy-N'-propan-2-ylhexa-2,4-dienehydrazide?\nAnswer:", + "answer": [ + "C9H16N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C4H4NPS2?\nAnswer (numerical number):", + "answer": [ + "161.2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-(thiolan-3-ylmethylamino)ethyl carbamate?\nAnswer (numerical number):", + "answer": [ + "204.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (1S,2R)-N-methyl-2-morpholin-4-ylcyclohexan-1-amine?\nAnswer:", + "answer": [ + "CNC1CCCCC1N2CCOCC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C=O)(C1CCCOC1)OC?\nAnswer (numerical number):", + "answer": [ + "172.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCCC(CC(=O)N(C)OC)N?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H19NO?\nAnswer:", + "answer": [ + "(NZ)-N-(2,2-dimethylheptan-4-ylidene)hydroxylamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H16O?\nAnswer:", + "answer": [ + "(2S,5S)-2-ethyl-5-methylcyclohexan-1-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H18O?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-methyl-2,3,3a,4,7,7a-hexahydroisoindol-1-one?\nAnswer:", + "answer": [ + "CC1C2CC=CCC2C(=O)N1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C=C1CCN(C1N)P?\nAnswer:", + "answer": [ + "C5H11N2P" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of isocyanooxyboronic acid?\nAnswer (numerical number):", + "answer": [ + "86.85" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1CCCN(CC1)C2CCCC2CO?\nAnswer (numerical number):", + "answer": [ + "197.32" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC(CCN1CCOCC1)N?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C5H6O4S?\nAnswer (numerical number):", + "answer": [ + "162.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2H-pyrimidin-1-ylboronic acid?\nAnswer (numerical number):", + "answer": [ + 16 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C5H11ClO2S?\nAnswer:", + "answer": [ + "CCCCCS(=O)(=O)Cl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H7NO2S?\nAnswer (numerical number):", + "answer": [ + "157.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CSC(=S)CCN.Cl\nAnswer:", + "answer": [ + "methyl 3-aminopropanedithioate;hydrochloride" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-(1-hydroxy-3-methoxypropan-2-yl)piperidin-2-one?\nAnswer (numerical number):", + "answer": [ + "187.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1CCCC(CC1)(CI)O\nAnswer:", + "answer": [ + "1-(iodomethyl)cycloheptan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(=CCl)CNCCSC?\nAnswer:", + "answer": [ + "C7H14ClNS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H19FN2?\nAnswer:", + "answer": [ + "2-N-(2-fluoroethyl)-2-N-methylcyclohexane-1,2-diamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C)C1=C(ON=C1N)N?\nAnswer (numerical number):", + "answer": [ + "141.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C5H10ClN3?\nAnswer (numerical number):", + "answer": [ + "147.60" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H24ClN?\nAnswer:", + "answer": [ + "4-(4-methylpentyl)piperidine;hydrochloride" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1CC(C(C1C)C)O?\nAnswer (numerical number):", + "answer": [ + "128.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of [2-(2,2-dimethylpropyl)oxiran-2-yl]methanol?\nAnswer:", + "answer": [ + "C8H16O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H19NS?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC#CCCC(=O)C1CSCCO1?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H15NO?\nAnswer (numerical number):", + "answer": [ + "165.23" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C=COC(=O)C(=O)OCCC#C?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C3H6O4S2?\nAnswer:", + "answer": [ + "2-methylsulfonylsulfanylacetic acid" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H19Cl?\nAnswer:", + "answer": [ + "CC(CC1CCCC1)(CCl)C=C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(C(=O)NC)NCC1CCOC1\nAnswer:", + "answer": [ + "(2S)-N-methyl-2-[[(3R)-oxolan-3-yl]methylamino]propanamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-(ethylamino)-2-(thiolan-3-yl)acetic acid?