image
imagewidth (px) 1.2k
1.2k
| question
stringclasses 5
values | choices
stringlengths 12
2.33k
| label
int64 0
3
| description
stringlengths 28
356
| id
stringlengths 30
38
|
|---|---|---|---|---|---|
How many carbons are in the following organic molecule? | [12, 13, 14, 15] | 3 | Its SMILES notation is CC(CNC(=O)C1=CC(=NC=C1)Cl)C2=C(C=CC=C2Cl)Cl. | sci_bench/chemistry/count_Cs_0 |
|
How many carbons are in the following organic molecule? | [11, 12, 13, 14] | 1 | Its SMILES notation is CC1=CC(=O)N(C(=N1)OC)CCC2=CN(N=C2)C. | sci_bench/chemistry/count_Cs_1 |
|
How many carbons are in the following organic molecule? | [12, 13, 14, 15] | 2 | Its SMILES notation is C1=CC(=CC(=C1)C(=O)NC2=CC(=C(C=C2)O)Cl)C#N. | sci_bench/chemistry/count_Cs_2 |
|
How many carbons are in the following organic molecule? | [7, 8, 9, 10] | 1 | Its SMILES notation is CN1N=C(N=N1)C2CC(CC(C2)Cl)Cl. | sci_bench/chemistry/count_Cs_3 |
|
How many carbons are in the following organic molecule? | [15, 16, 17, 18] | 2 | Its SMILES notation is C1=CC=C(C(=C1)CCN2C3=NC(=NC(=C3C=N2)C4=CC=CO4)N)F. | sci_bench/chemistry/count_Cs_4 |
|
How many carbons are in the following organic molecule? | [21, 22, 23, 24] | 2 | Its SMILES notation is CCN1C=C(C=N1)CN2CC3(C2)CC(CCO3)OCC4=CC=NC=C4.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O. | sci_bench/chemistry/count_Cs_5 |
|
How many carbons are in the following organic molecule? | [16, 17, 18, 19] | 2 | Its SMILES notation is CCCCCC[N+](CCCC)(CCCCC)CCCO.[I-]. | sci_bench/chemistry/count_Cs_6 |
|
How many carbons are in the following organic molecule? | [6, 7, 8, 9] | 3 | Its SMILES notation is CC(C1=CC=CC=C1Cl)C(F)(F)F. | sci_bench/chemistry/count_Cs_7 |
|
How many carbons are in the following organic molecule? | [14, 15, 16, 17] | 1 | Its SMILES notation is CC(C(=O)O)N=NC1=C(C=C(C(=C1)CN2C(=O)C(CO2)(C)C)Cl)Cl. | sci_bench/chemistry/count_Cs_8 |
|
How many carbons are in the following organic molecule? | [17, 18, 19, 20] | 2 | Its SMILES notation is C1=CC=C(C=C1)C2=CC=CC=C2NC3=CC=C(C4=NON=C34)C(=O)[O-]. | sci_bench/chemistry/count_Cs_9 |
|
How many carbons are in the following organic molecule? | [20, 21, 22, 23] | 0 | Its SMILES notation is C#CC1=CC=C(C=C1)C#CC2=CC3=CC=CC=C3C=C2. | sci_bench/chemistry/count_Cs_10 |
|
How many carbons are in the following organic molecule? | [14, 15, 16, 17] | 2 | Its SMILES notation is CC1=C(C=C(C=C1)C2=NOC(=N2)CCC(=O)NC(C)(C)CN)F.Cl. | sci_bench/chemistry/count_Cs_11 |
|
How many carbons are in the following organic molecule? | [22, 23, 24, 25] | 1 | Its SMILES notation is CC1=NC2=CC3=C(C=C2C(=N1)N4CCN(CC4)C(=O)CC5=CC=C(C=C5)F)OCCO3. | sci_bench/chemistry/count_Cs_12 |
|
How many carbons are in the following organic molecule? | [24, 25, 26, 27] | 3 | Its SMILES notation is CC1CC2C3CCC4=CC(=NOCC5=CC(=CN=C5)Br)C=CC4(C3(C(CC2C1(C(=O)CO)O)O)F)C. | sci_bench/chemistry/count_Cs_13 |
|
How many carbons are in the following organic molecule? | [14, 15, 16, 17] | 0 | Its SMILES notation is CCOCCC(=O)NCC1=CC(=CC=C1)OCC(=O)O. | sci_bench/chemistry/count_Cs_14 |
|
How many carbons are in the following organic molecule? | [22, 23, 24, 25] | 2 | Its SMILES notation is CC1=C(C(=NC2=NC(=NN12)SC)C)CC(=O)NC3=CC=C(C=C3)NCCC4=CC=CC=C4. | sci_bench/chemistry/count_Cs_15 |
|
How many carbons are in the following organic molecule? | [15, 16, 17, 18] | 3 | Its SMILES notation is CC(CNC(=O)C1=NC2=CC=CC=C2C=C1)(CN3CCOCC3)O. | sci_bench/chemistry/count_Cs_16 |
|
How many carbons are in the following organic molecule? | [9, 10, 11, 12] | 1 | Its SMILES notation is C1=CC2=C(C=C1[N+](=O)[O-])OC(C(=O)N2)CC(=O)[O-]. | sci_bench/chemistry/count_Cs_17 |
|
How many carbons are in the following organic molecule? | [10, 11, 12, 13] | 1 | Its SMILES notation is CCCCN1CNC2C1C=CC=C2. | sci_bench/chemistry/count_Cs_18 |
|
How many carbons are in the following organic molecule? | [40, 41, 42, 43] | 0 | Its SMILES notation is CC(C)(C)OC(=O)NC(C1=CC=CC=C1)C(=O)NC(C2=CC(=C(C(=C2)O)OC)O)C(=O)NC(C3=CC=CC=C3)C(=O)NC(CC4=CC=C(C=C4)Cl)C(=O)OC. | sci_bench/chemistry/count_Cs_19 |
|
How many carbons are in the following organic molecule? | [33, 34, 35, 36] | 0 | Its SMILES notation is C[N+]1(CCC2=CC(=C(C=C2C1CC3=CC(=C(C(=C3)OC)OC)OC)OC)OC)CCCC(CCCCCC(=O)O)C(=O)O. | sci_bench/chemistry/count_Cs_20 |
|
How many carbons are in the following organic molecule? | [11, 12, 13, 14] | 2 | Its SMILES notation is CC1CCC=CC1NC(=O)C2=CC(=NC=C2)F. | sci_bench/chemistry/count_Cs_21 |
|
How many carbons are in the following organic molecule? | [12, 13, 14, 15] | 3 | Its SMILES notation is CC(C)CC1C(=O)N(C(=O)N1)C(C)C2=CC=CC=C2. | sci_bench/chemistry/count_Cs_22 |
|
How many carbons are in the following organic molecule? | [13, 14, 15, 16] | 3 | Its SMILES notation is C1=CC=C2C(=C1)C=CC3=[NH+]C4=C(C=C(C=C4)S(=O)(=O)O)N=C32.[OH-]. | sci_bench/chemistry/count_Cs_23 |
|
How many carbons are in the following organic molecule? | [23, 24, 25, 26] | 1 | Its SMILES notation is B1(N(C(C(=C(C2=CC=CC=C2)C3=CC=CC=C3)O1)C=NC(C)(C)C)C(C)(C)C)Br. | sci_bench/chemistry/count_Cs_24 |
|
How many carbons are in the following organic molecule? | [22, 23, 24, 25] | 1 | Its SMILES notation is CN=C(NCCCN1CCN(CC1C2=CC=CC=C2)C)NCC3=CC(=CC=C3)F.I. | sci_bench/chemistry/count_Cs_25 |
|
How many carbons are in the following organic molecule? | [20, 21, 22, 23] | 2 | Its SMILES notation is C1C2CC3(CC1CC(C2)(C3)Br)CC(=O)NCC4=CN(N=C4)C5=CC=CC=C5. | sci_bench/chemistry/count_Cs_26 |
|
How many carbons are in the following organic molecule? | [77, 78, 79, 80] | 2 | Its SMILES notation is CC1=CC(=C(C=C1F)F)CC(=O)N(CCN=C(CN(CCN=C(CN(C)CCN(C)C)O)C(=O)CN2C=CC(=N)N=C2O)O)CC(=NCCN(CC(=NCCN(CC(=NCCN(CC(=NCCN(CC(=NCCN3CCOCC3)O)C(=O)CN4C=NC5=C4NC(=N)N=C5O)O)C(=O)CN6C=NC7=C(N=CN=C76)N)O)C(=O)CN8C=CC(=N)N=C8O)O)C(=O)CN9C=NC1=C9NC(=N)N=C1O)O. | sci_bench/chemistry/count_Cs_27 |