\nAnswer:", + "answer": [ + "C8H15NO2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-ethyl-1-(thian-2-yl)hex-4-yn-1-amine?\nAnswer (numerical number):", + "answer": [ + "225.40" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H16ClNS?\nAnswer (numerical number):", + "answer": [ + "193.74" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H11N3OS?\nAnswer:", + "answer": [ + "4-(ethylaminomethylsulfanyl)pyrimidine-5-carbaldehyde" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H18N2O2?\nAnswer:", + "answer": [ + "(2R)-2-amino-N-(2-methoxypropyl)butanamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-pyrimidin-5-ylmorpholin-4-amine?\nAnswer:", + "answer": [ + "C1COCCN1NC2=CN=CN=C2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H19NO?\nAnswer:", + "answer": [ + "CC1(CCC2N1CCCC2)CO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC1C2(CCS1)OCC(O2)CN?\nAnswer (numerical number):", + "answer": [ + "189.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 5,6-dimethyl-3-propyl-5,6-dihydro-2H-azepine?\nAnswer:", + "answer": [ + "C11H19N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H15NO2S?\nAnswer:", + "answer": [ + "1-(2-methylsulfanylacetyl)piperidine-2-carbaldehyde" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-hexan-3-yl-N-methylazetidin-3-amine?\nAnswer:", + "answer": [ + "CCCC(CC)N(C)C1CNC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (2S)-1-(6-methylpyrimidin-4-yl)propan-2-amine?\nAnswer:", + "answer": [ + "C8H13N3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C3H4N2O3?\nAnswer (numerical number):", + "answer": [ + 12 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCC(=CCOCC)N(C)C?\nAnswer (numerical number):", + "answer": [ + "171.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H17NS?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C10H14N2?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-(trimethylsilylmethyl)butan-2-amine?\nAnswer:", + "answer": [ + "C8H21NSi" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCCCCCCCC(CC#C)CO?\nAnswer:", + "answer": [ + "C14H26O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (1-hydroxy-3-methylpentan-3-yl)cyanamide?\nAnswer:", + "answer": [ + "C7H14N2O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC(C)(CSCCS)S?\nAnswer:", + "answer": [ + "C6H14S3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H17NO3?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1(CCC1N)C\nAnswer:", + "answer": [ + "(1R)-2,2-dimethylcyclobutan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1,1,2-trichloro-2,2-dideuterioethanol?\nAnswer:", + "answer": [ + "C2H3Cl3O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of hexa-1,3-dienyl formate?\nAnswer (numerical number):", + "answer": [ + "126.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1C(OCCN1)C2CCCCC2?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 3-amino-1-[amino(ethyl)amino]pentan-2-ol?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 4-(2-methylsulfanylpropylamino)cyclohexan-1-ol?\nAnswer:", + "answer": [ + "C10H21NOS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (6S)-3-ethyl-3-methyl-6-(oxiran-2-yl)dioxane?\nAnswer:", + "answer": [ + "C9H16O3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCNCCN1C=C(N=N1)CO?\nAnswer:", + "answer": [ + "C7H14N4O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCOC1(CCSC1)CC=O?\nAnswer:", + "answer": [ + "C8H14O2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H20N2?\nAnswer:", + "answer": [ + "CC(C)(C)CNC1CCCC1C#N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1CNC2C1C2C(F)(F)F?\nAnswer (numerical number):", + "answer": [ + 18 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H15N3S?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H15F?\nAnswer (numerical number):", + "answer": [ + "142.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCNCCOCC1=NN=C(N1C)C\nAnswer:", + "answer": [ + "2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methoxy]-N-ethylethanamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 5-methoxypent-2-ynylcyclohexane?\nAnswer:", + "answer": [ + "C12H20O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-(3-methylpentylsulfanyl)propane-1,1-diol?\nAnswer:", + "answer": [ + "C9H20O2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCNCC1=CN=C(S1)CO?\nAnswer:", + "answer": [ + "C7H12N2OS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (E)-3-(2,3-dihydrofuran-5-yl)prop-2-enoic acid?\nAnswer:", + "answer": [ + "C1COC(=C1)C=CC(=O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCCCNC=C(CC=C)C(=O)C?\nAnswer (numerical number):", + "answer": [ + "181.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1C2C=CC(C1C#N)S2?\nAnswer (numerical number):", + "answer": [ + 16 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 6-(3-ethylpyrrolidin-1-yl)hexane-1-thiol?\nAnswer (numerical number):", + "answer": [ + 39 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2\u00ce\u00bb3-ioda-7-azabicyclo[4.4.0]deca-1,3,5,7,9-pentaene?\nAnswer:", + "answer": [ + "C8H6IN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in O-(11-sulfanylundecyl)hydroxylamine?\nAnswer (numerical number):", + "answer": [ + 39 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C12H26O2?\nAnswer:", + "answer": [ + "CCCCCCCCC(C(C)(C)O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1COC(CC1(F)F)CO?\nAnswer (numerical number):", + "answer": [ + "152.14" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCC1CCC2C1CNC2\nAnswer:", + "answer": [ + "4-propyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-ethyloct-1-yn-3-amine?\nAnswer:", + "answer": [ + "CCCCCC(C#C)NCC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C8H13NO?\nAnswer (numerical number):", + "answer": [ + "139.19" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCCOC(C)C(=O)C=O\nAnswer:", + "answer": [ + "(3S)-3-butoxy-2-oxobutanal" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C1CC(CCC1CNCCCF)Cl\nAnswer:", + "answer": [ + "N-[(4-chlorocyclohexyl)methyl]-3-fluoropropan-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H18O3?\nAnswer (numerical number):", + "answer": [ + "186.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-ethyl-5-methyl-4,5,6,7-tetrahydrobenzimidazole?\nAnswer:", + "answer": [ + "CCN1C=NC2=C1CCC(C2)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-methoxy-2,5-dimethylidenepyrrol-3-ol?\nAnswer (numerical number):", + "answer": [ + "139.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC=CC(C)C?\nAnswer:", + "answer": [ + "C6H12" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCCCC(CC)(CCCC)S\nAnswer:", + "answer": [ + "(5R)-5-ethyldecane-5-thiol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H12O4?\nAnswer (numerical number):", + "answer": [ + "160.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1=CC(=NC=C1O)CCO?\nAnswer (numerical number):", + "answer": [ + 19 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC(C)(CN)CNCC(C)CN?\nAnswer (numerical number):", + "answer": [ + "187.33" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C11H22O2?\nAnswer:", + "answer": [ + "CC1CCC(CC1)OCCCOC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C3H11NO5P2?\nAnswer (numerical number):", + "answer": [ + "203.07" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H23NO3?\nAnswer:", + "answer": [ + "CC(CCOC)(CNCCCOC)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N'-methyl-N-propylideneethanimidamide?\nAnswer:", + "answer": [ + "CCC=NC(=NC)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2S)-3-[(1R)-1-butoxy-2-hydroxyethoxy]propane-1,2-diol?\nAnswer:", + "answer": [ + "CCCCOC(CO)OCC(CO)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC#CCCC(C)(C)C(=O)O?\nAnswer (numerical number):", + "answer": [ + "154.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(CCC(C1CCCC1)O)OC?\nAnswer (numerical number):", + "answer": [ + "186.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (2S)-1-cyclohexyloxy-3-(methylamino)propan-2-ol?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC(C)C(CC)C(C)CS?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2S)-2-(1,2,4-thiadiazol-5-yl)-1,4-oxazepane?\nAnswer:", + "answer": [ + "C1CNCC(OC1)C2=NC=NS2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-(3-aminocyclopentyl)oxypropan-1-ol?\nAnswer:", + "answer": [ + "C1CC(CC1N)OCCCO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-methyl-1-(oxolan-2-yl)but-3-en-2-ol?