|
How many carbons are in the following organic molecule? | [10, 11, 12, 13] | 1 | Its SMILES notation is CC1=CSC(=N1)CNC2CC3CCC2O3. | sci_bench/chemistry/count_Cs_28 |
|
How many carbons are in the following organic molecule? | [14, 15, 16, 17] | 1 | Its SMILES notation is CN(C)C1=C2CC(CCC2=NO1)C3=CC=CC=C3F. | sci_bench/chemistry/count_Cs_29 |
|
How many carbons are in the following organic molecule? | [14, 15, 16, 17] | 3 | Its SMILES notation is CC(C)(C)C1=CC=C(C=C1)CCNC(=NC)NCCC(F)(F)F.I. | sci_bench/chemistry/count_Cs_30 |
|
How many carbons are in the following organic molecule? | [6, 7, 8, 9] | 3 | Its SMILES notation is CCC1CC1C(C2=NN(N=C2)C)O. | sci_bench/chemistry/count_Cs_31 |
|
How many carbons are in the following organic molecule? | [16, 17, 18, 19] | 3 | Its SMILES notation is C1CCN(C1)C(CNC(=O)C2COCCN2CC(F)(F)F)C3=C(C=CC=C3Cl)F. | sci_bench/chemistry/count_Cs_32 |
|
How many carbons are in the following organic molecule? | [32, 33, 34, 35] | 2 | Its SMILES notation is CC(CCC=C(C)C)C1CCC2(C1(CCC3=C2CCC4C3(CCC(C4(C)C)OC(=O)C(=C)CO)C)C)C. | sci_bench/chemistry/count_Cs_33 |
|
How many carbons are in the following organic molecule? | [13, 14, 15, 16] | 3 | Its SMILES notation is CC(=O)C1=CC=C(C=C1)S(=O)(=O)N2CCN(CC2)C3CCS(=O)(=O)C3. | sci_bench/chemistry/count_Cs_34 |
|
How many carbons are in the following organic molecule? | [25, 26, 27, 28] | 0 | Its SMILES notation is C1CCN(C1)CC2=CC(=CC=C2)C(=O)N3CCCC(C3)C4=NC(=NO4)C5=CC(=CC=C5)F. | sci_bench/chemistry/count_Cs_35 |
|
How many carbons are in the following organic molecule? | [7, 8, 9, 10] | 0 | Its SMILES notation is C=CC1=CC=NC=C1. | sci_bench/chemistry/count_Cs_36 |
|
How many carbons are in the following organic molecule? | [32, 33, 34, 35] | 3 | Its SMILES notation is CCN(CC(C1=CC=CC=C1Cl)N2CCN(CC2)C(=O)C(CC3=CC=C(C=C3)Cl)NC(=O)CC4C5=CC=CC=C5CCN4)S(=O)(=O)C. | sci_bench/chemistry/count_Cs_37 |
|
How many carbons are in the following organic molecule? | [41, 42, 43, 44] | 3 | Its SMILES notation is CC1C(OC(OC1C2=CC=C(C=C2)CO)C3=CC=C(C=C3)CNC(=O)C(CC4=CC=CC=C4)NS(=O)(=O)C5=CC=C(C=C5)C)CSC6=CC=C(C=C6)NC(=O)C. | sci_bench/chemistry/count_Cs_38 |
|
How many carbons are in the following organic molecule? | [21, 22, 23, 24] | 1 | Its SMILES notation is CC1CCCC(C1C)NC(=O)NC(=O)COC2=C(C=C(C=C2)C=CC(=O)OC)OC. | sci_bench/chemistry/count_Cs_39 |
|
How many carbons are in the following organic molecule? | [14, 15, 16, 17] | 1 | Its SMILES notation is CC(C(=O)[O-])N(C1=CC=C(C=C1)Br)S(=O)(=O)C2=CC=CC=C2. | sci_bench/chemistry/count_Cs_40 |
|
How many carbons are in the following organic molecule? | [19, 20, 21, 22] | 2 | Its SMILES notation is CC1=CC=C(C=C1)CC2=CN=C(S2)NC(=O)NC3=CC(=C(C=C3)C)NC(=O)C. | sci_bench/chemistry/count_Cs_41 |
|