\nAnswer:", + "answer": [ + "C9H16O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of B(C1CCC(=NC1)OC)(O)O?\nAnswer (numerical number):", + "answer": [ + "156.98" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H13NS2?\nAnswer:", + "answer": [ + "CC1CC(NC(=S)S1)(C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-ethyl-3-(methylamino)hexanoic acid?\nAnswer:", + "answer": [ + "C9H19NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCC(C(CC)CC(CC)CO)O?\nAnswer:", + "answer": [ + "C12H26O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3,3-diethylhexa-1,5-diene?\nAnswer (numerical number):", + "answer": [ + "138.25" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1C2C1(C(CCC2)OC)C?\nAnswer:", + "answer": [ + "C10H18O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C1C(CC(C1CO)OC#P)N?\nAnswer (numerical number):", + "answer": [ + "173.15" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of ethyl N-acetyl-N-ethylcarbamate?\nAnswer (numerical number):", + "answer": [ + "159.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1CCCCC1N(C)C2CNC2?\nAnswer:", + "answer": [ + "C11H22N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-amino-N-[2-(2-aminoethyldisulfanyl)ethyl]acetamide?\nAnswer (numerical number):", + "answer": [ + "209.3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C12H21N?\nAnswer (numerical number):", + "answer": [ + "179.30" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1(CC(CCO1)N)C?\nAnswer:", + "answer": [ + "C7H15NO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C4H9N2O2P?\nAnswer:", + "answer": [ + "CNP(O)OCCC#N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H21NO3?\nAnswer:", + "answer": [ + "1-methoxy-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]propan-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of C1CCC(CC1)C23COCC2O3?\nAnswer:", + "answer": [ + "C10H16O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CC(C)(C)CNC1CCCC1C#N?\nAnswer (numerical number):", + "answer": [ + "180.29" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H19O6P?\nAnswer:", + "answer": [ + "2-methoxyethyl 2-propoxyethyl hydrogen phosphate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H11N?\nAnswer:", + "answer": [ + "CC=CC(=C)C(=N)C=C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of octyl(prop-1-enyl)phosphane?\nAnswer (numerical number):", + "answer": [ + "186.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC#CCCNC1CC2CCC1O2\nAnswer:", + "answer": [ + "N-pent-3-ynyl-7-oxabicyclo[2.2.1]heptan-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H13N3O?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H11NS?\nAnswer:", + "answer": [ + "CC#CCCNC1=CSC=C1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H21NO2?\nAnswer:", + "answer": [ + "C1CC(C1)N(CCCO)CCCO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (2S,4R)-2-ethyl-4-thiophen-2-ylpyrrolidine?\nAnswer:", + "answer": [ + "C10H15NS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 4-methoxy-2-methyl-1-(prop-2-enylamino)butan-2-ol?\nAnswer:", + "answer": [ + "C9H19NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H15NO3?\nAnswer:", + "answer": [ + "2-(3-hydroxy-2-methylpropyl)oxazinan-3-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-ethyl-5-propan-2-yl-1,2,4-oxadiazol-3-amine?\nAnswer:", + "answer": [ + "C7H13N3O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C(=NS(=O)OCl)=O?\nAnswer (numerical number):", + "answer": [ + "141.53" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCC(C#N)N1CCCCC1CN\nAnswer:", + "answer": [ + "(2S)-2-[(2R)-2-(aminomethyl)piperidin-1-yl]butanenitrile" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C5H13N2OP?\nAnswer:", + "answer": [ + "(5-methyl-1,2,5-oxadiazepan-2-yl)phosphane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H13N3?\nAnswer:", + "answer": [ + "CN1CC=CN2C1=NCCC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 4-(2,2-difluoropropyl)azepane?\nAnswer:", + "answer": [ + "C9H17F2N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 2-hexan-3-yl-1,1-dimethylhydrazine?\nAnswer:", + "answer": [ + "C8H20N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCCCC=CN1CCOCC1\nAnswer:", + "answer": [ + "4-hept-1-enylmorpholine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H11BrN2?\nAnswer (numerical number):", + "answer": [ + 22 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CNC1CC2(CCCO2)CCC1O\nAnswer:", + "answer": [ + "7-(methylamino)-1-oxaspiro[4.5]decan-8-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C7H11N5?\nAnswer:", + "answer": [ + "1-[(5E)-5-(aminomethylidene)imidazol-4-yl]iminopropan-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 5-amino-N-(2-methoxypropyl)pentanamide?\nAnswer (numerical number):", + "answer": [ + 33 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H19NO?\nAnswer (numerical number):", + "answer": [ + 30 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C6H15N3?\nAnswer:", + "answer": [ + "4-(2-methylpropyl)triazolidine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-[(3S)-4,4-dimethylpiperidin-3-yl]-N,N-dimethylethanamine?\nAnswer:", + "answer": [ + "CC1(CCNCC1CCN(C)C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C6H11NO?\nAnswer:", + "answer": [ + "3-aminohex-4-enal" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (1R,2R)-2-(3-methylbutylamino)cyclopentane-1-carbonitrile?\nAnswer:", + "answer": [ + "C11H20N2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-(pyrrolidin-3-yloxymethyl)pentan-3-ol?\nAnswer:", + "answer": [ + "C10H21NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C11H24N2S?\nAnswer (numerical number):", + "answer": [ + 38 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C6H12N2O4?\nAnswer (numerical number):", + "answer": [ + "176.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCOCCC(C)(CN)C=C\nAnswer:", + "answer": [ + "2-(2-ethoxyethyl)-2-methylbut-3-en-1-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(CNCC1CCOC1)C#N\nAnswer:", + "answer": [ + "(2S)-2-methyl-3-[[(3R)-oxolan-3-yl]methylamino]propanenitrile" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of CCC(C)(CO)C(=O)OC?\nAnswer (numerical number):", + "answer": [ + "146.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in N-[[1-(oxan-3-yl)piperidin-2-yl]methyl]ethanamine?\nAnswer (numerical number):", + "answer": [ + 42 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(C)N(CCN)CC(=CCl)C\nAnswer:", + "answer": [ + "N'-(3-chloro-2-methylprop-2-enyl)-N'-propan-2-ylethane-1,2-diamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of [1,3]thiazolo[3,2-b][1,2,4]triazole?\nAnswer:", + "answer": [ + "C4H3N3S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H23P?\nAnswer:", + "answer": [ + "butyl(2-ethylbutyl)phosphane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-[(1R,2S)-2,4-dimethylcyclohex-3-en-1-yl]-1,3-dioxolane?\nAnswer:", + "answer": [ + "CC1C=C(CCC1C2OCCO2)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(=O)OCCCCP?\nAnswer (numerical number):", + "answer": [ + 22 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-dimethylphosphorylbut-2-yne?\nAnswer:", + "answer": [ + "C6H11OP" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2S)-2,3-dimethylpentan-1-ol?\nAnswer:", + "answer": [ + "CCC(C)C(C)CO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of cyclohepta-2,6-dien-1-imine?\nAnswer:", + "answer": [ + "C1CC=CC(=N)C=C1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C5H10O3?\nAnswer:", + "answer": [ + "(2S)-2-methoxy-1,4-dioxane" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-methyl-1-(2-methylsulfinylphenyl)methanamine?\nAnswer (numerical number):", + "answer": [ + "183.27" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of COC(=O)C(=C)C1CCCO1?\nAnswer (numerical number):", + "answer": [ + "156.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C5H7ClN2O?\nAnswer:", + "answer": [ + "3-chloro-N-(cyanomethyl)propanamide" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C=CCSCCNC(=O)OCCO?\nAnswer (numerical number):", + "answer": [ + "205.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC1(CCN(C1)CCS)O?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 5-hydroxy-3-methyl-4-sulfanyl-1H-imidazol-2-one?\nAnswer (numerical number):", + "answer": [ + "146.17" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in ethane;3-methylcyclopentene?