How many carbons are in the following organic molecule? | [11, 12, 13, 14] | 0 | Its SMILES notation is COC1=C(C(=CN=C1CCl)CC(=O)OC)C(F)F. | sci_bench/chemistry/count_Cs_42 |
|
How many carbons are in the following organic molecule? | [12, 13, 14, 15] | 0 | Its SMILES notation is C1OCOC(O1)C2=[N+](C=CC3=CC=CC=C32)[O-]. | sci_bench/chemistry/count_Cs_43 |
|
How many carbons are in the following organic molecule? | [21, 22, 23, 24] | 2 | Its SMILES notation is CCOC(=O)C1=CN=C2C(=CC(=CC2=C1NCC3=CC(=C(C=C3)OC)Cl)C#N)C(=O)OC. | sci_bench/chemistry/count_Cs_44 |
|
How many carbons are in the following organic molecule? | [6, 7, 8, 9] | 3 | Its SMILES notation is CC1=CC=CN(C1=O)CC(=O)OC. | sci_bench/chemistry/count_Cs_45 |
|
How many carbons are in the following organic molecule? | [9, 10, 11, 12] | 3 | Its SMILES notation is CNS(=O)(=O)C1=CC(=CC=C1)S(=O)(=O)NCC(=O)NCC#C. | sci_bench/chemistry/count_Cs_46 |
|
How many carbons are in the following organic molecule? | [8, 9, 10, 11] | 2 | Its SMILES notation is CC1=NN(C=C1C(CC(C)C)N)C. | sci_bench/chemistry/count_Cs_47 |
|
How many carbons are in the following organic molecule? | [19, 20, 21, 22] | 0 | Its SMILES notation is CC(=CCN1CCN(CC1CCO)CC2=CC(=CC=C2)SC)C. | sci_bench/chemistry/count_Cs_48 |
|
How many carbons are in the following organic molecule? | [9, 10, 11, 12] | 0 | Its SMILES notation is CN[Si](C=C)(C1=CC=CC=C1)Cl. | sci_bench/chemistry/count_Cs_49 |
|
How many hydrogens are in the following organic molecule? | [3, 4, 5, 6] | 3 | Its SMILES notation is C1=CC(=C(C=C1Br)Br)NC(=O)C2=CC(=NC(=C2)Cl)Cl. | sci_bench/chemistry/count_Hs_0 |
|
How many hydrogens are in the following organic molecule? | [21, 22, 23, 24] | 1 | Its SMILES notation is CC1=CC=C(C=C1)CC2=CN=C(S2)NC(=O)NC3=CC(=C(C=C3)C)NC(=O)C. | sci_bench/chemistry/count_Hs_1 |
|
How many hydrogens are in the following organic molecule? | [22, 23, 24, 25] | 2 | Its SMILES notation is C1CCN(C1)C(CNC(=O)C2COCCN2CC(F)(F)F)C3=C(C=CC=C3Cl)F. | sci_bench/chemistry/count_Hs_2 |
|
How many hydrogens are in the following organic molecule? | [15, 16, 17, 18] | 2 | Its SMILES notation is CC(C(=O)O)N=NC1=C(C=C(C(=C1)CN2C(=O)C(CO2)(C)C)Cl)Cl. | sci_bench/chemistry/count_Hs_3 |
|
How many hydrogens are in the following organic molecule? | [12, 13, 14, 15] | 3 | Its SMILES notation is CC1CCC=CC1NC(=O)C2=CC(=NC=C2)F. | sci_bench/chemistry/count_Hs_4 |
|
How many hydrogens are in the following organic molecule? | [50, 51, 52, 53] | 2 | Its SMILES notation is C1CCC(CC1)C(N2CCCC2C(=O)NC3=CC=C(C=C3)C=CC4=CC=C(C=C4)NC(=O)C5CCCN5C(C6CCCCC6)O)O. | sci_bench/chemistry/count_Hs_5 |
|
How many hydrogens are in the following organic molecule? | [37, 38, 39, 40] | 0 | Its SMILES notation is CCCCCCCC(C1(CCCCC1)OC)NCCC. | sci_bench/chemistry/count_Hs_6 |
|
How many hydrogens are in the following organic molecule? | [23, 24, 25, 26] | 3 | Its SMILES notation is CC1CC2C(C1(C)CC=O)CCCC2OCOC. | sci_bench/chemistry/count_Hs_7 |