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of ethoxymethyl 2-hydroxypentanoate?\nAnswer:", + "answer": [ + "C8H16O4" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H17NS?\nAnswer (numerical number):", + "answer": [ + "183.32" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCCCCC(=O)CCC=CC=C\nAnswer:", + "answer": [ + "trideca-1,3-dien-7-one" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 4-methyl-N-pent-3-ynylpiperazin-1-amine?\nAnswer:", + "answer": [ + "CC#CCCNN1CCN(CC1)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H17N3?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-(3-methylbutan-2-yl)pent-3-yn-1-amine?\nAnswer (numerical number):", + "answer": [ + "153.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of methyl 2-chloro-2-(thiolan-3-yl)acetate?\nAnswer:", + "answer": [ + "C7H11ClO2S" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CC1=C(SN=C1C(CCN)O)C?\nAnswer:", + "answer": [ + "C8H14N2OS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of (5-cyclobutyl-3-methyl-1,2-oxazol-4-yl)methanamine?\nAnswer (numerical number):", + "answer": [ + "166.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C8H17NO2?\nAnswer:", + "answer": [ + "CNCCOCOCC1CC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C7H15N5?\nAnswer:", + "answer": [ + "CC(CCN)CC1=NN(N=N1)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC1=NN2C=CN=C2C=C1F?\nAnswer:", + "answer": [ + "C8H8FN3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C3H8N2S?\nAnswer:", + "answer": [ + "2-aminoethyl methanimidothioate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-(3-methyl-1,2-oxazol-5-yl)butan-1-amine?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H19NOS?\nAnswer:", + "answer": [ + "N-cyclopentyloxy-2-methylthiolan-3-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C9H14N2O?\nAnswer (numerical number):", + "answer": [ + "166.22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H18N4O?\nAnswer:", + "answer": [ + "N-[2-[(4-methyl-1,2,4-triazol-3-yl)methoxy]ethyl]propan-2-amine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 5-hydroxy-N-(2-prop-2-enylsulfanylethyl)pentanamide?\nAnswer:", + "answer": [ + "C=CCSCCNC(=O)CCCCO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1CC(COC1)C(C=O)(F)F?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H17N3O?\nAnswer (numerical number):", + "answer": [ + "195.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1-propan-2-ylpyrrolidine-2,5-dione?\nAnswer:", + "answer": [ + "C7H11NO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-ethyl-2-methyl-2-(2-methylsulfanylethyl)but-3-en-1-amine?\nAnswer:", + "answer": [ + "C10H21NS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C6H11N3?\nAnswer:", + "answer": [ + "2,3,7-triazaspiro[4.4]non-2-ene" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H14N2?\nAnswer:", + "answer": [ + "dec-2-enedinitrile" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2R)-2-[(Z)-hex-3-enoxy]oxane?\nAnswer:", + "answer": [ + "CCC=CCCOC1CCCCO1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C12H14?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H21O2P?\nAnswer:", + "answer": [ + "CCCCOCP(=O)(CC)CC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2-methyldeca-4,6-diene?\nAnswer (numerical number):", + "answer": [ + 31 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2,5-dimethyl-1-(2-methylpropyl)imidazole?\nAnswer (numerical number):", + "answer": [ + "152.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in [2-(3-methylbut-3-enylamino)cyclopentyl]methanol?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of methyl 2-[2-(aminomethyl)cyclohexyl]oxyacetate?\nAnswer:", + "answer": [ + "C10H19NO3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C4H8O2?\nAnswer (numerical number):", + "answer": [ + "88.11" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H17NO2?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C7H12N2O?\nAnswer (numerical number):", + "answer": [ + "140.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of N-(2-methoxypropyl)-1-(thiolan-3-yl)ethane-1,2-diamine?\nAnswer:", + "answer": [ + "CC(CNC(CN)C1CCSC1)OC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]ethanamine;hydrochloride?\nAnswer (numerical number):", + "answer": [ + "238.74" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-fluoroprop-2-ynal?\nAnswer:", + "answer": [ + "C3HFO" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-methyl-4-(pent-1-yn-3-ylamino)butan-2-ol?\nAnswer (numerical number):", + "answer": [ + "169.26" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C=CCSSC1=NNSC1=S?\nAnswer (numerical number):", + "answer": [ + 17 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C12H21N?\nAnswer:", + "answer": [ + "CCCC(C#C)NC(CC)C1CC1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCOCCCC(=O)N1CCCCC1C?\nAnswer (numerical number):", + "answer": [ + 38 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC(C(=O)NCC)NC(=O)C?\nAnswer:", + "answer": [ + "C8H16N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C3H10N2S?\nAnswer:", + "answer": [ + "ethane;thiourea" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C9H14O?\nAnswer:", + "answer": [ + "CC1CC(=CC=C1C)OC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 1,3-diaminobutyl acetate?\nAnswer:", + "answer": [ + "C6H14N2O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C10H21NO2?\nAnswer:", + "answer": [ + "CCCC(CC)N(C)CCC(=O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-(3-aminopropoxy)cyclopentan-1-ol?\nAnswer:", + "answer": [ + "C1CC(C(C1)OCCCN)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 1-[2-(1-methylpyrrol-2-yl)ethyl]cyclopropan-1-amine?\nAnswer (numerical number):", + "answer": [ + 28 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C12H24N2?\nAnswer:", + "answer": [ + "CNC1CCCCCC1N2CCCC2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CNC1C2N(C1=O)CCCS2?\nAnswer:", + "answer": [ + "C7H12N2OS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H16O2?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (2S)-1-[(1-methyltriazol-4-yl)methylamino]propan-2-ol?\nAnswer (numerical number):", + "answer": [ + 26 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-(furan-2-yl)cyclopropan-1-ol?\nAnswer (numerical number):", + "answer": [ + "124.14" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(=O)C(C(CCS)N)(N)S?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C12H25NO?\nAnswer (numerical number):", + "answer": [ + 39 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-[[(2S)-1-methylpiperidin-2-yl]methyl]-1,5-diazocane?\nAnswer (numerical number):", + "answer": [ + "225.37" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of methyl (2R)-2-(aminomethyl)piperidine-1-carboxylate?\nAnswer:", + "answer": [ + "COC(=O)N1CCCCC1CN" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 2-N-hex-1-yn-3-ylhexane-1,2-diamine?\nAnswer (numerical number):", + "answer": [ + "196.33" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of N-prop-2-ynylbutan-1-amine?\nAnswer (numerical number):", + "answer": [ + "111.18" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C5H9NS2?\nAnswer (numerical number):", + "answer": [ + "147.3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H16FN?\nAnswer (numerical number):", + "answer": [ + "169.24" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C6H6O2S?\nAnswer:", + "answer": [ + "2,2,3,3,5,7-hexadeuteriothieno[3,4-b][1,4]dioxine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 1-amino-3-ethyl-2-methylhexan-3-ol?\nAnswer:", + "answer": [ + "CCCC(CC)(C(C)CN)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCC1=CC2=C(N1)CCC2?\nAnswer:", + "answer": [ + "C9H13N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(CCC1=CC=CS1)N(C)O\nAnswer:", + "answer": [ + "N-methyl-N-[(2S)-4-thiophen-2-ylbutan-2-yl]hydroxylamine" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethanethiol?\nAnswer (numerical number):", + "answer": [ + "144.20" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of C4H10OS4?\nAnswer:", + "answer": [ + "CSCSS(=O)CSC" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of ethyl (2R)-2-chlorohexanoate?\nAnswer:", + "answer": [ + "C8H15ClO2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene?\nAnswer (numerical number):", + "answer": [ + 24 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in (2R)-2-[[[(2R)-butan-2-yl]amino]methyl]butanamide?