|
How many hydrogens are in the following organic molecule? | [9, 10, 11, 12] | 0 | Its SMILES notation is CC1=C(C=C(C=C1)C#N)NS(=O)(=O)N. | sci_bench/chemistry/count_Hs_8 |
|
How many hydrogens are in the following organic molecule? | [20, 21, 22, 23] | 1 | Its SMILES notation is C1CC(OC1)CNS(=O)(=O)C2=CC=C(C=C2)CNC3=CC=CC(=N3)C(=O)O. | sci_bench/chemistry/count_Hs_9 |
|
How many hydrogens are in the following organic molecule? | [15, 16, 17, 18] | 2 | Its SMILES notation is CC1=C(SC=C1)C=CC(=O)N2CCCC(C2)C(=O)O. | sci_bench/chemistry/count_Hs_10 |
|
How many hydrogens are in the following organic molecule? | [24, 25, 26, 27] | 2 | Its SMILES notation is C1CC2=CC=CC=C2C1NC(=O)C3=CC=CC(=C3)C4=CN=C(C(=N4)C(=O)NC5CCNC5)N. | sci_bench/chemistry/count_Hs_11 |
|
How many hydrogens are in the following organic molecule? | [32, 33, 34, 35] | 0 | Its SMILES notation is CCNC(=NCC1=CC=C(C=C1)NCCOC)NCCC(C2=CC=CC=C2)O. | sci_bench/chemistry/count_Hs_12 |
|
How many hydrogens are in the following organic molecule? | [18, 19, 20, 21] | 3 | Its SMILES notation is CC(C1=C(C=CC(=C1)OC)OC)NC(=O)C(C)OC(=O)C2=C(N=CC=C2)Cl. | sci_bench/chemistry/count_Hs_13 |
|
How many hydrogens are in the following organic molecule? | [25, 26, 27, 28] | 3 | Its SMILES notation is CC(C(=O)OC)SC1=CC=CC=C1C(=O)NCC(C2=CC=C(C=C2)OC)C3=CNC4=CC=CC=C43. | sci_bench/chemistry/count_Hs_14 |
|
How many hydrogens are in the following organic molecule? | [19, 20, 21, 22] | 2 | Its SMILES notation is CCNCCC1=NC(=NO1)CCC(C)C. | sci_bench/chemistry/count_Hs_15 |
|
How many hydrogens are in the following organic molecule? | [7, 8, 9, 10] | 0 | Its SMILES notation is C=CC1=CC=NC=C1. | sci_bench/chemistry/count_Hs_16 |
|
How many hydrogens are in the following organic molecule? | [15, 16, 17, 18] | 1 | Its SMILES notation is C1=CC=C2C(=C1)C(=NS2(=O)=O)NCCC(=O)OCC(=O)NC3=CC(=CC=C3)Cl. | sci_bench/chemistry/count_Hs_17 |
|
How many hydrogens are in the following organic molecule? | [43, 44, 45, 46] | 0 | Its SMILES notation is CCN(CC(C1=CC=CC=C1Cl)N2CCN(CC2)C(=O)C(CC3=CC=C(C=C3)Cl)NC(=O)CC4C5=CC=CC=C5CCN4)S(=O)(=O)C. | sci_bench/chemistry/count_Hs_18 |
|
How many hydrogens are in the following organic molecule? | [37, 38, 39, 40] | 3 | Its SMILES notation is CCCCCC[N+](CCCC)(CCCCC)CCCO.[I-]. | sci_bench/chemistry/count_Hs_19 |
|
How many hydrogens are in the following organic molecule? | [10, 11, 12, 13] | 2 | Its SMILES notation is CN[Si](C=C)(C1=CC=CC=C1)Cl. | sci_bench/chemistry/count_Hs_20 |
|
How many hydrogens are in the following organic molecule? | [26, 27, 28, 29] | 2 | Its SMILES notation is CCN1C=C(C=N1)CN2CC3(C2)CC(CCO3)OCC4=CC=NC=C4.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O. | sci_bench/chemistry/count_Hs_21 |
|
How many hydrogens are in the following organic molecule? | [11, 12, 13, 14] | 2 | Its SMILES notation is CC1=NC(=C2C=C(SC2=N1)C3=CC=CC=C3)NC4=C(C=CC(=C4)Cl)Cl. | sci_bench/chemistry/count_Hs_22 |