\nAnswer (numerical number):", + "answer": [ + 32 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in 4-methylidenepiperidine;hydroiodide?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCCCCCCCl.C1CCCCC1?\nAnswer:", + "answer": [ + "C14H29Cl" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C11H23NO2?\nAnswer:", + "answer": [ + "4-[[2-(hydroxymethyl)cyclohexyl]amino]butan-2-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC(CCCCCN)C(C)O\nAnswer:", + "answer": [ + "8-amino-3-methyloctan-2-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of (2E,4E,6Z)-octa-2,4,6-triene-3,5-diol?\nAnswer:", + "answer": [ + "C8H12O2" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CCC1=CN2CCSC2=N1?\nAnswer (numerical number):", + "answer": [ + 20 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of (2S)-2-amino-4-(difluoromethoxy)butanoic acid?\nAnswer:", + "answer": [ + "C(COC(F)F)C(C(=O)O)N" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of CCCC(C)CC(C)C=CC?\nAnswer:", + "answer": [ + "C11H22" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H17NO2?\nAnswer (numerical number):", + "answer": [ + 27 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of N-(1,2-oxazol-3-ylmethyl)-1-(thiolan-3-yl)methanamine?\nAnswer:", + "answer": [ + "C9H14N2OS" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular formula of 3-ethoxyperoxynonane?\nAnswer:", + "answer": [ + "C11H24O3" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of 3-methoxy-2-(pyrimidin-4-ylamino)propan-1-ol?\nAnswer (numerical number):", + "answer": [ + "183.21" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-[2-(2,2-dimethylhydrazinyl)ethyl]-1,1-dimethylhydrazine?\nAnswer:", + "answer": [ + "CN(C)NCCNN(C)C" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C10H18O3?\nAnswer:", + "answer": [ + "furan-2-ol;hexan-1-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C8H12F2?\nAnswer (numerical number):", + "answer": [ + 22 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 2-decan-2-yl-1,3,5-trithiane?\nAnswer:", + "answer": [ + "CCCCCCCCC(C)C1SCSCS1" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C9H16?\nAnswer (numerical number):", + "answer": [ + 25 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCC(=O)OCC1CC1\nAnswer:", + "answer": [ + "cyclopropylmethyl butanoate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CC(C)(C)CN(C)CC=C?\nAnswer (numerical number):", + "answer": [ + 29 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 3-[(2,2-difluoro-3-hydroxypropyl)amino]pentanenitrile?\nAnswer:", + "answer": [ + "CCC(CC#N)NCC(CO)(F)F" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the SMILES expression of 5-(hydroxymethyl)-1-propylpyrrolidine-3,3-diol?\nAnswer:", + "answer": [ + "CCCN1CC(CC1CO)(O)O" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CCCC(C)OCC(CNC)O\nAnswer:", + "answer": [ + "1-(methylamino)-3-pentan-2-yloxypropan-2-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the molecular weight of C10H20N2O?\nAnswer (numerical number):", + "answer": [ + "184.28" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C8H10O2S?\nAnswer:", + "answer": [ + "methyl (1S,2R,4S)-7-thiabicyclo[2.2.1]hept-5-ene-2-carboxylate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C1CC(NC1)COCCCCCO?\nAnswer (numerical number):", + "answer": [ + 34 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of C9H17NO3?\nAnswer:", + "answer": [ + "methyl 2-(4-methylpiperidin-3-yl)oxyacetate" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in CN(CC1=CN=C2N1CCS2)O?\nAnswer (numerical number):", + "answer": [ + 23 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "How many atoms are there in C7H10N4?\nAnswer (numerical number):", + "answer": [ + 21 + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + }, + { + "question": "What is the name of CC1=NC(=CS1)O\nAnswer:", + "answer": [ + "2-methyl-1,3-thiazol-4-ol" + ], + "category": "chemistry", + "topic": null, + "ability": "Knowledge Application", + "type": "filling", + "task_name": "Molecular", + "prompt": "Please answer the following question without any explaination, and directly give the answer.", + "cot_prompt": "" + } +] \ No newline at end of file