|
How many hydrogens are in the following organic molecule? | [106, 107, 108, 109] | 1 | Its SMILES notation is CC1=CC(=C(C=C1F)F)CC(=O)N(CCN=C(CN(CCN=C(CN(C)CCN(C)C)O)C(=O)CN2C=CC(=N)N=C2O)O)CC(=NCCN(CC(=NCCN(CC(=NCCN(CC(=NCCN(CC(=NCCN3CCOCC3)O)C(=O)CN4C=NC5=C4NC(=N)N=C5O)O)C(=O)CN6C=NC7=C(N=CN=C76)N)O)C(=O)CN8C=CC(=N)N=C8O)O)C(=O)CN9C=NC1=C9NC(=N)N=C1O)O. | sci_bench/chemistry/count_Hs_23 |
|
How many hydrogens are in the following organic molecule? | [26, 27, 28, 29] | 1 | Its SMILES notation is CC(C)(C)C1=CC=C(C=C1)CCNC(=NC)NCCC(F)(F)F.I. | sci_bench/chemistry/count_Hs_24 |
|
How many hydrogens are in the following organic molecule? | [5, 6, 7, 8] | 3 | Its SMILES notation is CC(C1=CC=CC=C1Cl)C(F)(F)F. | sci_bench/chemistry/count_Hs_25 |
|
How many hydrogens are in the following organic molecule? | [48, 49, 50, 51] | 0 | Its SMILES notation is C[N+]1(CCC2=CC(=C(C=C2C1CC3=CC(=C(C(=C3)OC)OC)OC)OC)OC)CCCC(CCCCCC(=O)O)C(=O)O. | sci_bench/chemistry/count_Hs_26 |
|
How many hydrogens are in the following organic molecule? | [13, 14, 15, 16] | 0 | Its SMILES notation is CC(CNC(=O)C1=CC(=NC=C1)Cl)C2=C(C=CC=C2Cl)Cl. | sci_bench/chemistry/count_Hs_27 |
|
How many hydrogens are in the following organic molecule? | [30, 31, 32, 33] | 0 | Its SMILES notation is CC1CCCC(C1C)NC(=O)NC(=O)COC2=C(C=C(C=C2)C=CC(=O)OC)OC. | sci_bench/chemistry/count_Hs_28 |
|
How many hydrogens are in the following organic molecule? | [25, 26, 27, 28] | 1 | Its SMILES notation is CC1CN(CC(O1)C2=CN(N=C2)C3CC3)C4=NC5=NC(=CN=C5C(=N4)C67CC(C6)(C7)C(F)(F)F)C. | sci_bench/chemistry/count_Hs_29 |
|
How many hydrogens are in the following organic molecule? | [28, 29, 30, 31] | 2 | Its SMILES notation is CC12CCCC1C3CC(C4=CC(CCC4(C3CC2)C)O)O. | sci_bench/chemistry/count_Hs_30 |
|
How many hydrogens are in the following organic molecule? | [31, 32, 33, 34] | 3 | Its SMILES notation is CC(C(=O)NCC1=CC=CC=C1C[NH+](C)C)NS(=O)(=O)C2=CC=C(C=C2)C(C)(C)C. | sci_bench/chemistry/count_Hs_31 |
|
How many hydrogens are in the following organic molecule? | [40, 41, 42, 43] | 3 | Its SMILES notation is CC(C)(C)OC(=O)NC(C1=CC=CC=C1)C(=O)NC(C2=CC(=C(C(=C2)O)OC)O)C(=O)NC(C3=CC=CC=C3)C(=O)NC(CC4=CC=C(C=C4)Cl)C(=O)OC. | sci_bench/chemistry/count_Hs_32 |
|
How many hydrogens are in the following organic molecule? | [10, 11, 12, 13] | 1 | Its SMILES notation is C1OCOC(O1)C2=[N+](C=CC3=CC=CC=C32)[O-]. | sci_bench/chemistry/count_Hs_33 |
|
How many hydrogens are in the following organic molecule? | [25, 26, 27, 28] | 1 | Its SMILES notation is C1C2CC3(CC1CC(C2)(C3)Br)CC(=O)NCC4=CN(N=C4)C5=CC=CC=C5. | sci_bench/chemistry/count_Hs_34 |
|
How many hydrogens are in the following organic molecule? | [22, 23, 24, 25] | 2 | Its SMILES notation is CC1=CC=CC=C1NC(=O)CSC2=C(C(C(=C(N2)C)C(=O)OCC=C)C3=CC=C(C=C3)Cl)C#N. | sci_bench/chemistry/count_Hs_35 |
|
How many hydrogens are in the following organic molecule? | [31, 32, 33, 34] | 2 | Its SMILES notation is CC(C)CC(C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CO)C(=O)O)NC(=O)C(CC(=O)N)N. | sci_bench/chemistry/count_Hs_36 |
|
How many hydrogens are in the following organic molecule? | [19, 20, 21, 22] | 1 | Its SMILES notation is CCOC(=O)C1=CN=C2C(=CC(=CC2=C1NCC3=CC(=C(C=C3)OC)Cl)C#N)C(=O)OC. | sci_bench/chemistry/count_Hs_37 |
|
How many hydrogens are in the following organic molecule? | [4, 5, 6, 7] | 3 | Its SMILES notation is C1=CC2=C(C=C1[N+](=O)[O-])OC(C(=O)N2)CC(=O)[O-]. | sci_bench/chemistry/count_Hs_38 |
|
How many hydrogens are in the following organic molecule? | [23, 24, 25, 26] | 2 | Its SMILES notation is CCC(C(=O)NC1=CC=CC(=C1)C(=O)NC2=NCC(=O)C2)OC3=C(C=C(C=C3)C)C. | sci_bench/chemistry/count_Hs_39 |
|
How many hydrogens are in the following organic molecule? | [24, 25, 26, 27] | 2 | Its SMILES notation is CC1=C(C(=NC2=NC(=NN12)SC)C)CC(=O)NC3=CC=C(C=C3)NCCC4=CC=CC=C4. | sci_bench/chemistry/count_Hs_40 |
|
How many hydrogens are in the following organic molecule? | [29, 30, 31, 32] | 3 | Its SMILES notation is CC1CC2C3CCC4=CC(=NOCC5=CC(=CN=C5)Br)C=CC4(C3(C(CC2C1(C(=O)CO)O)O)F)C. | sci_bench/chemistry/count_Hs_41 |
|
How many hydrogens are in the following organic molecule? | [25, 26, 27, 28] | 2 | Its SMILES notation is C1CCN(C1)CC2=CC(=CC=C2)C(=O)N3CCCC(C3)C4=NC(=NO4)C5=CC(=CC=C5)F. | sci_bench/chemistry/count_Hs_42 |
|
How many hydrogens are in the following organic molecule? | [9, 10, 11, 12] | 3 | Its SMILES notation is CN1N=C(N=N1)C2CC(CC(C2)Cl)Cl. | sci_bench/chemistry/count_Hs_43 |
|
How many hydrogens are in the following organic molecule? | [16, 17, 18, 19] | 0 | Its SMILES notation is CC1=CSC(=N1)CNC2CC3CCC2O3. | sci_bench/chemistry/count_Hs_44 |
|
How many hydrogens are in the following organic molecule? | [9, 10, 11, 12] | 2 | Its SMILES notation is CC1=C(C=C(S1)C(C2=CC=NN2C)O)Br. | sci_bench/chemistry/count_Hs_45 |
|
How many hydrogens are in the following organic molecule? | [16, 17, 18, 19] | 2 | Its SMILES notation is CCCCN1CNC2C1C=CC=C2. | sci_bench/chemistry/count_Hs_46 |
|
How many hydrogens are in the following organic molecule? | [13, 14, 15, 16] | 0 | Its SMILES notation is CC(C(=O)[O-])N(C1=CC=C(C=C1)Br)S(=O)(=O)C2=CC=CC=C2. | sci_bench/chemistry/count_Hs_47 |
|
How many hydrogens are in the following organic molecule? | [12, 13, 14, 15] | 3 | Its SMILES notation is CNS(=O)(=O)C1=CC(=CC=C1)S(=O)(=O)NCC(=O)NCC#C. | sci_bench/chemistry/count_Hs_48 |
|
How many hydrogens are in the following organic molecule? | [15, 16, 17, 18] | 2 | Its SMILES notation is CC1=C(C=CC(=C1)C2(COC2)C3(CCC3)C(=O)O)F. | sci_bench/chemistry/count_Hs_49 |
End of preview. Expand
in Dataset Viewer.
README.md exists but content is empty.
Use the Edit dataset card button to edit it.
- Downloads last month
- 41